diff --git a/.env.development b/.env.development index bd608ea7..521e2116 100644 --- a/.env.development +++ b/.env.development @@ -11,7 +11,7 @@ VITE_APP_NAME = "Core Network OMC" VITE_APP_CODE = "OMC" # 应用版本 -VITE_APP_VERSION = "2.240815" +VITE_APP_VERSION = "2.240920" # 接口基础URL地址-不带/后缀 VITE_API_BASE_URL = "/omc-api" diff --git a/.env.production b/.env.production index 338182a5..0859613f 100644 --- a/.env.production +++ b/.env.production @@ -11,7 +11,7 @@ VITE_APP_NAME = "Core Network OMC" VITE_APP_CODE = "OMC" # 应用版本 -VITE_APP_VERSION = "2.240815" +VITE_APP_VERSION = "2.240920" # 接口基础URL地址-不带/后缀 VITE_API_BASE_URL = "/omc-api" diff --git a/public/wiregasm/test_ethernet.pcap b/public/wiregasm/test_ethernet.pcap new file mode 100644 index 00000000..1d01bd91 Binary files /dev/null and b/public/wiregasm/test_ethernet.pcap differ diff --git a/public/wiregasm/wiregasm.data.gz b/public/wiregasm/wiregasm.data.gz new file mode 100644 index 00000000..f20ebd34 Binary files /dev/null and b/public/wiregasm/wiregasm.data.gz differ diff --git a/public/wiregasm/wiregasm.js b/public/wiregasm/wiregasm.js new file mode 100644 index 00000000..fa704402 --- /dev/null +++ b/public/wiregasm/wiregasm.js @@ -0,0 +1,9768 @@ + +var loadWiregasm = (() => { + var _scriptDir = typeof document !== 'undefined' && document.currentScript ? document.currentScript.src : undefined; + if (typeof __filename !== 'undefined') _scriptDir = _scriptDir || __filename; + return ( +function(loadWiregasm = {}) { + +// include: shell.js +// The Module object: Our interface to the outside world. We import +// and export values on it. There are various ways Module can be used: +// 1. Not defined. We create it here +// 2. A function parameter, function(Module) { ..generated code.. } +// 3. pre-run appended it, var Module = {}; ..generated code.. +// 4. External script tag defines var Module. +// We need to check if Module already exists (e.g. case 3 above). +// Substitution will be replaced with actual code on later stage of the build, +// this way Closure Compiler will not mangle it (e.g. case 4. above). +// Note that if you want to run closure, and also to use Module +// after the generated code, you will need to define var Module = {}; +// before the code. Then that object will be used in the code, and you +// can continue to use Module afterwards as well. +var Module = typeof loadWiregasm != 'undefined' ? loadWiregasm : {}; + +// Set up the promise that indicates the Module is initialized +var readyPromiseResolve, readyPromiseReject; +Module['ready'] = new Promise(function(resolve, reject) { + readyPromiseResolve = resolve; + readyPromiseReject = reject; +}); +["_malloc","_fflush","___getTypeName","__embind_initialize_bindings","onRuntimeInitialized"].forEach((prop) => { + if (!Object.getOwnPropertyDescriptor(Module['ready'], prop)) { + Object.defineProperty(Module['ready'], prop, { + get: () => abort('You are getting ' + prop + ' on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js'), + set: () => abort('You are setting ' + prop + ' on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js'), + }); + } +}); + +// --pre-jses are emitted after the Module integration code, so that they can +// refer to Module (if they choose; they can also define Module) + + if (!Module.expectedDataFileDownloads) { + Module.expectedDataFileDownloads = 0; + } + + Module.expectedDataFileDownloads++; + (function() { + // When running as a pthread, FS operations are proxied to the main thread, so we don't need to + // fetch the .data bundle on the worker + if (Module['ENVIRONMENT_IS_PTHREAD']) return; + var loadPackage = function(metadata) { + + var PACKAGE_PATH = ''; + if (typeof window === 'object') { + PACKAGE_PATH = window['encodeURIComponent'](window.location.pathname.toString().substring(0, window.location.pathname.toString().lastIndexOf('/')) + '/'); + } else if (typeof process === 'undefined' && typeof location !== 'undefined') { + // web worker + PACKAGE_PATH = encodeURIComponent(location.pathname.toString().substring(0, location.pathname.toString().lastIndexOf('/')) + '/'); + } + var PACKAGE_NAME = 'wiregasm.data'; + var REMOTE_PACKAGE_BASE = 'wiregasm.data'; + if (typeof Module['locateFilePackage'] === 'function' && !Module['locateFile']) { + Module['locateFile'] = Module['locateFilePackage']; + err('warning: you defined Module.locateFilePackage, that has been renamed to Module.locateFile (using your locateFilePackage for now)'); + } + var REMOTE_PACKAGE_NAME = Module['locateFile'] ? Module['locateFile'](REMOTE_PACKAGE_BASE, '') : REMOTE_PACKAGE_BASE; +var REMOTE_PACKAGE_SIZE = metadata['remote_package_size']; + + function fetchRemotePackage(packageName, packageSize, callback, errback) { + if (typeof process === 'object' && typeof process.versions === 'object' && typeof process.versions.node === 'string') { + require('fs').readFile(packageName, function(err, contents) { + if (err) { + errback(err); + } else { + callback(contents.buffer); + } + }); + return; + } + var xhr = new XMLHttpRequest(); + xhr.open('GET', packageName, true); + xhr.responseType = 'arraybuffer'; + xhr.onprogress = function(event) { + var url = packageName; + var size = packageSize; + if (event.total) size = event.total; + if (event.loaded) { + if (!xhr.addedTotal) { + xhr.addedTotal = true; + if (!Module.dataFileDownloads) Module.dataFileDownloads = {}; + Module.dataFileDownloads[url] = { + loaded: event.loaded, + total: size + }; + } else { + Module.dataFileDownloads[url].loaded = event.loaded; + } + var total = 0; + var loaded = 0; + var num = 0; + for (var download in Module.dataFileDownloads) { + var data = Module.dataFileDownloads[download]; + total += data.total; + loaded += data.loaded; + num++; + } + total = Math.ceil(total * Module.expectedDataFileDownloads/num); + if (Module['setStatus']) Module['setStatus']('Downloading data... (' + loaded + '/' + total + ')'); + } else if (!Module.dataFileDownloads) { + if (Module['setStatus']) Module['setStatus']('Downloading data...'); + } + }; + xhr.onerror = function(event) { + throw new Error("NetworkError for: " + packageName); + } + xhr.onload = function(event) { + if (xhr.status == 200 || xhr.status == 304 || xhr.status == 206 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0 + var packageData = xhr.response; + callback(packageData); + } else { + throw new Error(xhr.statusText + " : " + xhr.responseURL); + } + }; + xhr.send(null); + }; + + function handleError(error) { + console.error('package error:', error); + }; + + var fetchedCallback = null; + var fetched = Module['getPreloadedPackage'] ? Module['getPreloadedPackage'](REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE) : null; + + if (!fetched) fetchRemotePackage(REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE, function(data) { + if (fetchedCallback) { + fetchedCallback(data); + fetchedCallback = null; + } else { + fetched = data; + } + }, handleError); + + function runWithFS() { + + function assert(check, msg) { + if (!check) throw msg + new Error().stack; + } +Module['FS_createPath']("/", "wireshark", true, true); +Module['FS_createPath']("/wireshark", "diameter", true, true); +Module['FS_createPath']("/wireshark", "dtds", true, true); +Module['FS_createPath']("/wireshark", "profiles", true, true); +Module['FS_createPath']("/wireshark/profiles", "Bluetooth", true, true); +Module['FS_createPath']("/wireshark/profiles", "Classic", true, true); +Module['FS_createPath']("/wireshark/profiles", "No Reassembly", true, true); +Module['FS_createPath']("/wireshark", "radius", true, true); +Module['FS_createPath']("/wireshark", "tpncp", true, true); +Module['FS_createPath']("/wireshark", "wimaxasncp", true, true); + + /** @constructor */ + function DataRequest(start, end, audio) { + this.start = start; + this.end = end; + this.audio = audio; + } + DataRequest.prototype = { + requests: {}, + open: function(mode, name) { + this.name = name; + this.requests[name] = this; + Module['addRunDependency']('fp ' + this.name); + }, + send: function() {}, + onload: function() { + var byteArray = this.byteArray.subarray(this.start, this.end); + this.finish(byteArray); + }, + finish: function(byteArray) { + var that = this; + // canOwn this data in the filesystem, it is a slide into the heap that will never change + Module['FS_createDataFile'](this.name, null, byteArray, true, true, true); + Module['removeRunDependency']('fp ' + that.name); + this.requests[this.name] = null; + } + }; + + var files = metadata['files']; + for (var i = 0; i < files.length; ++i) { + new DataRequest(files[i]['start'], files[i]['end'], files[i]['audio'] || 0).open('GET', files[i]['filename']); + } + + function processPackageData(arrayBuffer) { + assert(arrayBuffer, 'Loading data file failed.'); + assert(arrayBuffer.constructor.name === ArrayBuffer.name, 'bad input to processPackageData'); + var byteArray = new Uint8Array(arrayBuffer); + var curr; + // Reuse the bytearray from the XHR as the source for file reads. + DataRequest.prototype.byteArray = byteArray; + var files = metadata['files']; + for (var i = 0; i < files.length; ++i) { + DataRequest.prototype.requests[files[i].filename].onload(); + } Module['removeRunDependency']('datafile_wiregasm.data'); + + }; + Module['addRunDependency']('datafile_wiregasm.data'); + + if (!Module.preloadResults) Module.preloadResults = {}; + + Module.preloadResults[PACKAGE_NAME] = {fromCache: false}; + if (fetched) { + processPackageData(fetched); + fetched = null; + } else { + fetchedCallback = processPackageData; + } + + } + if (Module['calledRun']) { + runWithFS(); + } else { + if (!Module['preRun']) Module['preRun'] = []; + Module["preRun"].push(runWithFS); // FS is not initialized yet, wait for it + } + + } + loadPackage({"files": [{"filename": "/wireshark/Acknowledgements.md", "start": 0, "end": 1544}, {"filename": "/wireshark/COPYING", "start": 1544, "end": 19636}, {"filename": "/wireshark/cfilters", "start": 19636, "end": 20218}, {"filename": "/wireshark/colorfilters", "start": 20218, "end": 22209}, {"filename": "/wireshark/console.lua", "start": 22209, "end": 24730}, {"filename": "/wireshark/dfilter_macros", "start": 24730, "end": 25028}, {"filename": "/wireshark/dfilters", "start": 25028, "end": 25682}, {"filename": "/wireshark/diameter/AlcatelLucent.xml", "start": 25682, "end": 27819}, {"filename": "/wireshark/diameter/Cisco.xml", "start": 27819, "end": 76499}, {"filename": "/wireshark/diameter/CiscoSystems.xml", "start": 76499, "end": 85544}, {"filename": "/wireshark/diameter/Custom.xml", "start": 85544, "end": 85881}, {"filename": "/wireshark/diameter/Ericsson.xml", "start": 85881, "end": 109674}, {"filename": "/wireshark/diameter/HP.xml", "start": 109674, "end": 111296}, {"filename": "/wireshark/diameter/Huawei.xml", "start": 111296, "end": 115724}, {"filename": "/wireshark/diameter/Inovar.xml", "start": 115724, "end": 118805}, {"filename": "/wireshark/diameter/Juniper.xml", "start": 118805, "end": 120625}, {"filename": "/wireshark/diameter/Metaswitch.xml", "start": 120625, "end": 124442}, {"filename": "/wireshark/diameter/Microsoft.xml", "start": 124442, "end": 125674}, {"filename": "/wireshark/diameter/Nokia.xml", "start": 125674, "end": 127256}, {"filename": "/wireshark/diameter/NokiaSolutionsAndNetworks.xml", "start": 127256, "end": 132080}, {"filename": "/wireshark/diameter/Oracle.xml", "start": 132080, "end": 132931}, {"filename": "/wireshark/diameter/Siemens.xml", "start": 132931, "end": 133571}, {"filename": "/wireshark/diameter/Starent.xml", "start": 133571, "end": 231424}, {"filename": "/wireshark/diameter/TGPP.xml", "start": 231424, "end": 322202}, {"filename": "/wireshark/diameter/TGPP2.xml", "start": 322202, "end": 327806}, {"filename": "/wireshark/diameter/Telefonica.xml", "start": 327806, "end": 339243}, {"filename": "/wireshark/diameter/VerizonWireless.xml", "start": 339243, "end": 342106}, {"filename": "/wireshark/diameter/Vodafone.xml", "start": 342106, "end": 345551}, {"filename": "/wireshark/diameter/chargecontrol.xml", "start": 345551, "end": 356078}, {"filename": "/wireshark/diameter/dictionary.dtd", "start": 356078, "end": 357945}, {"filename": "/wireshark/diameter/dictionary.xml", "start": 357945, "end": 761217}, {"filename": "/wireshark/diameter/eap.xml", "start": 761217, "end": 761770}, {"filename": "/wireshark/diameter/etsie2e4.xml", "start": 761770, "end": 777307}, {"filename": "/wireshark/diameter/mobileipv4.xml", "start": 777307, "end": 784108}, {"filename": "/wireshark/diameter/mobileipv6.xml", "start": 784108, "end": 786853}, {"filename": "/wireshark/diameter/nasreq.xml", "start": 786853, "end": 790798}, {"filename": "/wireshark/diameter/sip.xml", "start": 790798, "end": 797924}, {"filename": "/wireshark/diameter/sunping.xml", "start": 797924, "end": 798711}, {"filename": "/wireshark/dtd_gen.lua", "start": 798711, "end": 806408}, {"filename": "/wireshark/dtds/dc.dtd", "start": 806408, "end": 807189}, {"filename": "/wireshark/dtds/itunes.dtd", "start": 807189, "end": 807713}, {"filename": "/wireshark/dtds/mscml.dtd", "start": 807713, "end": 815254}, {"filename": "/wireshark/dtds/pocsettings.dtd", "start": 815254, "end": 816169}, {"filename": "/wireshark/dtds/presence.dtd", "start": 816169, "end": 816743}, {"filename": "/wireshark/dtds/reginfo.dtd", "start": 816743, "end": 817851}, {"filename": "/wireshark/dtds/rlmi.dtd", "start": 817851, "end": 818621}, {"filename": "/wireshark/dtds/rss.dtd", "start": 818621, "end": 821016}, {"filename": "/wireshark/dtds/smil.dtd", "start": 821016, "end": 828576}, {"filename": "/wireshark/dtds/watcherinfo.dtd", "start": 828576, "end": 829377}, {"filename": "/wireshark/dtds/xcap-caps.dtd", "start": 829377, "end": 829675}, {"filename": "/wireshark/dtds/xcap-error.dtd", "start": 829675, "end": 831248}, {"filename": "/wireshark/enterprises.tsv", "start": 831248, "end": 2466565}, {"filename": "/wireshark/gpl-2.0-standalone.html", "start": 2466565, "end": 2486571}, {"filename": "/wireshark/init.lua", "start": 2486571, "end": 2504293}, {"filename": "/wireshark/ipmap.html", "start": 2504293, "end": 2518221}, {"filename": "/wireshark/manuf", "start": 2518221, "end": 4606127}, {"filename": "/wireshark/pdml2html.xsl", "start": 4606127, "end": 4612530}, {"filename": "/wireshark/profiles/Bluetooth/colorfilters", "start": 4612530, "end": 4615666}, {"filename": "/wireshark/profiles/Bluetooth/preferences", "start": 4615666, "end": 4616056}, {"filename": "/wireshark/profiles/Classic/colorfilters", "start": 4616056, "end": 4617788}, {"filename": "/wireshark/profiles/No Reassembly/preferences", "start": 4617788, "end": 4622527}, {"filename": "/wireshark/radius/README.radius_dictionary", "start": 4622527, "end": 4625375}, {"filename": "/wireshark/radius/custom.includes", "start": 4625375, "end": 4625462}, {"filename": "/wireshark/radius/dictionary", "start": 4625462, "end": 4636249}, {"filename": "/wireshark/radius/dictionary.3com", "start": 4636249, "end": 4637748}, {"filename": "/wireshark/radius/dictionary.3gpp", "start": 4637748, "end": 4641414}, {"filename": "/wireshark/radius/dictionary.3gpp2", "start": 4641414, "end": 4656730}, {"filename": "/wireshark/radius/dictionary.acc", "start": 4656730, "end": 4667650}, {"filename": "/wireshark/radius/dictionary.acme", "start": 4667650, "end": 4677255}, {"filename": "/wireshark/radius/dictionary.actelis", "start": 4677255, "end": 4677680}, {"filename": "/wireshark/radius/dictionary.aerohive", "start": 4677680, "end": 4678505}, {"filename": "/wireshark/radius/dictionary.airespace", "start": 4678505, "end": 4680075}, {"filename": "/wireshark/radius/dictionary.alcatel", "start": 4680075, "end": 4683727}, {"filename": "/wireshark/radius/dictionary.alcatel-lucent.aaa", "start": 4683727, "end": 4687030}, {"filename": "/wireshark/radius/dictionary.alcatel.esam", "start": 4687030, "end": 4694607}, {"filename": "/wireshark/radius/dictionary.alcatel.sr", "start": 4694607, "end": 4697352}, {"filename": "/wireshark/radius/dictionary.alteon", "start": 4697352, "end": 4698316}, {"filename": "/wireshark/radius/dictionary.altiga", "start": 4698316, "end": 4705760}, {"filename": "/wireshark/radius/dictionary.alvarion", "start": 4705760, "end": 4717662}, {"filename": "/wireshark/radius/dictionary.alvarion.wimax.v2_2", "start": 4717662, "end": 4718876}, {"filename": "/wireshark/radius/dictionary.apc", "start": 4718876, "end": 4720010}, {"filename": "/wireshark/radius/dictionary.aptilo", "start": 4720010, "end": 4726030}, {"filename": "/wireshark/radius/dictionary.aptis", "start": 4726030, "end": 4734479}, {"filename": "/wireshark/radius/dictionary.arbor", "start": 4734479, "end": 4734974}, {"filename": "/wireshark/radius/dictionary.aruba", "start": 4734974, "end": 4737742}, {"filename": "/wireshark/radius/dictionary.ascend", "start": 4737742, "end": 4797227}, {"filename": "/wireshark/radius/dictionary.asn", "start": 4797227, "end": 4800332}, {"filename": "/wireshark/radius/dictionary.audiocodes", "start": 4800332, "end": 4800963}, {"filename": "/wireshark/radius/dictionary.avaya", "start": 4800963, "end": 4801897}, {"filename": "/wireshark/radius/dictionary.azaire", "start": 4801897, "end": 4803497}, {"filename": "/wireshark/radius/dictionary.bay", "start": 4803497, "end": 4815404}, {"filename": "/wireshark/radius/dictionary.bintec", "start": 4815404, "end": 4817025}, {"filename": "/wireshark/radius/dictionary.bluecoat", "start": 4817025, "end": 4817760}, {"filename": "/wireshark/radius/dictionary.bristol", "start": 4817760, "end": 4818244}, {"filename": "/wireshark/radius/dictionary.broadsoft", "start": 4818244, "end": 4835895}, {"filename": "/wireshark/radius/dictionary.brocade", "start": 4835895, "end": 4836583}, {"filename": "/wireshark/radius/dictionary.bskyb", "start": 4836583, "end": 4837240}, {"filename": "/wireshark/radius/dictionary.bt", "start": 4837240, "end": 4837644}, {"filename": "/wireshark/radius/dictionary.cablelabs", "start": 4837644, "end": 4848190}, {"filename": "/wireshark/radius/dictionary.cabletron", "start": 4848190, "end": 4849062}, {"filename": "/wireshark/radius/dictionary.camiant", "start": 4849062, "end": 4849650}, {"filename": "/wireshark/radius/dictionary.chillispot", "start": 4849650, "end": 4851066}, {"filename": "/wireshark/radius/dictionary.cisco", "start": 4851066, "end": 4860339}, {"filename": "/wireshark/radius/dictionary.cisco.asa", "start": 4860339, "end": 4875169}, {"filename": "/wireshark/radius/dictionary.cisco.bbsm", "start": 4875169, "end": 4875572}, {"filename": "/wireshark/radius/dictionary.cisco.vpn3000", "start": 4875572, "end": 4891677}, {"filename": "/wireshark/radius/dictionary.cisco.vpn5000", "start": 4891677, "end": 4892351}, {"filename": "/wireshark/radius/dictionary.citrix", "start": 4892351, "end": 4892987}, {"filename": "/wireshark/radius/dictionary.clavister", "start": 4892987, "end": 4893443}, {"filename": "/wireshark/radius/dictionary.cnergee", "start": 4893443, "end": 4894938}, {"filename": "/wireshark/radius/dictionary.colubris", "start": 4894938, "end": 4895253}, {"filename": "/wireshark/radius/dictionary.columbia_university", "start": 4895253, "end": 4895894}, {"filename": "/wireshark/radius/dictionary.compat", "start": 4895894, "end": 4897408}, {"filename": "/wireshark/radius/dictionary.compatible", "start": 4897408, "end": 4898001}, {"filename": "/wireshark/radius/dictionary.cosine", "start": 4898001, "end": 4898730}, {"filename": "/wireshark/radius/dictionary.dante", "start": 4898730, "end": 4899176}, {"filename": "/wireshark/radius/dictionary.dellemc", "start": 4899176, "end": 4899618}, {"filename": "/wireshark/radius/dictionary.dhcp", "start": 4899618, "end": 4917266}, {"filename": "/wireshark/radius/dictionary.digium", "start": 4917266, "end": 4918511}, {"filename": "/wireshark/radius/dictionary.dlink", "start": 4918511, "end": 4919586}, {"filename": "/wireshark/radius/dictionary.dragonwave", "start": 4919586, "end": 4920383}, {"filename": "/wireshark/radius/dictionary.efficientip", "start": 4920383, "end": 4921363}, {"filename": "/wireshark/radius/dictionary.eltex", "start": 4921363, "end": 4922212}, {"filename": "/wireshark/radius/dictionary.enterasys", "start": 4922212, "end": 4924462}, {"filename": "/wireshark/radius/dictionary.epygi", "start": 4924462, "end": 4928804}, {"filename": "/wireshark/radius/dictionary.equallogic", "start": 4928804, "end": 4930310}, {"filename": "/wireshark/radius/dictionary.ericsson", "start": 4930310, "end": 4936616}, {"filename": "/wireshark/radius/dictionary.ericsson.ab", "start": 4936616, "end": 4964219}, {"filename": "/wireshark/radius/dictionary.ericsson.packet.core.networks", "start": 4964219, "end": 4964521}, {"filename": "/wireshark/radius/dictionary.extreme", "start": 4964521, "end": 4967138}, {"filename": "/wireshark/radius/dictionary.f5", "start": 4967138, "end": 4968953}, {"filename": "/wireshark/radius/dictionary.fdxtended", "start": 4968953, "end": 4969512}, {"filename": "/wireshark/radius/dictionary.fortinet", "start": 4969512, "end": 4970256}, {"filename": "/wireshark/radius/dictionary.foundry", "start": 4970256, "end": 4972169}, {"filename": "/wireshark/radius/dictionary.freedhcp", "start": 4972169, "end": 4989566}, {"filename": "/wireshark/radius/dictionary.freeradius", "start": 4989566, "end": 4995195}, {"filename": "/wireshark/radius/dictionary.freeradius.internal", "start": 4995195, "end": 5022066}, {"filename": "/wireshark/radius/dictionary.freeswitch", "start": 5022066, "end": 5026671}, {"filename": "/wireshark/radius/dictionary.gandalf", "start": 5026671, "end": 5030337}, {"filename": "/wireshark/radius/dictionary.garderos", "start": 5030337, "end": 5030845}, {"filename": "/wireshark/radius/dictionary.gemtek", "start": 5030845, "end": 5031397}, {"filename": "/wireshark/radius/dictionary.h3c", "start": 5031397, "end": 5034667}, {"filename": "/wireshark/radius/dictionary.hp", "start": 5034667, "end": 5037161}, {"filename": "/wireshark/radius/dictionary.huawei", "start": 5037161, "end": 5046427}, {"filename": "/wireshark/radius/dictionary.iana", "start": 5046427, "end": 5047612}, {"filename": "/wireshark/radius/dictionary.identity_engines", "start": 5047612, "end": 5047987}, {"filename": "/wireshark/radius/dictionary.iea", "start": 5047987, "end": 5049009}, {"filename": "/wireshark/radius/dictionary.infoblox", "start": 5049009, "end": 5049495}, {"filename": "/wireshark/radius/dictionary.infonet", "start": 5049495, "end": 5051044}, {"filename": "/wireshark/radius/dictionary.ipunplugged", "start": 5051044, "end": 5051852}, {"filename": "/wireshark/radius/dictionary.issanni", "start": 5051852, "end": 5053158}, {"filename": "/wireshark/radius/dictionary.itk", "start": 5053158, "end": 5054686}, {"filename": "/wireshark/radius/dictionary.jradius", "start": 5054686, "end": 5055103}, {"filename": "/wireshark/radius/dictionary.juniper", "start": 5055103, "end": 5057260}, {"filename": "/wireshark/radius/dictionary.karlnet", "start": 5057260, "end": 5160039}, {"filename": "/wireshark/radius/dictionary.kineto", "start": 5160039, "end": 5164683}, {"filename": "/wireshark/radius/dictionary.lancom", "start": 5164683, "end": 5166060}, {"filename": "/wireshark/radius/dictionary.livingston", "start": 5166060, "end": 5168286}, {"filename": "/wireshark/radius/dictionary.localweb", "start": 5168286, "end": 5169379}, {"filename": "/wireshark/radius/dictionary.lucent", "start": 5169379, "end": 5190548}, {"filename": "/wireshark/radius/dictionary.manzara", "start": 5190548, "end": 5191486}, {"filename": "/wireshark/radius/dictionary.meinberg", "start": 5191486, "end": 5192097}, {"filename": "/wireshark/radius/dictionary.meraki", "start": 5192097, "end": 5192429}, {"filename": "/wireshark/radius/dictionary.merit", "start": 5192429, "end": 5192760}, {"filename": "/wireshark/radius/dictionary.meru", "start": 5192760, "end": 5193071}, {"filename": "/wireshark/radius/dictionary.microsemi", "start": 5193071, "end": 5193639}, {"filename": "/wireshark/radius/dictionary.microsoft", "start": 5193639, "end": 5199927}, {"filename": "/wireshark/radius/dictionary.mikrotik", "start": 5199927, "end": 5202075}, {"filename": "/wireshark/radius/dictionary.motorola", "start": 5202075, "end": 5205148}, {"filename": "/wireshark/radius/dictionary.motorola.wimax", "start": 5205148, "end": 5206468}, {"filename": "/wireshark/radius/dictionary.navini", "start": 5206468, "end": 5206847}, {"filename": "/wireshark/radius/dictionary.netscreen", "start": 5206847, "end": 5207798}, {"filename": "/wireshark/radius/dictionary.networkphysics", "start": 5207798, "end": 5208300}, {"filename": "/wireshark/radius/dictionary.nexans", "start": 5208300, "end": 5208904}, {"filename": "/wireshark/radius/dictionary.nokia", "start": 5208904, "end": 5210261}, {"filename": "/wireshark/radius/dictionary.nokia.conflict", "start": 5210261, "end": 5211320}, {"filename": "/wireshark/radius/dictionary.nomadix", "start": 5211320, "end": 5212417}, {"filename": "/wireshark/radius/dictionary.nortel", "start": 5212417, "end": 5214772}, {"filename": "/wireshark/radius/dictionary.ntua", "start": 5214772, "end": 5216108}, {"filename": "/wireshark/radius/dictionary.openser", "start": 5216108, "end": 5217507}, {"filename": "/wireshark/radius/dictionary.packeteer", "start": 5217507, "end": 5218121}, {"filename": "/wireshark/radius/dictionary.paloalto", "start": 5218121, "end": 5218748}, {"filename": "/wireshark/radius/dictionary.patton", "start": 5218748, "end": 5227269}, {"filename": "/wireshark/radius/dictionary.perle", "start": 5227269, "end": 5249969}, {"filename": "/wireshark/radius/dictionary.propel", "start": 5249969, "end": 5250460}, {"filename": "/wireshark/radius/dictionary.prosoft", "start": 5250460, "end": 5251783}, {"filename": "/wireshark/radius/dictionary.proxim", "start": 5251783, "end": 5254944}, {"filename": "/wireshark/radius/dictionary.purewave", "start": 5254944, "end": 5256489}, {"filename": "/wireshark/radius/dictionary.quiconnect", "start": 5256489, "end": 5257016}, {"filename": "/wireshark/radius/dictionary.quintum", "start": 5257016, "end": 5258564}, {"filename": "/wireshark/radius/dictionary.redcreek", "start": 5258564, "end": 5259239}, {"filename": "/wireshark/radius/dictionary.rfc2865", "start": 5259239, "end": 5263348}, {"filename": "/wireshark/radius/dictionary.rfc2866", "start": 5263348, "end": 5265197}, {"filename": "/wireshark/radius/dictionary.rfc2867", "start": 5265197, "end": 5265769}, {"filename": "/wireshark/radius/dictionary.rfc2868", "start": 5265769, "end": 5267487}, {"filename": "/wireshark/radius/dictionary.rfc2869", "start": 5267487, "end": 5268604}, {"filename": "/wireshark/radius/dictionary.rfc3162", "start": 5268604, "end": 5269073}, {"filename": "/wireshark/radius/dictionary.rfc3576", "start": 5269073, "end": 5270112}, {"filename": "/wireshark/radius/dictionary.rfc3580", "start": 5270112, "end": 5270631}, {"filename": "/wireshark/radius/dictionary.rfc4072", "start": 5270631, "end": 5270779}, {"filename": "/wireshark/radius/dictionary.rfc4372", "start": 5270779, "end": 5270936}, {"filename": "/wireshark/radius/dictionary.rfc4603", "start": 5270936, "end": 5271495}, {"filename": "/wireshark/radius/dictionary.rfc4675", "start": 5271495, "end": 5272281}, {"filename": "/wireshark/radius/dictionary.rfc4679", "start": 5272281, "end": 5274206}, {"filename": "/wireshark/radius/dictionary.rfc4818", "start": 5274206, "end": 5274636}, {"filename": "/wireshark/radius/dictionary.rfc4849", "start": 5274636, "end": 5274897}, {"filename": "/wireshark/radius/dictionary.rfc5090", "start": 5274897, "end": 5275894}, {"filename": "/wireshark/radius/dictionary.rfc5176", "start": 5275894, "end": 5276227}, {"filename": "/wireshark/radius/dictionary.rfc5447", "start": 5276227, "end": 5276643}, {"filename": "/wireshark/radius/dictionary.rfc5580", "start": 5276643, "end": 5277805}, {"filename": "/wireshark/radius/dictionary.rfc5607", "start": 5277805, "end": 5278736}, {"filename": "/wireshark/radius/dictionary.rfc5904", "start": 5278736, "end": 5279341}, {"filename": "/wireshark/radius/dictionary.rfc6519", "start": 5279341, "end": 5279607}, {"filename": "/wireshark/radius/dictionary.rfc6572", "start": 5279607, "end": 5280735}, {"filename": "/wireshark/radius/dictionary.rfc6677", "start": 5280735, "end": 5281312}, {"filename": "/wireshark/radius/dictionary.rfc6911", "start": 5281312, "end": 5281724}, {"filename": "/wireshark/radius/dictionary.rfc6929", "start": 5281724, "end": 5282683}, {"filename": "/wireshark/radius/dictionary.rfc6930", "start": 5282683, "end": 5283038}, {"filename": "/wireshark/radius/dictionary.rfc7055", "start": 5283038, "end": 5283416}, {"filename": "/wireshark/radius/dictionary.rfc7155", "start": 5283416, "end": 5283803}, {"filename": "/wireshark/radius/dictionary.rfc7268", "start": 5283803, "end": 5286167}, {"filename": "/wireshark/radius/dictionary.rfc7499", "start": 5286167, "end": 5286634}, {"filename": "/wireshark/radius/dictionary.rfc7930", "start": 5286634, "end": 5286908}, {"filename": "/wireshark/radius/dictionary.riverbed", "start": 5286908, "end": 5287505}, {"filename": "/wireshark/radius/dictionary.riverstone", "start": 5287505, "end": 5288642}, {"filename": "/wireshark/radius/dictionary.roaringpenguin", "start": 5288642, "end": 5289385}, {"filename": "/wireshark/radius/dictionary.ruckus", "start": 5289385, "end": 5294490}, {"filename": "/wireshark/radius/dictionary.ruggedcom", "start": 5294490, "end": 5294695}, {"filename": "/wireshark/radius/dictionary.sangoma", "start": 5294695, "end": 5299117}, {"filename": "/wireshark/radius/dictionary.sg", "start": 5299117, "end": 5305129}, {"filename": "/wireshark/radius/dictionary.shasta", "start": 5305129, "end": 5305685}, {"filename": "/wireshark/radius/dictionary.shiva", "start": 5305685, "end": 5309909}, {"filename": "/wireshark/radius/dictionary.siemens", "start": 5309909, "end": 5310691}, {"filename": "/wireshark/radius/dictionary.slipstream", "start": 5310691, "end": 5311227}, {"filename": "/wireshark/radius/dictionary.sofaware", "start": 5311227, "end": 5312367}, {"filename": "/wireshark/radius/dictionary.sonicwall", "start": 5312367, "end": 5315088}, {"filename": "/wireshark/radius/dictionary.springtide", "start": 5315088, "end": 5316153}, {"filename": "/wireshark/radius/dictionary.starent", "start": 5316153, "end": 5377025}, {"filename": "/wireshark/radius/dictionary.starent.vsa1", "start": 5377025, "end": 5432741}, {"filename": "/wireshark/radius/dictionary.surfnet", "start": 5432741, "end": 5433245}, {"filename": "/wireshark/radius/dictionary.symbol", "start": 5433245, "end": 5436468}, {"filename": "/wireshark/radius/dictionary.t_systems_nova", "start": 5436468, "end": 5437730}, {"filename": "/wireshark/radius/dictionary.telebit", "start": 5437730, "end": 5438213}, {"filename": "/wireshark/radius/dictionary.telkom", "start": 5438213, "end": 5439217}, {"filename": "/wireshark/radius/dictionary.terena", "start": 5439217, "end": 5439575}, {"filename": "/wireshark/radius/dictionary.trapeze", "start": 5439575, "end": 5441019}, {"filename": "/wireshark/radius/dictionary.travelping", "start": 5441019, "end": 5444185}, {"filename": "/wireshark/radius/dictionary.tropos", "start": 5444185, "end": 5446350}, {"filename": "/wireshark/radius/dictionary.ukerna", "start": 5446350, "end": 5447290}, {"filename": "/wireshark/radius/dictionary.unisphere", "start": 5447290, "end": 5462671}, {"filename": "/wireshark/radius/dictionary.unix", "start": 5462671, "end": 5463124}, {"filename": "/wireshark/radius/dictionary.usr", "start": 5463124, "end": 5537242}, {"filename": "/wireshark/radius/dictionary.utstarcom", "start": 5537242, "end": 5538908}, {"filename": "/wireshark/radius/dictionary.valemount", "start": 5538908, "end": 5539641}, {"filename": "/wireshark/radius/dictionary.verizon", "start": 5539641, "end": 5540454}, {"filename": "/wireshark/radius/dictionary.versanet", "start": 5540454, "end": 5542598}, {"filename": "/wireshark/radius/dictionary.vqp", "start": 5542598, "end": 5545706}, {"filename": "/wireshark/radius/dictionary.walabi", "start": 5545706, "end": 5546670}, {"filename": "/wireshark/radius/dictionary.waverider", "start": 5546670, "end": 5548634}, {"filename": "/wireshark/radius/dictionary.wichorus", "start": 5548634, "end": 5549207}, {"filename": "/wireshark/radius/dictionary.wimax", "start": 5549207, "end": 5565476}, {"filename": "/wireshark/radius/dictionary.wimax.alvarion", "start": 5565476, "end": 5584887}, {"filename": "/wireshark/radius/dictionary.wimax.wichorus", "start": 5584887, "end": 5600312}, {"filename": "/wireshark/radius/dictionary.wispr", "start": 5600312, "end": 5601341}, {"filename": "/wireshark/radius/dictionary.xedia", "start": 5601341, "end": 5602166}, {"filename": "/wireshark/radius/dictionary.xylan", "start": 5602166, "end": 5603707}, {"filename": "/wireshark/radius/dictionary.yubico", "start": 5603707, "end": 5604349}, {"filename": "/wireshark/radius/dictionary.zeus", "start": 5604349, "end": 5604551}, {"filename": "/wireshark/radius/dictionary.zte", "start": 5604551, "end": 5607147}, {"filename": "/wireshark/radius/dictionary.zyxel", "start": 5607147, "end": 5607912}, {"filename": "/wireshark/services", "start": 5607912, "end": 5877761}, {"filename": "/wireshark/smi_modules", "start": 5877761, "end": 5878076}, {"filename": "/wireshark/tpncp/tpncp.dat", "start": 5878076, "end": 6528250}, {"filename": "/wireshark/wimaxasncp/dictionary.dtd", "start": 6528250, "end": 6528557}, {"filename": "/wireshark/wimaxasncp/dictionary.xml", "start": 6528557, "end": 6620048}, {"filename": "/wireshark/wka", "start": 6620048, "end": 6631269}, {"filename": "/wireshark/ws.css", "start": 6631269, "end": 6671939}], "remote_package_size": 6671939}); + + })(); + + + // All the pre-js content up to here must remain later on, we need to run + // it. + if (Module['ENVIRONMENT_IS_PTHREAD']) Module['preRun'] = []; + var necessaryPreJSTasks = Module['preRun'].slice(); + +// defaults + +if (!Module["print"]) + Module.print = function (text) { + console.log(text); + }; + +if (!Module["printErr"]) + Module.printErr = function (text) { + console.warn(text); + }; + +if (!Module["handleStatus"]) + Module.handleStatus = function (type, status) { + console.log(type, status); + }; + +// initialize FS with directories +Module["onRuntimeInitialized"] = () => { + Module.FS.mkdir("/plugins"); + Module.FS.mkdir("/uploads"); +}; + + if (!Module['preRun']) throw 'Module.preRun should exist because file support used it; did a pre-js delete it?'; + necessaryPreJSTasks.forEach(function(task) { + if (Module['preRun'].indexOf(task) < 0) throw 'All preRun tasks that exist before user pre-js code should remain after; did you replace Module or modify Module.preRun?'; + }); + + + +// Sometimes an existing Module object exists with properties +// meant to overwrite the default module functionality. Here +// we collect those properties and reapply _after_ we configure +// the current environment's defaults to avoid having to be so +// defensive during initialization. +var moduleOverrides = Object.assign({}, Module); + +var arguments_ = []; +var thisProgram = './this.program'; +var quit_ = (status, toThrow) => { + throw toThrow; +}; + +// Determine the runtime environment we are in. You can customize this by +// setting the ENVIRONMENT setting at compile time (see settings.js). + +// Attempt to auto-detect the environment +var ENVIRONMENT_IS_WEB = typeof window == 'object'; +var ENVIRONMENT_IS_WORKER = typeof importScripts == 'function'; +// N.b. Electron.js environment is simultaneously a NODE-environment, but +// also a web environment. +var ENVIRONMENT_IS_NODE = typeof process == 'object' && typeof process.versions == 'object' && typeof process.versions.node == 'string'; +var ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER; + +if (Module['ENVIRONMENT']) { + throw new Error('Module.ENVIRONMENT has been deprecated. To force the environment, use the ENVIRONMENT compile-time option (for example, -sENVIRONMENT=web or -sENVIRONMENT=node)'); +} + +// `/` should be present at the end if `scriptDirectory` is not empty +var scriptDirectory = ''; +function locateFile(path) { + if (Module['locateFile']) { + return Module['locateFile'](path, scriptDirectory); + } + return scriptDirectory + path; +} + +// Hooks that are implemented differently in different runtime environments. +var read_, + readAsync, + readBinary, + setWindowTitle; + +// Normally we don't log exceptions but instead let them bubble out the top +// level where the embedding environment (e.g. the browser) can handle +// them. +// However under v8 and node we sometimes exit the process direcly in which case +// its up to use us to log the exception before exiting. +// If we fix https://github.com/emscripten-core/emscripten/issues/15080 +// this may no longer be needed under node. +function logExceptionOnExit(e) { + if (e instanceof ExitStatus) return; + let toLog = e; + if (e && typeof e == 'object' && e.stack) { + toLog = [e, e.stack]; + } + err('exiting due to exception: ' + toLog); +} + +if (ENVIRONMENT_IS_NODE) { + if (typeof process == 'undefined' || !process.release || process.release.name !== 'node') throw new Error('not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)'); + // `require()` is no-op in an ESM module, use `createRequire()` to construct + // the require()` function. This is only necessary for multi-environment + // builds, `-sENVIRONMENT=node` emits a static import declaration instead. + // TODO: Swap all `require()`'s with `import()`'s? + // These modules will usually be used on Node.js. Load them eagerly to avoid + // the complexity of lazy-loading. + var fs = require('fs'); + var nodePath = require('path'); + + if (ENVIRONMENT_IS_WORKER) { + scriptDirectory = nodePath.dirname(scriptDirectory) + '/'; + } else { + scriptDirectory = __dirname + '/'; + } + +// include: node_shell_read.js +read_ = (filename, binary) => { + // We need to re-wrap `file://` strings to URLs. Normalizing isn't + // necessary in that case, the path should already be absolute. + filename = isFileURI(filename) ? new URL(filename) : nodePath.normalize(filename); + return fs.readFileSync(filename, binary ? undefined : 'utf8'); +}; + +readBinary = (filename) => { + var ret = read_(filename, true); + if (!ret.buffer) { + ret = new Uint8Array(ret); + } + assert(ret.buffer); + return ret; +}; + +readAsync = (filename, onload, onerror) => { + // See the comment in the `read_` function. + filename = isFileURI(filename) ? new URL(filename) : nodePath.normalize(filename); + fs.readFile(filename, function(err, data) { + if (err) onerror(err); + else onload(data.buffer); + }); +}; + +// end include: node_shell_read.js + if (process['argv'].length > 1) { + thisProgram = process['argv'][1].replace(/\\/g, '/'); + } + + arguments_ = process['argv'].slice(2); + + // MODULARIZE will export the module in the proper place outside, we don't need to export here + + process['on']('uncaughtException', function(ex) { + // suppress ExitStatus exceptions from showing an error + if (!(ex instanceof ExitStatus)) { + throw ex; + } + }); + + // Without this older versions of node (< v15) will log unhandled rejections + // but return 0, which is not normally the desired behaviour. This is + // not be needed with node v15 and about because it is now the default + // behaviour: + // See https://nodejs.org/api/cli.html#cli_unhandled_rejections_mode + var nodeMajor = process.version.match(/^v(\d+)\./)[1]; + if (nodeMajor < 15) { + process['on']('unhandledRejection', function(reason) { throw reason; }); + } + + quit_ = (status, toThrow) => { + if (keepRuntimeAlive()) { + process['exitCode'] = status; + throw toThrow; + } + logExceptionOnExit(toThrow); + process['exit'](status); + }; + + Module['inspect'] = function () { return '[Emscripten Module object]'; }; + +} else +if (ENVIRONMENT_IS_SHELL) { + + if ((typeof process == 'object' && typeof require === 'function') || typeof window == 'object' || typeof importScripts == 'function') throw new Error('not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)'); + + if (typeof read != 'undefined') { + read_ = function shell_read(f) { + return read(f); + }; + } + + readBinary = function readBinary(f) { + let data; + if (typeof readbuffer == 'function') { + return new Uint8Array(readbuffer(f)); + } + data = read(f, 'binary'); + assert(typeof data == 'object'); + return data; + }; + + readAsync = function readAsync(f, onload, onerror) { + setTimeout(() => onload(readBinary(f)), 0); + }; + + if (typeof clearTimeout == 'undefined') { + globalThis.clearTimeout = (id) => {}; + } + + if (typeof scriptArgs != 'undefined') { + arguments_ = scriptArgs; + } else if (typeof arguments != 'undefined') { + arguments_ = arguments; + } + + if (typeof quit == 'function') { + quit_ = (status, toThrow) => { + logExceptionOnExit(toThrow); + quit(status); + }; + } + + if (typeof print != 'undefined') { + // Prefer to use print/printErr where they exist, as they usually work better. + if (typeof console == 'undefined') console = /** @type{!Console} */({}); + console.log = /** @type{!function(this:Console, ...*): undefined} */ (print); + console.warn = console.error = /** @type{!function(this:Console, ...*): undefined} */ (typeof printErr != 'undefined' ? printErr : print); + } + +} else + +// Note that this includes Node.js workers when relevant (pthreads is enabled). +// Node.js workers are detected as a combination of ENVIRONMENT_IS_WORKER and +// ENVIRONMENT_IS_NODE. +if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) { + if (ENVIRONMENT_IS_WORKER) { // Check worker, not web, since window could be polyfilled + scriptDirectory = self.location.href; + } else if (typeof document != 'undefined' && document.currentScript) { // web + scriptDirectory = document.currentScript.src; + } + // When MODULARIZE, this JS may be executed later, after document.currentScript + // is gone, so we saved it, and we use it here instead of any other info. + if (_scriptDir) { + scriptDirectory = _scriptDir; + } + // blob urls look like blob:http://site.com/etc/etc and we cannot infer anything from them. + // otherwise, slice off the final part of the url to find the script directory. + // if scriptDirectory does not contain a slash, lastIndexOf will return -1, + // and scriptDirectory will correctly be replaced with an empty string. + // If scriptDirectory contains a query (starting with ?) or a fragment (starting with #), + // they are removed because they could contain a slash. + if (scriptDirectory.indexOf('blob:') !== 0) { + scriptDirectory = scriptDirectory.substr(0, scriptDirectory.replace(/[?#].*/, "").lastIndexOf('/')+1); + } else { + scriptDirectory = ''; + } + + if (!(typeof window == 'object' || typeof importScripts == 'function')) throw new Error('not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)'); + + // Differentiate the Web Worker from the Node Worker case, as reading must + // be done differently. + { +// include: web_or_worker_shell_read.js +read_ = (url) => { + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + xhr.send(null); + return xhr.responseText; + } + + if (ENVIRONMENT_IS_WORKER) { + readBinary = (url) => { + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + xhr.responseType = 'arraybuffer'; + xhr.send(null); + return new Uint8Array(/** @type{!ArrayBuffer} */(xhr.response)); + }; + } + + readAsync = (url, onload, onerror) => { + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, true); + xhr.responseType = 'arraybuffer'; + xhr.onload = () => { + if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0 + onload(xhr.response); + return; + } + onerror(); + }; + xhr.onerror = onerror; + xhr.send(null); + } + +// end include: web_or_worker_shell_read.js + } + + setWindowTitle = (title) => document.title = title; +} else +{ + throw new Error('environment detection error'); +} + +var out = Module['print'] || console.log.bind(console); +var err = Module['printErr'] || console.warn.bind(console); + +// Merge back in the overrides +Object.assign(Module, moduleOverrides); +// Free the object hierarchy contained in the overrides, this lets the GC +// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array. +moduleOverrides = null; +checkIncomingModuleAPI(); + +// Emit code to handle expected values on the Module object. This applies Module.x +// to the proper local x. This has two benefits: first, we only emit it if it is +// expected to arrive, and second, by using a local everywhere else that can be +// minified. + +if (Module['arguments']) arguments_ = Module['arguments'];legacyModuleProp('arguments', 'arguments_'); + +if (Module['thisProgram']) thisProgram = Module['thisProgram'];legacyModuleProp('thisProgram', 'thisProgram'); + +if (Module['quit']) quit_ = Module['quit'];legacyModuleProp('quit', 'quit_'); + +// perform assertions in shell.js after we set up out() and err(), as otherwise if an assertion fails it cannot print the message +// Assertions on removed incoming Module JS APIs. +assert(typeof Module['memoryInitializerPrefixURL'] == 'undefined', 'Module.memoryInitializerPrefixURL option was removed, use Module.locateFile instead'); +assert(typeof Module['pthreadMainPrefixURL'] == 'undefined', 'Module.pthreadMainPrefixURL option was removed, use Module.locateFile instead'); +assert(typeof Module['cdInitializerPrefixURL'] == 'undefined', 'Module.cdInitializerPrefixURL option was removed, use Module.locateFile instead'); +assert(typeof Module['filePackagePrefixURL'] == 'undefined', 'Module.filePackagePrefixURL option was removed, use Module.locateFile instead'); +assert(typeof Module['read'] == 'undefined', 'Module.read option was removed (modify read_ in JS)'); +assert(typeof Module['readAsync'] == 'undefined', 'Module.readAsync option was removed (modify readAsync in JS)'); +assert(typeof Module['readBinary'] == 'undefined', 'Module.readBinary option was removed (modify readBinary in JS)'); +assert(typeof Module['setWindowTitle'] == 'undefined', 'Module.setWindowTitle option was removed (modify setWindowTitle in JS)'); +assert(typeof Module['TOTAL_MEMORY'] == 'undefined', 'Module.TOTAL_MEMORY has been renamed Module.INITIAL_MEMORY'); +legacyModuleProp('read', 'read_'); +legacyModuleProp('readAsync', 'readAsync'); +legacyModuleProp('readBinary', 'readBinary'); +legacyModuleProp('setWindowTitle', 'setWindowTitle'); +var IDBFS = 'IDBFS is no longer included by default; build with -lidbfs.js'; +var PROXYFS = 'PROXYFS is no longer included by default; build with -lproxyfs.js'; +var WORKERFS = 'WORKERFS is no longer included by default; build with -lworkerfs.js'; +var NODEFS = 'NODEFS is no longer included by default; build with -lnodefs.js'; + +assert(!ENVIRONMENT_IS_SHELL, "shell environment detected but not enabled at build time. Add 'shell' to `-sENVIRONMENT` to enable."); + + +// end include: shell.js +// include: preamble.js +// === Preamble library stuff === + +// Documentation for the public APIs defined in this file must be updated in: +// site/source/docs/api_reference/preamble.js.rst +// A prebuilt local version of the documentation is available at: +// site/build/text/docs/api_reference/preamble.js.txt +// You can also build docs locally as HTML or other formats in site/ +// An online HTML version (which may be of a different version of Emscripten) +// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html + +var wasmBinary; +if (Module['wasmBinary']) wasmBinary = Module['wasmBinary'];legacyModuleProp('wasmBinary', 'wasmBinary'); +var noExitRuntime = Module['noExitRuntime'] || true;legacyModuleProp('noExitRuntime', 'noExitRuntime'); + +if (typeof WebAssembly != 'object') { + abort('no native wasm support detected'); +} + +// Wasm globals + +var wasmMemory; + +//======================================== +// Runtime essentials +//======================================== + +// whether we are quitting the application. no code should run after this. +// set in exit() and abort() +var ABORT = false; + +// set by exit() and abort(). Passed to 'onExit' handler. +// NOTE: This is also used as the process return code code in shell environments +// but only when noExitRuntime is false. +var EXITSTATUS; + +/** @type {function(*, string=)} */ +function assert(condition, text) { + if (!condition) { + abort('Assertion failed' + (text ? ': ' + text : '')); + } +} + +// We used to include malloc/free by default in the past. Show a helpful error in +// builds with assertions. + +// include: runtime_strings.js +// runtime_strings.js: String related runtime functions that are part of both +// MINIMAL_RUNTIME and regular runtime. + +var UTF8Decoder = typeof TextDecoder != 'undefined' ? new TextDecoder('utf8') : undefined; + +/** + * Given a pointer 'idx' to a null-terminated UTF8-encoded string in the given + * array that contains uint8 values, returns a copy of that string as a + * Javascript String object. + * heapOrArray is either a regular array, or a JavaScript typed array view. + * @param {number} idx + * @param {number=} maxBytesToRead + * @return {string} + */ +function UTF8ArrayToString(heapOrArray, idx, maxBytesToRead) { + var endIdx = idx + maxBytesToRead; + var endPtr = idx; + // TextDecoder needs to know the byte length in advance, it doesn't stop on + // null terminator by itself. Also, use the length info to avoid running tiny + // strings through TextDecoder, since .subarray() allocates garbage. + // (As a tiny code save trick, compare endPtr against endIdx using a negation, + // so that undefined means Infinity) + while (heapOrArray[endPtr] && !(endPtr >= endIdx)) ++endPtr; + + if (endPtr - idx > 16 && heapOrArray.buffer && UTF8Decoder) { + return UTF8Decoder.decode(heapOrArray.subarray(idx, endPtr)); + } + var str = ''; + // If building with TextDecoder, we have already computed the string length + // above, so test loop end condition against that + while (idx < endPtr) { + // For UTF8 byte structure, see: + // http://en.wikipedia.org/wiki/UTF-8#Description + // https://www.ietf.org/rfc/rfc2279.txt + // https://tools.ietf.org/html/rfc3629 + var u0 = heapOrArray[idx++]; + if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; } + var u1 = heapOrArray[idx++] & 63; + if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; } + var u2 = heapOrArray[idx++] & 63; + if ((u0 & 0xF0) == 0xE0) { + u0 = ((u0 & 15) << 12) | (u1 << 6) | u2; + } else { + if ((u0 & 0xF8) != 0xF0) warnOnce('Invalid UTF-8 leading byte ' + ptrToString(u0) + ' encountered when deserializing a UTF-8 string in wasm memory to a JS string!'); + u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | (heapOrArray[idx++] & 63); + } + + if (u0 < 0x10000) { + str += String.fromCharCode(u0); + } else { + var ch = u0 - 0x10000; + str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); + } + } + return str; +} + +/** + * Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the + * emscripten HEAP, returns a copy of that string as a Javascript String object. + * + * @param {number} ptr + * @param {number=} maxBytesToRead - An optional length that specifies the + * maximum number of bytes to read. You can omit this parameter to scan the + * string until the first \0 byte. If maxBytesToRead is passed, and the string + * at [ptr, ptr+maxBytesToReadr[ contains a null byte in the middle, then the + * string will cut short at that byte index (i.e. maxBytesToRead will not + * produce a string of exact length [ptr, ptr+maxBytesToRead[) N.B. mixing + * frequent uses of UTF8ToString() with and without maxBytesToRead may throw + * JS JIT optimizations off, so it is worth to consider consistently using one + * @return {string} + */ +function UTF8ToString(ptr, maxBytesToRead) { + return ptr ? UTF8ArrayToString(HEAPU8, ptr, maxBytesToRead) : ''; +} + +/** + * Copies the given Javascript String object 'str' to the given byte array at + * address 'outIdx', encoded in UTF8 form and null-terminated. The copy will + * require at most str.length*4+1 bytes of space in the HEAP. Use the function + * lengthBytesUTF8 to compute the exact number of bytes (excluding null + * terminator) that this function will write. + * + * @param {string} str - The Javascript string to copy. + * @param {ArrayBufferView|Array} heap - The array to copy to. Each + * index in this array is assumed + * to be one 8-byte element. + * @param {number} outIdx - The starting offset in the array to begin the copying. + * @param {number} maxBytesToWrite - The maximum number of bytes this function + * can write to the array. This count should + * include the null terminator, i.e. if + * maxBytesToWrite=1, only the null terminator + * will be written and nothing else. + * maxBytesToWrite=0 does not write any bytes + * to the output, not even the null + * terminator. + * @return {number} The number of bytes written, EXCLUDING the null terminator. + */ +function stringToUTF8Array(str, heap, outIdx, maxBytesToWrite) { + // Parameter maxBytesToWrite is not optional. Negative values, 0, null, + // undefined and false each don't write out any bytes. + if (!(maxBytesToWrite > 0)) + return 0; + + var startIdx = outIdx; + var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator. + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code + // unit, not a Unicode code point of the character! So decode + // UTF16->UTF32->UTF8. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description + // and https://www.ietf.org/rfc/rfc2279.txt + // and https://tools.ietf.org/html/rfc3629 + var u = str.charCodeAt(i); // possibly a lead surrogate + if (u >= 0xD800 && u <= 0xDFFF) { + var u1 = str.charCodeAt(++i); + u = 0x10000 + ((u & 0x3FF) << 10) | (u1 & 0x3FF); + } + if (u <= 0x7F) { + if (outIdx >= endIdx) break; + heap[outIdx++] = u; + } else if (u <= 0x7FF) { + if (outIdx + 1 >= endIdx) break; + heap[outIdx++] = 0xC0 | (u >> 6); + heap[outIdx++] = 0x80 | (u & 63); + } else if (u <= 0xFFFF) { + if (outIdx + 2 >= endIdx) break; + heap[outIdx++] = 0xE0 | (u >> 12); + heap[outIdx++] = 0x80 | ((u >> 6) & 63); + heap[outIdx++] = 0x80 | (u & 63); + } else { + if (outIdx + 3 >= endIdx) break; + if (u > 0x10FFFF) warnOnce('Invalid Unicode code point ' + ptrToString(u) + ' encountered when serializing a JS string to a UTF-8 string in wasm memory! (Valid unicode code points should be in range 0-0x10FFFF).'); + heap[outIdx++] = 0xF0 | (u >> 18); + heap[outIdx++] = 0x80 | ((u >> 12) & 63); + heap[outIdx++] = 0x80 | ((u >> 6) & 63); + heap[outIdx++] = 0x80 | (u & 63); + } + } + // Null-terminate the pointer to the buffer. + heap[outIdx] = 0; + return outIdx - startIdx; +} + +/** + * Copies the given Javascript String object 'str' to the emscripten HEAP at + * address 'outPtr', null-terminated and encoded in UTF8 form. The copy will + * require at most str.length*4+1 bytes of space in the HEAP. + * Use the function lengthBytesUTF8 to compute the exact number of bytes + * (excluding null terminator) that this function will write. + * + * @return {number} The number of bytes written, EXCLUDING the null terminator. + */ +function stringToUTF8(str, outPtr, maxBytesToWrite) { + assert(typeof maxBytesToWrite == 'number', 'stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); + return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite); +} + +/** + * Returns the number of bytes the given Javascript string takes if encoded as a + * UTF8 byte array, EXCLUDING the null terminator byte. + * + * @param {string} str - JavaScript string to operator on + * @return {number} Length, in bytes, of the UTF8 encoded string. + */ +function lengthBytesUTF8(str) { + var len = 0; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code + // unit, not a Unicode code point of the character! So decode + // UTF16->UTF32->UTF8. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var c = str.charCodeAt(i); // possibly a lead surrogate + if (c <= 0x7F) { + len++; + } else if (c <= 0x7FF) { + len += 2; + } else if (c >= 0xD800 && c <= 0xDFFF) { + len += 4; ++i; + } else { + len += 3; + } + } + return len; +} + +// end include: runtime_strings.js +// Memory management + +var HEAP, +/** @type {!Int8Array} */ + HEAP8, +/** @type {!Uint8Array} */ + HEAPU8, +/** @type {!Int16Array} */ + HEAP16, +/** @type {!Uint16Array} */ + HEAPU16, +/** @type {!Int32Array} */ + HEAP32, +/** @type {!Uint32Array} */ + HEAPU32, +/** @type {!Float32Array} */ + HEAPF32, +/** @type {!Float64Array} */ + HEAPF64; + +function updateMemoryViews() { + var b = wasmMemory.buffer; + Module['HEAP8'] = HEAP8 = new Int8Array(b); + Module['HEAP16'] = HEAP16 = new Int16Array(b); + Module['HEAP32'] = HEAP32 = new Int32Array(b); + Module['HEAPU8'] = HEAPU8 = new Uint8Array(b); + Module['HEAPU16'] = HEAPU16 = new Uint16Array(b); + Module['HEAPU32'] = HEAPU32 = new Uint32Array(b); + Module['HEAPF32'] = HEAPF32 = new Float32Array(b); + Module['HEAPF64'] = HEAPF64 = new Float64Array(b); +} + +assert(!Module['STACK_SIZE'], 'STACK_SIZE can no longer be set at runtime. Use -sSTACK_SIZE at link time') + +assert(typeof Int32Array != 'undefined' && typeof Float64Array !== 'undefined' && Int32Array.prototype.subarray != undefined && Int32Array.prototype.set != undefined, + 'JS engine does not provide full typed array support'); + +// If memory is defined in wasm, the user can't provide it, or set INITIAL_MEMORY +assert(!Module['wasmMemory'], 'Use of `wasmMemory` detected. Use -sIMPORTED_MEMORY to define wasmMemory externally'); +assert(!Module['INITIAL_MEMORY'], 'Detected runtime INITIAL_MEMORY setting. Use -sIMPORTED_MEMORY to define wasmMemory dynamically'); + +// include: runtime_init_table.js +// In regular non-RELOCATABLE mode the table is exported +// from the wasm module and this will be assigned once +// the exports are available. +var wasmTable; + +// end include: runtime_init_table.js +// include: runtime_stack_check.js +// Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode. +function writeStackCookie() { + var max = _emscripten_stack_get_end(); + assert((max & 3) == 0); + // If the stack ends at address zero we write our cookies 4 bytes into the + // stack. This prevents interference with the (separate) address-zero check + // below. + if (max == 0) { + max += 4; + } + // The stack grow downwards towards _emscripten_stack_get_end. + // We write cookies to the final two words in the stack and detect if they are + // ever overwritten. + HEAPU32[((max)>>2)] = 0x2135467; + HEAPU32[(((max)+(4))>>2)] = 0x89BACDFE; + // Also test the global address 0 for integrity. + HEAPU32[0] = 0x63736d65; /* 'emsc' */ +} + +function checkStackCookie() { + if (ABORT) return; + var max = _emscripten_stack_get_end(); + // See writeStackCookie(). + if (max == 0) { + max += 4; + } + var cookie1 = HEAPU32[((max)>>2)]; + var cookie2 = HEAPU32[(((max)+(4))>>2)]; + if (cookie1 != 0x2135467 || cookie2 != 0x89BACDFE) { + abort('Stack overflow! Stack cookie has been overwritten at ' + ptrToString(max) + ', expected hex dwords 0x89BACDFE and 0x2135467, but received ' + ptrToString(cookie2) + ' ' + ptrToString(cookie1)); + } + // Also test the global address 0 for integrity. + if (HEAPU32[0] !== 0x63736d65 /* 'emsc' */) { + abort('Runtime error: The application has corrupted its heap memory area (address zero)!'); + } +} + +// end include: runtime_stack_check.js +// include: runtime_assertions.js +// Endianness check +(function() { + var h16 = new Int16Array(1); + var h8 = new Int8Array(h16.buffer); + h16[0] = 0x6373; + if (h8[0] !== 0x73 || h8[1] !== 0x63) throw 'Runtime error: expected the system to be little-endian! (Run with -sSUPPORT_BIG_ENDIAN to bypass)'; +})(); + +// end include: runtime_assertions.js +var __ATPRERUN__ = []; // functions called before the runtime is initialized +var __ATINIT__ = []; // functions called during startup +var __ATEXIT__ = []; // functions called during shutdown +var __ATPOSTRUN__ = []; // functions called after the main() is called + +var runtimeInitialized = false; + +function keepRuntimeAlive() { + return noExitRuntime; +} + +function preRun() { + if (Module['preRun']) { + if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']]; + while (Module['preRun'].length) { + addOnPreRun(Module['preRun'].shift()); + } + } + callRuntimeCallbacks(__ATPRERUN__); +} + +function initRuntime() { + assert(!runtimeInitialized); + runtimeInitialized = true; + + checkStackCookie(); + + +if (!Module["noFSInit"] && !FS.init.initialized) + FS.init(); +FS.ignorePermissions = false; + +TTY.init(); +SOCKFS.root = FS.mount(SOCKFS, {}, null); + callRuntimeCallbacks(__ATINIT__); +} + +function postRun() { + checkStackCookie(); + + if (Module['postRun']) { + if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']]; + while (Module['postRun'].length) { + addOnPostRun(Module['postRun'].shift()); + } + } + + callRuntimeCallbacks(__ATPOSTRUN__); +} + +function addOnPreRun(cb) { + __ATPRERUN__.unshift(cb); +} + +function addOnInit(cb) { + __ATINIT__.unshift(cb); +} + +function addOnExit(cb) { +} + +function addOnPostRun(cb) { + __ATPOSTRUN__.unshift(cb); +} + +// include: runtime_math.js +// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/imul + +// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/fround + +// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/clz32 + +// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/trunc + +assert(Math.imul, 'This browser does not support Math.imul(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); +assert(Math.fround, 'This browser does not support Math.fround(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); +assert(Math.clz32, 'This browser does not support Math.clz32(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); +assert(Math.trunc, 'This browser does not support Math.trunc(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); + +// end include: runtime_math.js +// A counter of dependencies for calling run(). If we need to +// do asynchronous work before running, increment this and +// decrement it. Incrementing must happen in a place like +// Module.preRun (used by emcc to add file preloading). +// Note that you can add dependencies in preRun, even though +// it happens right before run - run will be postponed until +// the dependencies are met. +var runDependencies = 0; +var runDependencyWatcher = null; +var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled +var runDependencyTracking = {}; + +function getUniqueRunDependency(id) { + var orig = id; + while (1) { + if (!runDependencyTracking[id]) return id; + id = orig + Math.random(); + } +} + +function addRunDependency(id) { + runDependencies++; + + if (Module['monitorRunDependencies']) { + Module['monitorRunDependencies'](runDependencies); + } + + if (id) { + assert(!runDependencyTracking[id]); + runDependencyTracking[id] = 1; + if (runDependencyWatcher === null && typeof setInterval != 'undefined') { + // Check for missing dependencies every few seconds + runDependencyWatcher = setInterval(function() { + if (ABORT) { + clearInterval(runDependencyWatcher); + runDependencyWatcher = null; + return; + } + var shown = false; + for (var dep in runDependencyTracking) { + if (!shown) { + shown = true; + err('still waiting on run dependencies:'); + } + err('dependency: ' + dep); + } + if (shown) { + err('(end of list)'); + } + }, 10000); + } + } else { + err('warning: run dependency added without ID'); + } +} + +function removeRunDependency(id) { + runDependencies--; + + if (Module['monitorRunDependencies']) { + Module['monitorRunDependencies'](runDependencies); + } + + if (id) { + assert(runDependencyTracking[id]); + delete runDependencyTracking[id]; + } else { + err('warning: run dependency removed without ID'); + } + if (runDependencies == 0) { + if (runDependencyWatcher !== null) { + clearInterval(runDependencyWatcher); + runDependencyWatcher = null; + } + if (dependenciesFulfilled) { + var callback = dependenciesFulfilled; + dependenciesFulfilled = null; + callback(); // can add another dependenciesFulfilled + } + } +} + +/** @param {string|number=} what */ +function abort(what) { + if (Module['onAbort']) { + Module['onAbort'](what); + } + + what = 'Aborted(' + what + ')'; + // TODO(sbc): Should we remove printing and leave it up to whoever + // catches the exception? + err(what); + + ABORT = true; + EXITSTATUS = 1; + + // Use a wasm runtime error, because a JS error might be seen as a foreign + // exception, which means we'd run destructors on it. We need the error to + // simply make the program stop. + // FIXME This approach does not work in Wasm EH because it currently does not assume + // all RuntimeErrors are from traps; it decides whether a RuntimeError is from + // a trap or not based on a hidden field within the object. So at the moment + // we don't have a way of throwing a wasm trap from JS. TODO Make a JS API that + // allows this in the wasm spec. + + // Suppress closure compiler warning here. Closure compiler's builtin extern + // defintion for WebAssembly.RuntimeError claims it takes no arguments even + // though it can. + // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure gets fixed. + /** @suppress {checkTypes} */ + var e = new WebAssembly.RuntimeError(what); + + readyPromiseReject(e); + // Throw the error whether or not MODULARIZE is set because abort is used + // in code paths apart from instantiation where an exception is expected + // to be thrown when abort is called. + throw e; +} + +// include: memoryprofiler.js +// end include: memoryprofiler.js +// include: URIUtils.js +// Prefix of data URIs emitted by SINGLE_FILE and related options. +var dataURIPrefix = 'data:application/octet-stream;base64,'; + +// Indicates whether filename is a base64 data URI. +function isDataURI(filename) { + // Prefix of data URIs emitted by SINGLE_FILE and related options. + return filename.startsWith(dataURIPrefix); +} + +// Indicates whether filename is delivered via file protocol (as opposed to http/https) +function isFileURI(filename) { + return filename.startsWith('file://'); +} + +// end include: URIUtils.js +/** @param {boolean=} fixedasm */ +function createExportWrapper(name, fixedasm) { + return function() { + var displayName = name; + var asm = fixedasm; + if (!fixedasm) { + asm = Module['asm']; + } + assert(runtimeInitialized, 'native function `' + displayName + '` called before runtime initialization'); + if (!asm[name]) { + assert(asm[name], 'exported native function `' + displayName + '` not found'); + } + return asm[name].apply(null, arguments); + }; +} + +var wasmBinaryFile; + wasmBinaryFile = 'wiregasm.wasm'; + if (!isDataURI(wasmBinaryFile)) { + wasmBinaryFile = locateFile(wasmBinaryFile); + } + +function getBinary(file) { + try { + if (file == wasmBinaryFile && wasmBinary) { + return new Uint8Array(wasmBinary); + } + if (readBinary) { + return readBinary(file); + } + throw "both async and sync fetching of the wasm failed"; + } + catch (err) { + abort(err); + } +} + +function getBinaryPromise() { + // If we don't have the binary yet, try to to load it asynchronously. + // Fetch has some additional restrictions over XHR, like it can't be used on a file:// url. + // See https://github.com/github/fetch/pull/92#issuecomment-140665932 + // Cordova or Electron apps are typically loaded from a file:// url. + // So use fetch if it is available and the url is not a file, otherwise fall back to XHR. + if (!wasmBinary && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER)) { + if (typeof fetch == 'function' + && !isFileURI(wasmBinaryFile) + ) { + return fetch(wasmBinaryFile, { credentials: 'same-origin' }).then(function(response) { + if (!response['ok']) { + throw "failed to load wasm binary file at '" + wasmBinaryFile + "'"; + } + return response['arrayBuffer'](); + }).catch(function () { + return getBinary(wasmBinaryFile); + }); + } + else { + if (readAsync) { + // fetch is not available or url is file => try XHR (readAsync uses XHR internally) + return new Promise(function(resolve, reject) { + readAsync(wasmBinaryFile, function(response) { resolve(new Uint8Array(/** @type{!ArrayBuffer} */(response))) }, reject) + }); + } + } + } + + // Otherwise, getBinary should be able to get it synchronously + return Promise.resolve().then(function() { return getBinary(wasmBinaryFile); }); +} + +// Create the wasm instance. +// Receives the wasm imports, returns the exports. +function createWasm() { + // prepare imports + var info = { + 'env': wasmImports, + 'wasi_snapshot_preview1': wasmImports, + }; + // Load the wasm module and create an instance of using native support in the JS engine. + // handle a generated wasm instance, receiving its exports and + // performing other necessary setup + /** @param {WebAssembly.Module=} module*/ + function receiveInstance(instance, module) { + var exports = instance.exports; + + Module['asm'] = exports; + + wasmMemory = Module['asm']['memory']; + assert(wasmMemory, "memory not found in wasm exports"); + // This assertion doesn't hold when emscripten is run in --post-link + // mode. + // TODO(sbc): Read INITIAL_MEMORY out of the wasm file in post-link mode. + //assert(wasmMemory.buffer.byteLength === 134217728); + updateMemoryViews(); + + wasmTable = Module['asm']['__indirect_function_table']; + assert(wasmTable, "table not found in wasm exports"); + + addOnInit(Module['asm']['__wasm_call_ctors']); + + removeRunDependency('wasm-instantiate'); + + } + // wait for the pthread pool (if any) + addRunDependency('wasm-instantiate'); + + // Prefer streaming instantiation if available. + // Async compilation can be confusing when an error on the page overwrites Module + // (for example, if the order of elements is wrong, and the one defining Module is + // later), so we save Module and check it later. + var trueModule = Module; + function receiveInstantiationResult(result) { + // 'result' is a ResultObject object which has both the module and instance. + // receiveInstance() will swap in the exports (to Module.asm) so they can be called + assert(Module === trueModule, 'the Module object should not be replaced during async compilation - perhaps the order of HTML elements is wrong?'); + trueModule = null; + // TODO: Due to Closure regression https://github.com/google/closure-compiler/issues/3193, the above line no longer optimizes out down to the following line. + // When the regression is fixed, can restore the above USE_PTHREADS-enabled path. + receiveInstance(result['instance']); + } + + function instantiateArrayBuffer(receiver) { + return getBinaryPromise().then(function(binary) { + return WebAssembly.instantiate(binary, info); + }).then(function (instance) { + return instance; + }).then(receiver, function(reason) { + err('failed to asynchronously prepare wasm: ' + reason); + + // Warn on some common problems. + if (isFileURI(wasmBinaryFile)) { + err('warning: Loading from a file URI (' + wasmBinaryFile + ') is not supported in most browsers. See https://emscripten.org/docs/getting_started/FAQ.html#how-do-i-run-a-local-webserver-for-testing-why-does-my-program-stall-in-downloading-or-preparing'); + } + abort(reason); + }); + } + + function instantiateAsync() { + if (!wasmBinary && + typeof WebAssembly.instantiateStreaming == 'function' && + !isDataURI(wasmBinaryFile) && + // Don't use streaming for file:// delivered objects in a webview, fetch them synchronously. + !isFileURI(wasmBinaryFile) && + // Avoid instantiateStreaming() on Node.js environment for now, as while + // Node.js v18.1.0 implements it, it does not have a full fetch() + // implementation yet. + // + // Reference: + // https://github.com/emscripten-core/emscripten/pull/16917 + !ENVIRONMENT_IS_NODE && + typeof fetch == 'function') { + return fetch(wasmBinaryFile, { credentials: 'same-origin' }).then(function(response) { + // Suppress closure warning here since the upstream definition for + // instantiateStreaming only allows Promise rather than + // an actual Response. + // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure is fixed. + /** @suppress {checkTypes} */ + var result = WebAssembly.instantiateStreaming(response, info); + + return result.then( + receiveInstantiationResult, + function(reason) { + // We expect the most common failure cause to be a bad MIME type for the binary, + // in which case falling back to ArrayBuffer instantiation should work. + err('wasm streaming compile failed: ' + reason); + err('falling back to ArrayBuffer instantiation'); + return instantiateArrayBuffer(receiveInstantiationResult); + }); + }); + } else { + return instantiateArrayBuffer(receiveInstantiationResult); + } + } + + // User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback + // to manually instantiate the Wasm module themselves. This allows pages to run the instantiation parallel + // to any other async startup actions they are performing. + // Also pthreads and wasm workers initialize the wasm instance through this path. + if (Module['instantiateWasm']) { + try { + var exports = Module['instantiateWasm'](info, receiveInstance); + return exports; + } catch(e) { + err('Module.instantiateWasm callback failed with error: ' + e); + // If instantiation fails, reject the module ready promise. + readyPromiseReject(e); + } + } + + // If instantiation fails, reject the module ready promise. + instantiateAsync().catch(readyPromiseReject); + return {}; // no exports yet; we'll fill them in later +} + +// Globals used by JS i64 conversions (see makeSetValue) +var tempDouble; +var tempI64; + +// include: runtime_debug.js +function legacyModuleProp(prop, newName) { + if (!Object.getOwnPropertyDescriptor(Module, prop)) { + Object.defineProperty(Module, prop, { + configurable: true, + get: function() { + abort('Module.' + prop + ' has been replaced with plain ' + newName + ' (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)'); + } + }); + } +} + +function ignoredModuleProp(prop) { + if (Object.getOwnPropertyDescriptor(Module, prop)) { + abort('`Module.' + prop + '` was supplied but `' + prop + '` not included in INCOMING_MODULE_JS_API'); + } +} + +// forcing the filesystem exports a few things by default +function isExportedByForceFilesystem(name) { + return name === 'FS_createPath' || + name === 'FS_createDataFile' || + name === 'FS_createPreloadedFile' || + name === 'FS_unlink' || + name === 'addRunDependency' || + // The old FS has some functionality that WasmFS lacks. + name === 'FS_createLazyFile' || + name === 'FS_createDevice' || + name === 'removeRunDependency'; +} + +function missingGlobal(sym, msg) { + if (typeof globalThis !== 'undefined') { + Object.defineProperty(globalThis, sym, { + configurable: true, + get: function() { + warnOnce('`' + sym + '` is not longer defined by emscripten. ' + msg); + return undefined; + } + }); + } +} + +missingGlobal('buffer', 'Please use HEAP8.buffer or wasmMemory.buffer'); + +function missingLibrarySymbol(sym) { + if (typeof globalThis !== 'undefined' && !Object.getOwnPropertyDescriptor(globalThis, sym)) { + Object.defineProperty(globalThis, sym, { + configurable: true, + get: function() { + // Can't `abort()` here because it would break code that does runtime + // checks. e.g. `if (typeof SDL === 'undefined')`. + var msg = '`' + sym + '` is a library symbol and not included by default; add it to your library.js __deps or to DEFAULT_LIBRARY_FUNCS_TO_INCLUDE on the command line'; + // DEFAULT_LIBRARY_FUNCS_TO_INCLUDE requires the name as it appears in + // library.js, which means $name for a JS name with no prefix, or name + // for a JS name like _name. + var librarySymbol = sym; + if (!librarySymbol.startsWith('_')) { + librarySymbol = '$' + sym; + } + msg += " (e.g. -sDEFAULT_LIBRARY_FUNCS_TO_INCLUDE=" + librarySymbol + ")"; + if (isExportedByForceFilesystem(sym)) { + msg += '. Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you'; + } + warnOnce(msg); + return undefined; + } + }); + } + // Any symbol that is not included from the JS libary is also (by definttion) + // not exported on the Module object. + unexportedRuntimeSymbol(sym); +} + +function unexportedRuntimeSymbol(sym) { + if (!Object.getOwnPropertyDescriptor(Module, sym)) { + Object.defineProperty(Module, sym, { + configurable: true, + get: function() { + var msg = "'" + sym + "' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)"; + if (isExportedByForceFilesystem(sym)) { + msg += '. Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you'; + } + abort(msg); + } + }); + } +} + +// end include: runtime_debug.js +// === Body === + + +// end include: preamble.js + + /** @constructor */ + function ExitStatus(status) { + this.name = 'ExitStatus'; + this.message = 'Program terminated with exit(' + status + ')'; + this.status = status; + } + + function callRuntimeCallbacks(callbacks) { + while (callbacks.length > 0) { + // Pass the module as the first argument. + callbacks.shift()(Module); + } + } + + + /** + * @param {number} ptr + * @param {string} type + */ + function getValue(ptr, type = 'i8') { + if (type.endsWith('*')) type = '*'; + switch (type) { + case 'i1': return HEAP8[((ptr)>>0)]; + case 'i8': return HEAP8[((ptr)>>0)]; + case 'i16': return HEAP16[((ptr)>>1)]; + case 'i32': return HEAP32[((ptr)>>2)]; + case 'i64': return HEAP32[((ptr)>>2)]; + case 'float': return HEAPF32[((ptr)>>2)]; + case 'double': return HEAPF64[((ptr)>>3)]; + case '*': return HEAPU32[((ptr)>>2)]; + default: abort('invalid type for getValue: ' + type); + } + return null; + } + + function ptrToString(ptr) { + assert(typeof ptr === 'number'); + return '0x' + ptr.toString(16).padStart(8, '0'); + } + + + /** + * @param {number} ptr + * @param {number} value + * @param {string} type + */ + function setValue(ptr, value, type = 'i8') { + if (type.endsWith('*')) type = '*'; + switch (type) { + case 'i1': HEAP8[((ptr)>>0)] = value; break; + case 'i8': HEAP8[((ptr)>>0)] = value; break; + case 'i16': HEAP16[((ptr)>>1)] = value; break; + case 'i32': HEAP32[((ptr)>>2)] = value; break; + case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)] = tempI64[0],HEAP32[(((ptr)+(4))>>2)] = tempI64[1]); break; + case 'float': HEAPF32[((ptr)>>2)] = value; break; + case 'double': HEAPF64[((ptr)>>3)] = value; break; + case '*': HEAPU32[((ptr)>>2)] = value; break; + default: abort('invalid type for setValue: ' + type); + } + } + + function warnOnce(text) { + if (!warnOnce.shown) warnOnce.shown = {}; + if (!warnOnce.shown[text]) { + warnOnce.shown[text] = 1; + if (ENVIRONMENT_IS_NODE) text = 'warning: ' + text; + err(text); + } + } + + function ___assert_fail(condition, filename, line, func) { + abort('Assertion failed: ' + UTF8ToString(condition) + ', at: ' + [filename ? UTF8ToString(filename) : 'unknown filename', line, func ? UTF8ToString(func) : 'unknown function']); + } + + function ___call_sighandler(fp, sig) { + ((a1) => dynCall_vi.apply(null, [fp, a1]))(sig); + } + + /** @constructor */ + function ExceptionInfo(excPtr) { + this.excPtr = excPtr; + this.ptr = excPtr - 24; + + this.set_type = function(type) { + HEAPU32[(((this.ptr)+(4))>>2)] = type; + }; + + this.get_type = function() { + return HEAPU32[(((this.ptr)+(4))>>2)]; + }; + + this.set_destructor = function(destructor) { + HEAPU32[(((this.ptr)+(8))>>2)] = destructor; + }; + + this.get_destructor = function() { + return HEAPU32[(((this.ptr)+(8))>>2)]; + }; + + this.set_refcount = function(refcount) { + HEAP32[((this.ptr)>>2)] = refcount; + }; + + this.set_caught = function (caught) { + caught = caught ? 1 : 0; + HEAP8[(((this.ptr)+(12))>>0)] = caught; + }; + + this.get_caught = function () { + return HEAP8[(((this.ptr)+(12))>>0)] != 0; + }; + + this.set_rethrown = function (rethrown) { + rethrown = rethrown ? 1 : 0; + HEAP8[(((this.ptr)+(13))>>0)] = rethrown; + }; + + this.get_rethrown = function () { + return HEAP8[(((this.ptr)+(13))>>0)] != 0; + }; + + // Initialize native structure fields. Should be called once after allocated. + this.init = function(type, destructor) { + this.set_adjusted_ptr(0); + this.set_type(type); + this.set_destructor(destructor); + this.set_refcount(0); + this.set_caught(false); + this.set_rethrown(false); + } + + this.add_ref = function() { + var value = HEAP32[((this.ptr)>>2)]; + HEAP32[((this.ptr)>>2)] = value + 1; + }; + + // Returns true if last reference released. + this.release_ref = function() { + var prev = HEAP32[((this.ptr)>>2)]; + HEAP32[((this.ptr)>>2)] = prev - 1; + assert(prev > 0); + return prev === 1; + }; + + this.set_adjusted_ptr = function(adjustedPtr) { + HEAPU32[(((this.ptr)+(16))>>2)] = adjustedPtr; + }; + + this.get_adjusted_ptr = function() { + return HEAPU32[(((this.ptr)+(16))>>2)]; + }; + + // Get pointer which is expected to be received by catch clause in C++ code. It may be adjusted + // when the pointer is casted to some of the exception object base classes (e.g. when virtual + // inheritance is used). When a pointer is thrown this method should return the thrown pointer + // itself. + this.get_exception_ptr = function() { + // Work around a fastcomp bug, this code is still included for some reason in a build without + // exceptions support. + var isPointer = ___cxa_is_pointer_type(this.get_type()); + if (isPointer) { + return HEAPU32[((this.excPtr)>>2)]; + } + var adjusted = this.get_adjusted_ptr(); + if (adjusted !== 0) return adjusted; + return this.excPtr; + }; + } + + var exceptionLast = 0; + + var uncaughtExceptionCount = 0; + function ___cxa_throw(ptr, type, destructor) { + var info = new ExceptionInfo(ptr); + // Initialize ExceptionInfo content after it was allocated in __cxa_allocate_exception. + info.init(type, destructor); + exceptionLast = ptr; + uncaughtExceptionCount++; + throw ptr + " - Exception catching is disabled, this exception cannot be caught. Compile with -sNO_DISABLE_EXCEPTION_CATCHING or -sEXCEPTION_CATCHING_ALLOWED=[..] to catch."; + } + + var PATH = {isAbs:(path) => path.charAt(0) === '/',splitPath:(filename) => { + var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/; + return splitPathRe.exec(filename).slice(1); + },normalizeArray:(parts, allowAboveRoot) => { + // if the path tries to go above the root, `up` ends up > 0 + var up = 0; + for (var i = parts.length - 1; i >= 0; i--) { + var last = parts[i]; + if (last === '.') { + parts.splice(i, 1); + } else if (last === '..') { + parts.splice(i, 1); + up++; + } else if (up) { + parts.splice(i, 1); + up--; + } + } + // if the path is allowed to go above the root, restore leading ..s + if (allowAboveRoot) { + for (; up; up--) { + parts.unshift('..'); + } + } + return parts; + },normalize:(path) => { + var isAbsolute = PATH.isAbs(path), + trailingSlash = path.substr(-1) === '/'; + // Normalize the path + path = PATH.normalizeArray(path.split('/').filter((p) => !!p), !isAbsolute).join('/'); + if (!path && !isAbsolute) { + path = '.'; + } + if (path && trailingSlash) { + path += '/'; + } + return (isAbsolute ? '/' : '') + path; + },dirname:(path) => { + var result = PATH.splitPath(path), + root = result[0], + dir = result[1]; + if (!root && !dir) { + // No dirname whatsoever + return '.'; + } + if (dir) { + // It has a dirname, strip trailing slash + dir = dir.substr(0, dir.length - 1); + } + return root + dir; + },basename:(path) => { + // EMSCRIPTEN return '/'' for '/', not an empty string + if (path === '/') return '/'; + path = PATH.normalize(path); + path = path.replace(/\/$/, ""); + var lastSlash = path.lastIndexOf('/'); + if (lastSlash === -1) return path; + return path.substr(lastSlash+1); + },join:function() { + var paths = Array.prototype.slice.call(arguments); + return PATH.normalize(paths.join('/')); + },join2:(l, r) => { + return PATH.normalize(l + '/' + r); + }}; + + function getRandomDevice() { + if (typeof crypto == 'object' && typeof crypto['getRandomValues'] == 'function') { + // for modern web browsers + var randomBuffer = new Uint8Array(1); + return () => { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; }; + } else + if (ENVIRONMENT_IS_NODE) { + // for nodejs with or without crypto support included + try { + var crypto_module = require('crypto'); + // nodejs has crypto support + return () => crypto_module['randomBytes'](1)[0]; + } catch (e) { + // nodejs doesn't have crypto support + } + } + // we couldn't find a proper implementation, as Math.random() is not suitable for /dev/random, see emscripten-core/emscripten/pull/7096 + return () => abort("no cryptographic support found for randomDevice. consider polyfilling it if you want to use something insecure like Math.random(), e.g. put this in a --pre-js: var crypto = { getRandomValues: function(array) { for (var i = 0; i < array.length; i++) array[i] = (Math.random()*256)|0 } };"); + } + + + + var PATH_FS = {resolve:function() { + var resolvedPath = '', + resolvedAbsolute = false; + for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) { + var path = (i >= 0) ? arguments[i] : FS.cwd(); + // Skip empty and invalid entries + if (typeof path != 'string') { + throw new TypeError('Arguments to path.resolve must be strings'); + } else if (!path) { + return ''; // an invalid portion invalidates the whole thing + } + resolvedPath = path + '/' + resolvedPath; + resolvedAbsolute = PATH.isAbs(path); + } + // At this point the path should be resolved to a full absolute path, but + // handle relative paths to be safe (might happen when process.cwd() fails) + resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter((p) => !!p), !resolvedAbsolute).join('/'); + return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.'; + },relative:(from, to) => { + from = PATH_FS.resolve(from).substr(1); + to = PATH_FS.resolve(to).substr(1); + function trim(arr) { + var start = 0; + for (; start < arr.length; start++) { + if (arr[start] !== '') break; + } + var end = arr.length - 1; + for (; end >= 0; end--) { + if (arr[end] !== '') break; + } + if (start > end) return []; + return arr.slice(start, end - start + 1); + } + var fromParts = trim(from.split('/')); + var toParts = trim(to.split('/')); + var length = Math.min(fromParts.length, toParts.length); + var samePartsLength = length; + for (var i = 0; i < length; i++) { + if (fromParts[i] !== toParts[i]) { + samePartsLength = i; + break; + } + } + var outputParts = []; + for (var i = samePartsLength; i < fromParts.length; i++) { + outputParts.push('..'); + } + outputParts = outputParts.concat(toParts.slice(samePartsLength)); + return outputParts.join('/'); + }}; + + + /** @type {function(string, boolean=, number=)} */ + function intArrayFromString(stringy, dontAddNull, length) { + var len = length > 0 ? length : lengthBytesUTF8(stringy)+1; + var u8array = new Array(len); + var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length); + if (dontAddNull) u8array.length = numBytesWritten; + return u8array; + } + var TTY = {ttys:[],init:function () { + // https://github.com/emscripten-core/emscripten/pull/1555 + // if (ENVIRONMENT_IS_NODE) { + // // currently, FS.init does not distinguish if process.stdin is a file or TTY + // // device, it always assumes it's a TTY device. because of this, we're forcing + // // process.stdin to UTF8 encoding to at least make stdin reading compatible + // // with text files until FS.init can be refactored. + // process['stdin']['setEncoding']('utf8'); + // } + },shutdown:function() { + // https://github.com/emscripten-core/emscripten/pull/1555 + // if (ENVIRONMENT_IS_NODE) { + // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)? + // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation + // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists? + // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle + // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call + // process['stdin']['pause'](); + // } + },register:function(dev, ops) { + TTY.ttys[dev] = { input: [], output: [], ops: ops }; + FS.registerDevice(dev, TTY.stream_ops); + },stream_ops:{open:function(stream) { + var tty = TTY.ttys[stream.node.rdev]; + if (!tty) { + throw new FS.ErrnoError(43); + } + stream.tty = tty; + stream.seekable = false; + },close:function(stream) { + // flush any pending line data + stream.tty.ops.fsync(stream.tty); + },fsync:function(stream) { + stream.tty.ops.fsync(stream.tty); + },read:function(stream, buffer, offset, length, pos /* ignored */) { + if (!stream.tty || !stream.tty.ops.get_char) { + throw new FS.ErrnoError(60); + } + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = stream.tty.ops.get_char(stream.tty); + } catch (e) { + throw new FS.ErrnoError(29); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(6); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset+i] = result; + } + if (bytesRead) { + stream.node.timestamp = Date.now(); + } + return bytesRead; + },write:function(stream, buffer, offset, length, pos) { + if (!stream.tty || !stream.tty.ops.put_char) { + throw new FS.ErrnoError(60); + } + try { + for (var i = 0; i < length; i++) { + stream.tty.ops.put_char(stream.tty, buffer[offset+i]); + } + } catch (e) { + throw new FS.ErrnoError(29); + } + if (length) { + stream.node.timestamp = Date.now(); + } + return i; + }},default_tty_ops:{get_char:function(tty) { + if (!tty.input.length) { + var result = null; + if (ENVIRONMENT_IS_NODE) { + // we will read data by chunks of BUFSIZE + var BUFSIZE = 256; + var buf = Buffer.alloc(BUFSIZE); + var bytesRead = 0; + + try { + bytesRead = fs.readSync(process.stdin.fd, buf, 0, BUFSIZE, -1); + } catch(e) { + // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes, + // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0. + if (e.toString().includes('EOF')) bytesRead = 0; + else throw e; + } + + if (bytesRead > 0) { + result = buf.slice(0, bytesRead).toString('utf-8'); + } else { + result = null; + } + } else + if (typeof window != 'undefined' && + typeof window.prompt == 'function') { + // Browser. + result = window.prompt('Input: '); // returns null on cancel + if (result !== null) { + result += '\n'; + } + } else if (typeof readline == 'function') { + // Command line. + result = readline(); + if (result !== null) { + result += '\n'; + } + } + if (!result) { + return null; + } + tty.input = intArrayFromString(result, true); + } + return tty.input.shift(); + },put_char:function(tty, val) { + if (val === null || val === 10) { + out(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle. + } + },fsync:function(tty) { + if (tty.output && tty.output.length > 0) { + out(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } + }},default_tty1_ops:{put_char:function(tty, val) { + if (val === null || val === 10) { + err(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); + } + },fsync:function(tty) { + if (tty.output && tty.output.length > 0) { + err(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } + }}}; + + + function zeroMemory(address, size) { + HEAPU8.fill(0, address, address + size); + return address; + } + + function alignMemory(size, alignment) { + assert(alignment, "alignment argument is required"); + return Math.ceil(size / alignment) * alignment; + } + function mmapAlloc(size) { + size = alignMemory(size, 65536); + var ptr = _emscripten_builtin_memalign(65536, size); + if (!ptr) return 0; + return zeroMemory(ptr, size); + } + var MEMFS = {ops_table:null,mount:function(mount) { + return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0); + },createNode:function(parent, name, mode, dev) { + if (FS.isBlkdev(mode) || FS.isFIFO(mode)) { + // no supported + throw new FS.ErrnoError(63); + } + if (!MEMFS.ops_table) { + MEMFS.ops_table = { + dir: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + lookup: MEMFS.node_ops.lookup, + mknod: MEMFS.node_ops.mknod, + rename: MEMFS.node_ops.rename, + unlink: MEMFS.node_ops.unlink, + rmdir: MEMFS.node_ops.rmdir, + readdir: MEMFS.node_ops.readdir, + symlink: MEMFS.node_ops.symlink + }, + stream: { + llseek: MEMFS.stream_ops.llseek + } + }, + file: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: { + llseek: MEMFS.stream_ops.llseek, + read: MEMFS.stream_ops.read, + write: MEMFS.stream_ops.write, + allocate: MEMFS.stream_ops.allocate, + mmap: MEMFS.stream_ops.mmap, + msync: MEMFS.stream_ops.msync + } + }, + link: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + readlink: MEMFS.node_ops.readlink + }, + stream: {} + }, + chrdev: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: FS.chrdev_stream_ops + } + }; + } + var node = FS.createNode(parent, name, mode, dev); + if (FS.isDir(node.mode)) { + node.node_ops = MEMFS.ops_table.dir.node; + node.stream_ops = MEMFS.ops_table.dir.stream; + node.contents = {}; + } else if (FS.isFile(node.mode)) { + node.node_ops = MEMFS.ops_table.file.node; + node.stream_ops = MEMFS.ops_table.file.stream; + node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity. + // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred + // for performance, and used by default. However, typed arrays are not like normal JS arrays are, so there is a small disk size + // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme. + node.contents = null; + } else if (FS.isLink(node.mode)) { + node.node_ops = MEMFS.ops_table.link.node; + node.stream_ops = MEMFS.ops_table.link.stream; + } else if (FS.isChrdev(node.mode)) { + node.node_ops = MEMFS.ops_table.chrdev.node; + node.stream_ops = MEMFS.ops_table.chrdev.stream; + } + node.timestamp = Date.now(); + // add the new node to the parent + if (parent) { + parent.contents[name] = node; + parent.timestamp = node.timestamp; + } + return node; + },getFileDataAsTypedArray:function(node) { + if (!node.contents) return new Uint8Array(0); + if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes. + return new Uint8Array(node.contents); + },expandFileStorage:function(node, newCapacity) { + var prevCapacity = node.contents ? node.contents.length : 0; + if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough. + // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity. + // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to + // avoid overshooting the allocation cap by a very large margin. + var CAPACITY_DOUBLING_MAX = 1024 * 1024; + newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) >>> 0); + if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding. + var oldContents = node.contents; + node.contents = new Uint8Array(newCapacity); // Allocate new storage. + if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage. + },resizeFileStorage:function(node, newSize) { + if (node.usedBytes == newSize) return; + if (newSize == 0) { + node.contents = null; // Fully decommit when requesting a resize to zero. + node.usedBytes = 0; + } else { + var oldContents = node.contents; + node.contents = new Uint8Array(newSize); // Allocate new storage. + if (oldContents) { + node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage. + } + node.usedBytes = newSize; + } + },node_ops:{getattr:function(node) { + var attr = {}; + // device numbers reuse inode numbers. + attr.dev = FS.isChrdev(node.mode) ? node.id : 1; + attr.ino = node.id; + attr.mode = node.mode; + attr.nlink = 1; + attr.uid = 0; + attr.gid = 0; + attr.rdev = node.rdev; + if (FS.isDir(node.mode)) { + attr.size = 4096; + } else if (FS.isFile(node.mode)) { + attr.size = node.usedBytes; + } else if (FS.isLink(node.mode)) { + attr.size = node.link.length; + } else { + attr.size = 0; + } + attr.atime = new Date(node.timestamp); + attr.mtime = new Date(node.timestamp); + attr.ctime = new Date(node.timestamp); + // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize), + // but this is not required by the standard. + attr.blksize = 4096; + attr.blocks = Math.ceil(attr.size / attr.blksize); + return attr; + },setattr:function(node, attr) { + if (attr.mode !== undefined) { + node.mode = attr.mode; + } + if (attr.timestamp !== undefined) { + node.timestamp = attr.timestamp; + } + if (attr.size !== undefined) { + MEMFS.resizeFileStorage(node, attr.size); + } + },lookup:function(parent, name) { + throw FS.genericErrors[44]; + },mknod:function(parent, name, mode, dev) { + return MEMFS.createNode(parent, name, mode, dev); + },rename:function(old_node, new_dir, new_name) { + // if we're overwriting a directory at new_name, make sure it's empty. + if (FS.isDir(old_node.mode)) { + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) { + } + if (new_node) { + for (var i in new_node.contents) { + throw new FS.ErrnoError(55); + } + } + } + // do the internal rewiring + delete old_node.parent.contents[old_node.name]; + old_node.parent.timestamp = Date.now() + old_node.name = new_name; + new_dir.contents[new_name] = old_node; + new_dir.timestamp = old_node.parent.timestamp; + old_node.parent = new_dir; + },unlink:function(parent, name) { + delete parent.contents[name]; + parent.timestamp = Date.now(); + },rmdir:function(parent, name) { + var node = FS.lookupNode(parent, name); + for (var i in node.contents) { + throw new FS.ErrnoError(55); + } + delete parent.contents[name]; + parent.timestamp = Date.now(); + },readdir:function(node) { + var entries = ['.', '..']; + for (var key in node.contents) { + if (!node.contents.hasOwnProperty(key)) { + continue; + } + entries.push(key); + } + return entries; + },symlink:function(parent, newname, oldpath) { + var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0); + node.link = oldpath; + return node; + },readlink:function(node) { + if (!FS.isLink(node.mode)) { + throw new FS.ErrnoError(28); + } + return node.link; + }},stream_ops:{read:function(stream, buffer, offset, length, position) { + var contents = stream.node.contents; + if (position >= stream.node.usedBytes) return 0; + var size = Math.min(stream.node.usedBytes - position, length); + assert(size >= 0); + if (size > 8 && contents.subarray) { // non-trivial, and typed array + buffer.set(contents.subarray(position, position + size), offset); + } else { + for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i]; + } + return size; + },write:function(stream, buffer, offset, length, position, canOwn) { + // The data buffer should be a typed array view + assert(!(buffer instanceof ArrayBuffer)); + // If the buffer is located in main memory (HEAP), and if + // memory can grow, we can't hold on to references of the + // memory buffer, as they may get invalidated. That means we + // need to do copy its contents. + if (buffer.buffer === HEAP8.buffer) { + canOwn = false; + } + + if (!length) return 0; + var node = stream.node; + node.timestamp = Date.now(); + + if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array? + if (canOwn) { + assert(position === 0, 'canOwn must imply no weird position inside the file'); + node.contents = buffer.subarray(offset, offset + length); + node.usedBytes = length; + return length; + } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data. + node.contents = buffer.slice(offset, offset + length); + node.usedBytes = length; + return length; + } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file? + node.contents.set(buffer.subarray(offset, offset + length), position); + return length; + } + } + + // Appending to an existing file and we need to reallocate, or source data did not come as a typed array. + MEMFS.expandFileStorage(node, position+length); + if (node.contents.subarray && buffer.subarray) { + // Use typed array write which is available. + node.contents.set(buffer.subarray(offset, offset + length), position); + } else { + for (var i = 0; i < length; i++) { + node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not. + } + } + node.usedBytes = Math.max(node.usedBytes, position + length); + return length; + },llseek:function(stream, offset, whence) { + var position = offset; + if (whence === 1) { + position += stream.position; + } else if (whence === 2) { + if (FS.isFile(stream.node.mode)) { + position += stream.node.usedBytes; + } + } + if (position < 0) { + throw new FS.ErrnoError(28); + } + return position; + },allocate:function(stream, offset, length) { + MEMFS.expandFileStorage(stream.node, offset + length); + stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length); + },mmap:function(stream, length, position, prot, flags) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + var ptr; + var allocated; + var contents = stream.node.contents; + // Only make a new copy when MAP_PRIVATE is specified. + if (!(flags & 2) && contents.buffer === HEAP8.buffer) { + // We can't emulate MAP_SHARED when the file is not backed by the + // buffer we're mapping to (e.g. the HEAP buffer). + allocated = false; + ptr = contents.byteOffset; + } else { + // Try to avoid unnecessary slices. + if (position > 0 || position + length < contents.length) { + if (contents.subarray) { + contents = contents.subarray(position, position + length); + } else { + contents = Array.prototype.slice.call(contents, position, position + length); + } + } + allocated = true; + ptr = mmapAlloc(length); + if (!ptr) { + throw new FS.ErrnoError(48); + } + HEAP8.set(contents, ptr); + } + return { ptr: ptr, allocated: allocated }; + },msync:function(stream, buffer, offset, length, mmapFlags) { + MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false); + // should we check if bytesWritten and length are the same? + return 0; + }}}; + + /** @param {boolean=} noRunDep */ + function asyncLoad(url, onload, onerror, noRunDep) { + var dep = !noRunDep ? getUniqueRunDependency('al ' + url) : ''; + readAsync(url, (arrayBuffer) => { + assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).'); + onload(new Uint8Array(arrayBuffer)); + if (dep) removeRunDependency(dep); + }, (event) => { + if (onerror) { + onerror(); + } else { + throw 'Loading data file "' + url + '" failed.'; + } + }); + if (dep) addRunDependency(dep); + } + + + var ERRNO_MESSAGES = {0:"Success",1:"Arg list too long",2:"Permission denied",3:"Address already in use",4:"Address not available",5:"Address family not supported by protocol family",6:"No more processes",7:"Socket already connected",8:"Bad file number",9:"Trying to read unreadable message",10:"Mount device busy",11:"Operation canceled",12:"No children",13:"Connection aborted",14:"Connection refused",15:"Connection reset by peer",16:"File locking deadlock error",17:"Destination address required",18:"Math arg out of domain of func",19:"Quota exceeded",20:"File exists",21:"Bad address",22:"File too large",23:"Host is unreachable",24:"Identifier removed",25:"Illegal byte sequence",26:"Connection already in progress",27:"Interrupted system call",28:"Invalid argument",29:"I/O error",30:"Socket is already connected",31:"Is a directory",32:"Too many symbolic links",33:"Too many open files",34:"Too many links",35:"Message too long",36:"Multihop attempted",37:"File or path name too long",38:"Network interface is not configured",39:"Connection reset by network",40:"Network is unreachable",41:"Too many open files in system",42:"No buffer space available",43:"No such device",44:"No such file or directory",45:"Exec format error",46:"No record locks available",47:"The link has been severed",48:"Not enough core",49:"No message of desired type",50:"Protocol not available",51:"No space left on device",52:"Function not implemented",53:"Socket is not connected",54:"Not a directory",55:"Directory not empty",56:"State not recoverable",57:"Socket operation on non-socket",59:"Not a typewriter",60:"No such device or address",61:"Value too large for defined data type",62:"Previous owner died",63:"Not super-user",64:"Broken pipe",65:"Protocol error",66:"Unknown protocol",67:"Protocol wrong type for socket",68:"Math result not representable",69:"Read only file system",70:"Illegal seek",71:"No such process",72:"Stale file handle",73:"Connection timed out",74:"Text file busy",75:"Cross-device link",100:"Device not a stream",101:"Bad font file fmt",102:"Invalid slot",103:"Invalid request code",104:"No anode",105:"Block device required",106:"Channel number out of range",107:"Level 3 halted",108:"Level 3 reset",109:"Link number out of range",110:"Protocol driver not attached",111:"No CSI structure available",112:"Level 2 halted",113:"Invalid exchange",114:"Invalid request descriptor",115:"Exchange full",116:"No data (for no delay io)",117:"Timer expired",118:"Out of streams resources",119:"Machine is not on the network",120:"Package not installed",121:"The object is remote",122:"Advertise error",123:"Srmount error",124:"Communication error on send",125:"Cross mount point (not really error)",126:"Given log. name not unique",127:"f.d. invalid for this operation",128:"Remote address changed",129:"Can access a needed shared lib",130:"Accessing a corrupted shared lib",131:".lib section in a.out corrupted",132:"Attempting to link in too many libs",133:"Attempting to exec a shared library",135:"Streams pipe error",136:"Too many users",137:"Socket type not supported",138:"Not supported",139:"Protocol family not supported",140:"Can't send after socket shutdown",141:"Too many references",142:"Host is down",148:"No medium (in tape drive)",156:"Level 2 not synchronized"}; + + var ERRNO_CODES = {}; + + function demangle(func) { + warnOnce('warning: build with -sDEMANGLE_SUPPORT to link in libcxxabi demangling'); + return func; + } + function demangleAll(text) { + var regex = + /\b_Z[\w\d_]+/g; + return text.replace(regex, + function(x) { + var y = demangle(x); + return x === y ? x : (y + ' [' + x + ']'); + }); + } + var FS = {root:null,mounts:[],devices:{},streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,lookupPath:(path, opts = {}) => { + path = PATH_FS.resolve(path); + + if (!path) return { path: '', node: null }; + + var defaults = { + follow_mount: true, + recurse_count: 0 + }; + opts = Object.assign(defaults, opts) + + if (opts.recurse_count > 8) { // max recursive lookup of 8 + throw new FS.ErrnoError(32); + } + + // split the absolute path + var parts = path.split('/').filter((p) => !!p); + + // start at the root + var current = FS.root; + var current_path = '/'; + + for (var i = 0; i < parts.length; i++) { + var islast = (i === parts.length-1); + if (islast && opts.parent) { + // stop resolving + break; + } + + current = FS.lookupNode(current, parts[i]); + current_path = PATH.join2(current_path, parts[i]); + + // jump to the mount's root node if this is a mountpoint + if (FS.isMountpoint(current)) { + if (!islast || (islast && opts.follow_mount)) { + current = current.mounted.root; + } + } + + // by default, lookupPath will not follow a symlink if it is the final path component. + // setting opts.follow = true will override this behavior. + if (!islast || opts.follow) { + var count = 0; + while (FS.isLink(current.mode)) { + var link = FS.readlink(current_path); + current_path = PATH_FS.resolve(PATH.dirname(current_path), link); + + var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count + 1 }); + current = lookup.node; + + if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX). + throw new FS.ErrnoError(32); + } + } + } + } + + return { path: current_path, node: current }; + },getPath:(node) => { + var path; + while (true) { + if (FS.isRoot(node)) { + var mount = node.mount.mountpoint; + if (!path) return mount; + return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path; + } + path = path ? node.name + '/' + path : node.name; + node = node.parent; + } + },hashName:(parentid, name) => { + var hash = 0; + + for (var i = 0; i < name.length; i++) { + hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0; + } + return ((parentid + hash) >>> 0) % FS.nameTable.length; + },hashAddNode:(node) => { + var hash = FS.hashName(node.parent.id, node.name); + node.name_next = FS.nameTable[hash]; + FS.nameTable[hash] = node; + },hashRemoveNode:(node) => { + var hash = FS.hashName(node.parent.id, node.name); + if (FS.nameTable[hash] === node) { + FS.nameTable[hash] = node.name_next; + } else { + var current = FS.nameTable[hash]; + while (current) { + if (current.name_next === node) { + current.name_next = node.name_next; + break; + } + current = current.name_next; + } + } + },lookupNode:(parent, name) => { + var errCode = FS.mayLookup(parent); + if (errCode) { + throw new FS.ErrnoError(errCode, parent); + } + var hash = FS.hashName(parent.id, name); + for (var node = FS.nameTable[hash]; node; node = node.name_next) { + var nodeName = node.name; + if (node.parent.id === parent.id && nodeName === name) { + return node; + } + } + // if we failed to find it in the cache, call into the VFS + return FS.lookup(parent, name); + },createNode:(parent, name, mode, rdev) => { + assert(typeof parent == 'object') + var node = new FS.FSNode(parent, name, mode, rdev); + + FS.hashAddNode(node); + + return node; + },destroyNode:(node) => { + FS.hashRemoveNode(node); + },isRoot:(node) => { + return node === node.parent; + },isMountpoint:(node) => { + return !!node.mounted; + },isFile:(mode) => { + return (mode & 61440) === 32768; + },isDir:(mode) => { + return (mode & 61440) === 16384; + },isLink:(mode) => { + return (mode & 61440) === 40960; + },isChrdev:(mode) => { + return (mode & 61440) === 8192; + },isBlkdev:(mode) => { + return (mode & 61440) === 24576; + },isFIFO:(mode) => { + return (mode & 61440) === 4096; + },isSocket:(mode) => { + return (mode & 49152) === 49152; + },flagModes:{"r":0,"r+":2,"w":577,"w+":578,"a":1089,"a+":1090},modeStringToFlags:(str) => { + var flags = FS.flagModes[str]; + if (typeof flags == 'undefined') { + throw new Error('Unknown file open mode: ' + str); + } + return flags; + },flagsToPermissionString:(flag) => { + var perms = ['r', 'w', 'rw'][flag & 3]; + if ((flag & 512)) { + perms += 'w'; + } + return perms; + },nodePermissions:(node, perms) => { + if (FS.ignorePermissions) { + return 0; + } + // return 0 if any user, group or owner bits are set. + if (perms.includes('r') && !(node.mode & 292)) { + return 2; + } else if (perms.includes('w') && !(node.mode & 146)) { + return 2; + } else if (perms.includes('x') && !(node.mode & 73)) { + return 2; + } + return 0; + },mayLookup:(dir) => { + var errCode = FS.nodePermissions(dir, 'x'); + if (errCode) return errCode; + if (!dir.node_ops.lookup) return 2; + return 0; + },mayCreate:(dir, name) => { + try { + var node = FS.lookupNode(dir, name); + return 20; + } catch (e) { + } + return FS.nodePermissions(dir, 'wx'); + },mayDelete:(dir, name, isdir) => { + var node; + try { + node = FS.lookupNode(dir, name); + } catch (e) { + return e.errno; + } + var errCode = FS.nodePermissions(dir, 'wx'); + if (errCode) { + return errCode; + } + if (isdir) { + if (!FS.isDir(node.mode)) { + return 54; + } + if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) { + return 10; + } + } else { + if (FS.isDir(node.mode)) { + return 31; + } + } + return 0; + },mayOpen:(node, flags) => { + if (!node) { + return 44; + } + if (FS.isLink(node.mode)) { + return 32; + } else if (FS.isDir(node.mode)) { + if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write + (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only) + return 31; + } + } + return FS.nodePermissions(node, FS.flagsToPermissionString(flags)); + },MAX_OPEN_FDS:4096,nextfd:(fd_start = 0, fd_end = FS.MAX_OPEN_FDS) => { + for (var fd = fd_start; fd <= fd_end; fd++) { + if (!FS.streams[fd]) { + return fd; + } + } + throw new FS.ErrnoError(33); + },getStream:(fd) => FS.streams[fd],createStream:(stream, fd_start, fd_end) => { + if (!FS.FSStream) { + FS.FSStream = /** @constructor */ function() { + this.shared = { }; + }; + FS.FSStream.prototype = {}; + Object.defineProperties(FS.FSStream.prototype, { + object: { + /** @this {FS.FSStream} */ + get: function() { return this.node; }, + /** @this {FS.FSStream} */ + set: function(val) { this.node = val; } + }, + isRead: { + /** @this {FS.FSStream} */ + get: function() { return (this.flags & 2097155) !== 1; } + }, + isWrite: { + /** @this {FS.FSStream} */ + get: function() { return (this.flags & 2097155) !== 0; } + }, + isAppend: { + /** @this {FS.FSStream} */ + get: function() { return (this.flags & 1024); } + }, + flags: { + /** @this {FS.FSStream} */ + get: function() { return this.shared.flags; }, + /** @this {FS.FSStream} */ + set: function(val) { this.shared.flags = val; }, + }, + position : { + /** @this {FS.FSStream} */ + get: function() { return this.shared.position; }, + /** @this {FS.FSStream} */ + set: function(val) { this.shared.position = val; }, + }, + }); + } + // clone it, so we can return an instance of FSStream + stream = Object.assign(new FS.FSStream(), stream); + var fd = FS.nextfd(fd_start, fd_end); + stream.fd = fd; + FS.streams[fd] = stream; + return stream; + },closeStream:(fd) => { + FS.streams[fd] = null; + },chrdev_stream_ops:{open:(stream) => { + var device = FS.getDevice(stream.node.rdev); + // override node's stream ops with the device's + stream.stream_ops = device.stream_ops; + // forward the open call + if (stream.stream_ops.open) { + stream.stream_ops.open(stream); + } + },llseek:() => { + throw new FS.ErrnoError(70); + }},major:(dev) => ((dev) >> 8),minor:(dev) => ((dev) & 0xff),makedev:(ma, mi) => ((ma) << 8 | (mi)),registerDevice:(dev, ops) => { + FS.devices[dev] = { stream_ops: ops }; + },getDevice:(dev) => FS.devices[dev],getMounts:(mount) => { + var mounts = []; + var check = [mount]; + + while (check.length) { + var m = check.pop(); + + mounts.push(m); + + check.push.apply(check, m.mounts); + } + + return mounts; + },syncfs:(populate, callback) => { + if (typeof populate == 'function') { + callback = populate; + populate = false; + } + + FS.syncFSRequests++; + + if (FS.syncFSRequests > 1) { + err('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work'); + } + + var mounts = FS.getMounts(FS.root.mount); + var completed = 0; + + function doCallback(errCode) { + assert(FS.syncFSRequests > 0); + FS.syncFSRequests--; + return callback(errCode); + } + + function done(errCode) { + if (errCode) { + if (!done.errored) { + done.errored = true; + return doCallback(errCode); + } + return; + } + if (++completed >= mounts.length) { + doCallback(null); + } + }; + + // sync all mounts + mounts.forEach((mount) => { + if (!mount.type.syncfs) { + return done(null); + } + mount.type.syncfs(mount, populate, done); + }); + },mount:(type, opts, mountpoint) => { + if (typeof type == 'string') { + // The filesystem was not included, and instead we have an error + // message stored in the variable. + throw type; + } + var root = mountpoint === '/'; + var pseudo = !mountpoint; + var node; + + if (root && FS.root) { + throw new FS.ErrnoError(10); + } else if (!root && !pseudo) { + var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); + + mountpoint = lookup.path; // use the absolute path + node = lookup.node; + + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + + if (!FS.isDir(node.mode)) { + throw new FS.ErrnoError(54); + } + } + + var mount = { + type: type, + opts: opts, + mountpoint: mountpoint, + mounts: [] + }; + + // create a root node for the fs + var mountRoot = type.mount(mount); + mountRoot.mount = mount; + mount.root = mountRoot; + + if (root) { + FS.root = mountRoot; + } else if (node) { + // set as a mountpoint + node.mounted = mount; + + // add the new mount to the current mount's children + if (node.mount) { + node.mount.mounts.push(mount); + } + } + + return mountRoot; + },unmount:(mountpoint) => { + var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); + + if (!FS.isMountpoint(lookup.node)) { + throw new FS.ErrnoError(28); + } + + // destroy the nodes for this mount, and all its child mounts + var node = lookup.node; + var mount = node.mounted; + var mounts = FS.getMounts(mount); + + Object.keys(FS.nameTable).forEach((hash) => { + var current = FS.nameTable[hash]; + + while (current) { + var next = current.name_next; + + if (mounts.includes(current.mount)) { + FS.destroyNode(current); + } + + current = next; + } + }); + + // no longer a mountpoint + node.mounted = null; + + // remove this mount from the child mounts + var idx = node.mount.mounts.indexOf(mount); + assert(idx !== -1); + node.mount.mounts.splice(idx, 1); + },lookup:(parent, name) => { + return parent.node_ops.lookup(parent, name); + },mknod:(path, mode, dev) => { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + if (!name || name === '.' || name === '..') { + throw new FS.ErrnoError(28); + } + var errCode = FS.mayCreate(parent, name); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.mknod) { + throw new FS.ErrnoError(63); + } + return parent.node_ops.mknod(parent, name, mode, dev); + },create:(path, mode) => { + mode = mode !== undefined ? mode : 438 /* 0666 */; + mode &= 4095; + mode |= 32768; + return FS.mknod(path, mode, 0); + },mkdir:(path, mode) => { + mode = mode !== undefined ? mode : 511 /* 0777 */; + mode &= 511 | 512; + mode |= 16384; + return FS.mknod(path, mode, 0); + },mkdirTree:(path, mode) => { + var dirs = path.split('/'); + var d = ''; + for (var i = 0; i < dirs.length; ++i) { + if (!dirs[i]) continue; + d += '/' + dirs[i]; + try { + FS.mkdir(d, mode); + } catch(e) { + if (e.errno != 20) throw e; + } + } + },mkdev:(path, mode, dev) => { + if (typeof dev == 'undefined') { + dev = mode; + mode = 438 /* 0666 */; + } + mode |= 8192; + return FS.mknod(path, mode, dev); + },symlink:(oldpath, newpath) => { + if (!PATH_FS.resolve(oldpath)) { + throw new FS.ErrnoError(44); + } + var lookup = FS.lookupPath(newpath, { parent: true }); + var parent = lookup.node; + if (!parent) { + throw new FS.ErrnoError(44); + } + var newname = PATH.basename(newpath); + var errCode = FS.mayCreate(parent, newname); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.symlink) { + throw new FS.ErrnoError(63); + } + return parent.node_ops.symlink(parent, newname, oldpath); + },rename:(old_path, new_path) => { + var old_dirname = PATH.dirname(old_path); + var new_dirname = PATH.dirname(new_path); + var old_name = PATH.basename(old_path); + var new_name = PATH.basename(new_path); + // parents must exist + var lookup, old_dir, new_dir; + + // let the errors from non existant directories percolate up + lookup = FS.lookupPath(old_path, { parent: true }); + old_dir = lookup.node; + lookup = FS.lookupPath(new_path, { parent: true }); + new_dir = lookup.node; + + if (!old_dir || !new_dir) throw new FS.ErrnoError(44); + // need to be part of the same mount + if (old_dir.mount !== new_dir.mount) { + throw new FS.ErrnoError(75); + } + // source must exist + var old_node = FS.lookupNode(old_dir, old_name); + // old path should not be an ancestor of the new path + var relative = PATH_FS.relative(old_path, new_dirname); + if (relative.charAt(0) !== '.') { + throw new FS.ErrnoError(28); + } + // new path should not be an ancestor of the old path + relative = PATH_FS.relative(new_path, old_dirname); + if (relative.charAt(0) !== '.') { + throw new FS.ErrnoError(55); + } + // see if the new path already exists + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) { + // not fatal + } + // early out if nothing needs to change + if (old_node === new_node) { + return; + } + // we'll need to delete the old entry + var isdir = FS.isDir(old_node.mode); + var errCode = FS.mayDelete(old_dir, old_name, isdir); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + // need delete permissions if we'll be overwriting. + // need create permissions if new doesn't already exist. + errCode = new_node ? + FS.mayDelete(new_dir, new_name, isdir) : + FS.mayCreate(new_dir, new_name); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!old_dir.node_ops.rename) { + throw new FS.ErrnoError(63); + } + if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) { + throw new FS.ErrnoError(10); + } + // if we are going to change the parent, check write permissions + if (new_dir !== old_dir) { + errCode = FS.nodePermissions(old_dir, 'w'); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + } + // remove the node from the lookup hash + FS.hashRemoveNode(old_node); + // do the underlying fs rename + try { + old_dir.node_ops.rename(old_node, new_dir, new_name); + } catch (e) { + throw e; + } finally { + // add the node back to the hash (in case node_ops.rename + // changed its name) + FS.hashAddNode(old_node); + } + },rmdir:(path) => { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var errCode = FS.mayDelete(parent, name, true); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.rmdir) { + throw new FS.ErrnoError(63); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + parent.node_ops.rmdir(parent, name); + FS.destroyNode(node); + },readdir:(path) => { + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + if (!node.node_ops.readdir) { + throw new FS.ErrnoError(54); + } + return node.node_ops.readdir(node); + },unlink:(path) => { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + if (!parent) { + throw new FS.ErrnoError(44); + } + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var errCode = FS.mayDelete(parent, name, false); + if (errCode) { + // According to POSIX, we should map EISDIR to EPERM, but + // we instead do what Linux does (and we must, as we use + // the musl linux libc). + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.unlink) { + throw new FS.ErrnoError(63); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + parent.node_ops.unlink(parent, name); + FS.destroyNode(node); + },readlink:(path) => { + var lookup = FS.lookupPath(path); + var link = lookup.node; + if (!link) { + throw new FS.ErrnoError(44); + } + if (!link.node_ops.readlink) { + throw new FS.ErrnoError(28); + } + return PATH_FS.resolve(FS.getPath(link.parent), link.node_ops.readlink(link)); + },stat:(path, dontFollow) => { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + var node = lookup.node; + if (!node) { + throw new FS.ErrnoError(44); + } + if (!node.node_ops.getattr) { + throw new FS.ErrnoError(63); + } + return node.node_ops.getattr(node); + },lstat:(path) => { + return FS.stat(path, true); + },chmod:(path, mode, dontFollow) => { + var node; + if (typeof path == 'string') { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + node.node_ops.setattr(node, { + mode: (mode & 4095) | (node.mode & ~4095), + timestamp: Date.now() + }); + },lchmod:(path, mode) => { + FS.chmod(path, mode, true); + },fchmod:(fd, mode) => { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(8); + } + FS.chmod(stream.node, mode); + },chown:(path, uid, gid, dontFollow) => { + var node; + if (typeof path == 'string') { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + node.node_ops.setattr(node, { + timestamp: Date.now() + // we ignore the uid / gid for now + }); + },lchown:(path, uid, gid) => { + FS.chown(path, uid, gid, true); + },fchown:(fd, uid, gid) => { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(8); + } + FS.chown(stream.node, uid, gid); + },truncate:(path, len) => { + if (len < 0) { + throw new FS.ErrnoError(28); + } + var node; + if (typeof path == 'string') { + var lookup = FS.lookupPath(path, { follow: true }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + if (FS.isDir(node.mode)) { + throw new FS.ErrnoError(31); + } + if (!FS.isFile(node.mode)) { + throw new FS.ErrnoError(28); + } + var errCode = FS.nodePermissions(node, 'w'); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + node.node_ops.setattr(node, { + size: len, + timestamp: Date.now() + }); + },ftruncate:(fd, len) => { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(8); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(28); + } + FS.truncate(stream.node, len); + },utime:(path, atime, mtime) => { + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + node.node_ops.setattr(node, { + timestamp: Math.max(atime, mtime) + }); + },open:(path, flags, mode) => { + if (path === "") { + throw new FS.ErrnoError(44); + } + flags = typeof flags == 'string' ? FS.modeStringToFlags(flags) : flags; + mode = typeof mode == 'undefined' ? 438 /* 0666 */ : mode; + if ((flags & 64)) { + mode = (mode & 4095) | 32768; + } else { + mode = 0; + } + var node; + if (typeof path == 'object') { + node = path; + } else { + path = PATH.normalize(path); + try { + var lookup = FS.lookupPath(path, { + follow: !(flags & 131072) + }); + node = lookup.node; + } catch (e) { + // ignore + } + } + // perhaps we need to create the node + var created = false; + if ((flags & 64)) { + if (node) { + // if O_CREAT and O_EXCL are set, error out if the node already exists + if ((flags & 128)) { + throw new FS.ErrnoError(20); + } + } else { + // node doesn't exist, try to create it + node = FS.mknod(path, mode, 0); + created = true; + } + } + if (!node) { + throw new FS.ErrnoError(44); + } + // can't truncate a device + if (FS.isChrdev(node.mode)) { + flags &= ~512; + } + // if asked only for a directory, then this must be one + if ((flags & 65536) && !FS.isDir(node.mode)) { + throw new FS.ErrnoError(54); + } + // check permissions, if this is not a file we just created now (it is ok to + // create and write to a file with read-only permissions; it is read-only + // for later use) + if (!created) { + var errCode = FS.mayOpen(node, flags); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + } + // do truncation if necessary + if ((flags & 512) && !created) { + FS.truncate(node, 0); + } + // we've already handled these, don't pass down to the underlying vfs + flags &= ~(128 | 512 | 131072); + + // register the stream with the filesystem + var stream = FS.createStream({ + node: node, + path: FS.getPath(node), // we want the absolute path to the node + flags: flags, + seekable: true, + position: 0, + stream_ops: node.stream_ops, + // used by the file family libc calls (fopen, fwrite, ferror, etc.) + ungotten: [], + error: false + }); + // call the new stream's open function + if (stream.stream_ops.open) { + stream.stream_ops.open(stream); + } + if (Module['logReadFiles'] && !(flags & 1)) { + if (!FS.readFiles) FS.readFiles = {}; + if (!(path in FS.readFiles)) { + FS.readFiles[path] = 1; + } + } + return stream; + },close:(stream) => { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (stream.getdents) stream.getdents = null; // free readdir state + try { + if (stream.stream_ops.close) { + stream.stream_ops.close(stream); + } + } catch (e) { + throw e; + } finally { + FS.closeStream(stream.fd); + } + stream.fd = null; + },isClosed:(stream) => { + return stream.fd === null; + },llseek:(stream, offset, whence) => { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (!stream.seekable || !stream.stream_ops.llseek) { + throw new FS.ErrnoError(70); + } + if (whence != 0 && whence != 1 && whence != 2) { + throw new FS.ErrnoError(28); + } + stream.position = stream.stream_ops.llseek(stream, offset, whence); + stream.ungotten = []; + return stream.position; + },read:(stream, buffer, offset, length, position) => { + if (length < 0 || position < 0) { + throw new FS.ErrnoError(28); + } + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(8); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(31); + } + if (!stream.stream_ops.read) { + throw new FS.ErrnoError(28); + } + var seeking = typeof position != 'undefined'; + if (!seeking) { + position = stream.position; + } else if (!stream.seekable) { + throw new FS.ErrnoError(70); + } + var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position); + if (!seeking) stream.position += bytesRead; + return bytesRead; + },write:(stream, buffer, offset, length, position, canOwn) => { + if (length < 0 || position < 0) { + throw new FS.ErrnoError(28); + } + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(8); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(31); + } + if (!stream.stream_ops.write) { + throw new FS.ErrnoError(28); + } + if (stream.seekable && stream.flags & 1024) { + // seek to the end before writing in append mode + FS.llseek(stream, 0, 2); + } + var seeking = typeof position != 'undefined'; + if (!seeking) { + position = stream.position; + } else if (!stream.seekable) { + throw new FS.ErrnoError(70); + } + var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn); + if (!seeking) stream.position += bytesWritten; + return bytesWritten; + },allocate:(stream, offset, length) => { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (offset < 0 || length <= 0) { + throw new FS.ErrnoError(28); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(8); + } + if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + if (!stream.stream_ops.allocate) { + throw new FS.ErrnoError(138); + } + stream.stream_ops.allocate(stream, offset, length); + },mmap:(stream, length, position, prot, flags) => { + // User requests writing to file (prot & PROT_WRITE != 0). + // Checking if we have permissions to write to the file unless + // MAP_PRIVATE flag is set. According to POSIX spec it is possible + // to write to file opened in read-only mode with MAP_PRIVATE flag, + // as all modifications will be visible only in the memory of + // the current process. + if ((prot & 2) !== 0 + && (flags & 2) === 0 + && (stream.flags & 2097155) !== 2) { + throw new FS.ErrnoError(2); + } + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(2); + } + if (!stream.stream_ops.mmap) { + throw new FS.ErrnoError(43); + } + return stream.stream_ops.mmap(stream, length, position, prot, flags); + },msync:(stream, buffer, offset, length, mmapFlags) => { + if (!stream.stream_ops.msync) { + return 0; + } + return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags); + },munmap:(stream) => 0,ioctl:(stream, cmd, arg) => { + if (!stream.stream_ops.ioctl) { + throw new FS.ErrnoError(59); + } + return stream.stream_ops.ioctl(stream, cmd, arg); + },readFile:(path, opts = {}) => { + opts.flags = opts.flags || 0; + opts.encoding = opts.encoding || 'binary'; + if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') { + throw new Error('Invalid encoding type "' + opts.encoding + '"'); + } + var ret; + var stream = FS.open(path, opts.flags); + var stat = FS.stat(path); + var length = stat.size; + var buf = new Uint8Array(length); + FS.read(stream, buf, 0, length, 0); + if (opts.encoding === 'utf8') { + ret = UTF8ArrayToString(buf, 0); + } else if (opts.encoding === 'binary') { + ret = buf; + } + FS.close(stream); + return ret; + },writeFile:(path, data, opts = {}) => { + opts.flags = opts.flags || 577; + var stream = FS.open(path, opts.flags, opts.mode); + if (typeof data == 'string') { + var buf = new Uint8Array(lengthBytesUTF8(data)+1); + var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length); + FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn); + } else if (ArrayBuffer.isView(data)) { + FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn); + } else { + throw new Error('Unsupported data type'); + } + FS.close(stream); + },cwd:() => FS.currentPath,chdir:(path) => { + var lookup = FS.lookupPath(path, { follow: true }); + if (lookup.node === null) { + throw new FS.ErrnoError(44); + } + if (!FS.isDir(lookup.node.mode)) { + throw new FS.ErrnoError(54); + } + var errCode = FS.nodePermissions(lookup.node, 'x'); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + FS.currentPath = lookup.path; + },createDefaultDirectories:() => { + FS.mkdir('/tmp'); + FS.mkdir('/home'); + FS.mkdir('/home/web_user'); + },createDefaultDevices:() => { + // create /dev + FS.mkdir('/dev'); + // setup /dev/null + FS.registerDevice(FS.makedev(1, 3), { + read: () => 0, + write: (stream, buffer, offset, length, pos) => length, + }); + FS.mkdev('/dev/null', FS.makedev(1, 3)); + // setup /dev/tty and /dev/tty1 + // stderr needs to print output using err() rather than out() + // so we register a second tty just for it. + TTY.register(FS.makedev(5, 0), TTY.default_tty_ops); + TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops); + FS.mkdev('/dev/tty', FS.makedev(5, 0)); + FS.mkdev('/dev/tty1', FS.makedev(6, 0)); + // setup /dev/[u]random + var random_device = getRandomDevice(); + FS.createDevice('/dev', 'random', random_device); + FS.createDevice('/dev', 'urandom', random_device); + // we're not going to emulate the actual shm device, + // just create the tmp dirs that reside in it commonly + FS.mkdir('/dev/shm'); + FS.mkdir('/dev/shm/tmp'); + },createSpecialDirectories:() => { + // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the + // name of the stream for fd 6 (see test_unistd_ttyname) + FS.mkdir('/proc'); + var proc_self = FS.mkdir('/proc/self'); + FS.mkdir('/proc/self/fd'); + FS.mount({ + mount: () => { + var node = FS.createNode(proc_self, 'fd', 16384 | 511 /* 0777 */, 73); + node.node_ops = { + lookup: (parent, name) => { + var fd = +name; + var stream = FS.getStream(fd); + if (!stream) throw new FS.ErrnoError(8); + var ret = { + parent: null, + mount: { mountpoint: 'fake' }, + node_ops: { readlink: () => stream.path }, + }; + ret.parent = ret; // make it look like a simple root node + return ret; + } + }; + return node; + } + }, {}, '/proc/self/fd'); + },createStandardStreams:() => { + // TODO deprecate the old functionality of a single + // input / output callback and that utilizes FS.createDevice + // and instead require a unique set of stream ops + + // by default, we symlink the standard streams to the + // default tty devices. however, if the standard streams + // have been overwritten we create a unique device for + // them instead. + if (Module['stdin']) { + FS.createDevice('/dev', 'stdin', Module['stdin']); + } else { + FS.symlink('/dev/tty', '/dev/stdin'); + } + if (Module['stdout']) { + FS.createDevice('/dev', 'stdout', null, Module['stdout']); + } else { + FS.symlink('/dev/tty', '/dev/stdout'); + } + if (Module['stderr']) { + FS.createDevice('/dev', 'stderr', null, Module['stderr']); + } else { + FS.symlink('/dev/tty1', '/dev/stderr'); + } + + // open default streams for the stdin, stdout and stderr devices + var stdin = FS.open('/dev/stdin', 0); + var stdout = FS.open('/dev/stdout', 1); + var stderr = FS.open('/dev/stderr', 1); + assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')'); + assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')'); + assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')'); + },ensureErrnoError:() => { + if (FS.ErrnoError) return; + FS.ErrnoError = /** @this{Object} */ function ErrnoError(errno, node) { + this.node = node; + this.setErrno = /** @this{Object} */ function(errno) { + this.errno = errno; + for (var key in ERRNO_CODES) { + if (ERRNO_CODES[key] === errno) { + this.code = key; + break; + } + } + }; + this.setErrno(errno); + this.message = ERRNO_MESSAGES[errno]; + + // Try to get a maximally helpful stack trace. On Node.js, getting Error.stack + // now ensures it shows what we want. + if (this.stack) { + // Define the stack property for Node.js 4, which otherwise errors on the next line. + Object.defineProperty(this, "stack", { value: (new Error).stack, writable: true }); + this.stack = demangleAll(this.stack); + } + }; + FS.ErrnoError.prototype = new Error(); + FS.ErrnoError.prototype.constructor = FS.ErrnoError; + // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info) + [44].forEach((code) => { + FS.genericErrors[code] = new FS.ErrnoError(code); + FS.genericErrors[code].stack = ''; + }); + },staticInit:() => { + FS.ensureErrnoError(); + + FS.nameTable = new Array(4096); + + FS.mount(MEMFS, {}, '/'); + + FS.createDefaultDirectories(); + FS.createDefaultDevices(); + FS.createSpecialDirectories(); + + FS.filesystems = { + 'MEMFS': MEMFS, + }; + },init:(input, output, error) => { + assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)'); + FS.init.initialized = true; + + FS.ensureErrnoError(); + + // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here + Module['stdin'] = input || Module['stdin']; + Module['stdout'] = output || Module['stdout']; + Module['stderr'] = error || Module['stderr']; + + FS.createStandardStreams(); + },quit:() => { + FS.init.initialized = false; + // force-flush all streams, so we get musl std streams printed out + _fflush(0); + // close all of our streams + for (var i = 0; i < FS.streams.length; i++) { + var stream = FS.streams[i]; + if (!stream) { + continue; + } + FS.close(stream); + } + },getMode:(canRead, canWrite) => { + var mode = 0; + if (canRead) mode |= 292 | 73; + if (canWrite) mode |= 146; + return mode; + },findObject:(path, dontResolveLastLink) => { + var ret = FS.analyzePath(path, dontResolveLastLink); + if (!ret.exists) { + return null; + } + return ret.object; + },analyzePath:(path, dontResolveLastLink) => { + // operate from within the context of the symlink's target + try { + var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); + path = lookup.path; + } catch (e) { + } + var ret = { + isRoot: false, exists: false, error: 0, name: null, path: null, object: null, + parentExists: false, parentPath: null, parentObject: null + }; + try { + var lookup = FS.lookupPath(path, { parent: true }); + ret.parentExists = true; + ret.parentPath = lookup.path; + ret.parentObject = lookup.node; + ret.name = PATH.basename(path); + lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); + ret.exists = true; + ret.path = lookup.path; + ret.object = lookup.node; + ret.name = lookup.node.name; + ret.isRoot = lookup.path === '/'; + } catch (e) { + ret.error = e.errno; + }; + return ret; + },createPath:(parent, path, canRead, canWrite) => { + parent = typeof parent == 'string' ? parent : FS.getPath(parent); + var parts = path.split('/').reverse(); + while (parts.length) { + var part = parts.pop(); + if (!part) continue; + var current = PATH.join2(parent, part); + try { + FS.mkdir(current); + } catch (e) { + // ignore EEXIST + } + parent = current; + } + return current; + },createFile:(parent, name, properties, canRead, canWrite) => { + var path = PATH.join2(typeof parent == 'string' ? parent : FS.getPath(parent), name); + var mode = FS.getMode(canRead, canWrite); + return FS.create(path, mode); + },createDataFile:(parent, name, data, canRead, canWrite, canOwn) => { + var path = name; + if (parent) { + parent = typeof parent == 'string' ? parent : FS.getPath(parent); + path = name ? PATH.join2(parent, name) : parent; + } + var mode = FS.getMode(canRead, canWrite); + var node = FS.create(path, mode); + if (data) { + if (typeof data == 'string') { + var arr = new Array(data.length); + for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i); + data = arr; + } + // make sure we can write to the file + FS.chmod(node, mode | 146); + var stream = FS.open(node, 577); + FS.write(stream, data, 0, data.length, 0, canOwn); + FS.close(stream); + FS.chmod(node, mode); + } + return node; + },createDevice:(parent, name, input, output) => { + var path = PATH.join2(typeof parent == 'string' ? parent : FS.getPath(parent), name); + var mode = FS.getMode(!!input, !!output); + if (!FS.createDevice.major) FS.createDevice.major = 64; + var dev = FS.makedev(FS.createDevice.major++, 0); + // Create a fake device that a set of stream ops to emulate + // the old behavior. + FS.registerDevice(dev, { + open: (stream) => { + stream.seekable = false; + }, + close: (stream) => { + // flush any pending line data + if (output && output.buffer && output.buffer.length) { + output(10); + } + }, + read: (stream, buffer, offset, length, pos /* ignored */) => { + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = input(); + } catch (e) { + throw new FS.ErrnoError(29); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(6); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset+i] = result; + } + if (bytesRead) { + stream.node.timestamp = Date.now(); + } + return bytesRead; + }, + write: (stream, buffer, offset, length, pos) => { + for (var i = 0; i < length; i++) { + try { + output(buffer[offset+i]); + } catch (e) { + throw new FS.ErrnoError(29); + } + } + if (length) { + stream.node.timestamp = Date.now(); + } + return i; + } + }); + return FS.mkdev(path, mode, dev); + },forceLoadFile:(obj) => { + if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true; + if (typeof XMLHttpRequest != 'undefined') { + throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread."); + } else if (read_) { + // Command-line. + try { + // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as + // read() will try to parse UTF8. + obj.contents = intArrayFromString(read_(obj.url), true); + obj.usedBytes = obj.contents.length; + } catch (e) { + throw new FS.ErrnoError(29); + } + } else { + throw new Error('Cannot load without read() or XMLHttpRequest.'); + } + },createLazyFile:(parent, name, url, canRead, canWrite) => { + // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse. + /** @constructor */ + function LazyUint8Array() { + this.lengthKnown = false; + this.chunks = []; // Loaded chunks. Index is the chunk number + } + LazyUint8Array.prototype.get = /** @this{Object} */ function LazyUint8Array_get(idx) { + if (idx > this.length-1 || idx < 0) { + return undefined; + } + var chunkOffset = idx % this.chunkSize; + var chunkNum = (idx / this.chunkSize)|0; + return this.getter(chunkNum)[chunkOffset]; + }; + LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) { + this.getter = getter; + }; + LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() { + // Find length + var xhr = new XMLHttpRequest(); + xhr.open('HEAD', url, false); + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + var datalength = Number(xhr.getResponseHeader("Content-length")); + var header; + var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes"; + var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip"; + + var chunkSize = 1024*1024; // Chunk size in bytes + + if (!hasByteServing) chunkSize = datalength; + + // Function to get a range from the remote URL. + var doXHR = (from, to) => { + if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!"); + if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!"); + + // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available. + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to); + + // Some hints to the browser that we want binary data. + xhr.responseType = 'arraybuffer'; + if (xhr.overrideMimeType) { + xhr.overrideMimeType('text/plain; charset=x-user-defined'); + } + + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + if (xhr.response !== undefined) { + return new Uint8Array(/** @type{Array} */(xhr.response || [])); + } + return intArrayFromString(xhr.responseText || '', true); + }; + var lazyArray = this; + lazyArray.setDataGetter((chunkNum) => { + var start = chunkNum * chunkSize; + var end = (chunkNum+1) * chunkSize - 1; // including this byte + end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block + if (typeof lazyArray.chunks[chunkNum] == 'undefined') { + lazyArray.chunks[chunkNum] = doXHR(start, end); + } + if (typeof lazyArray.chunks[chunkNum] == 'undefined') throw new Error('doXHR failed!'); + return lazyArray.chunks[chunkNum]; + }); + + if (usesGzip || !datalength) { + // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length + chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file + datalength = this.getter(0).length; + chunkSize = datalength; + out("LazyFiles on gzip forces download of the whole file when length is accessed"); + } + + this._length = datalength; + this._chunkSize = chunkSize; + this.lengthKnown = true; + }; + if (typeof XMLHttpRequest != 'undefined') { + if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc'; + var lazyArray = new LazyUint8Array(); + Object.defineProperties(lazyArray, { + length: { + get: /** @this{Object} */ function() { + if (!this.lengthKnown) { + this.cacheLength(); + } + return this._length; + } + }, + chunkSize: { + get: /** @this{Object} */ function() { + if (!this.lengthKnown) { + this.cacheLength(); + } + return this._chunkSize; + } + } + }); + + var properties = { isDevice: false, contents: lazyArray }; + } else { + var properties = { isDevice: false, url: url }; + } + + var node = FS.createFile(parent, name, properties, canRead, canWrite); + // This is a total hack, but I want to get this lazy file code out of the + // core of MEMFS. If we want to keep this lazy file concept I feel it should + // be its own thin LAZYFS proxying calls to MEMFS. + if (properties.contents) { + node.contents = properties.contents; + } else if (properties.url) { + node.contents = null; + node.url = properties.url; + } + // Add a function that defers querying the file size until it is asked the first time. + Object.defineProperties(node, { + usedBytes: { + get: /** @this {FSNode} */ function() { return this.contents.length; } + } + }); + // override each stream op with one that tries to force load the lazy file first + var stream_ops = {}; + var keys = Object.keys(node.stream_ops); + keys.forEach((key) => { + var fn = node.stream_ops[key]; + stream_ops[key] = function forceLoadLazyFile() { + FS.forceLoadFile(node); + return fn.apply(null, arguments); + }; + }); + function writeChunks(stream, buffer, offset, length, position) { + var contents = stream.node.contents; + if (position >= contents.length) + return 0; + var size = Math.min(contents.length - position, length); + assert(size >= 0); + if (contents.slice) { // normal array + for (var i = 0; i < size; i++) { + buffer[offset + i] = contents[position + i]; + } + } else { + for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR + buffer[offset + i] = contents.get(position + i); + } + } + return size; + } + // use a custom read function + stream_ops.read = (stream, buffer, offset, length, position) => { + FS.forceLoadFile(node); + return writeChunks(stream, buffer, offset, length, position) + }; + // use a custom mmap function + stream_ops.mmap = (stream, length, position, prot, flags) => { + FS.forceLoadFile(node); + var ptr = mmapAlloc(length); + if (!ptr) { + throw new FS.ErrnoError(48); + } + writeChunks(stream, HEAP8, ptr, length, position); + return { ptr: ptr, allocated: true }; + }; + node.stream_ops = stream_ops; + return node; + },createPreloadedFile:(parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) => { + // TODO we should allow people to just pass in a complete filename instead + // of parent and name being that we just join them anyways + var fullname = name ? PATH_FS.resolve(PATH.join2(parent, name)) : parent; + var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname + function processData(byteArray) { + function finish(byteArray) { + if (preFinish) preFinish(); + if (!dontCreateFile) { + FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn); + } + if (onload) onload(); + removeRunDependency(dep); + } + if (Browser.handledByPreloadPlugin(byteArray, fullname, finish, () => { + if (onerror) onerror(); + removeRunDependency(dep); + })) { + return; + } + finish(byteArray); + } + addRunDependency(dep); + if (typeof url == 'string') { + asyncLoad(url, (byteArray) => processData(byteArray), onerror); + } else { + processData(url); + } + },indexedDB:() => { + return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; + },DB_NAME:() => { + return 'EM_FS_' + window.location.pathname; + },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:(paths, onload = (() => {}), onerror = (() => {})) => { + var indexedDB = FS.indexedDB(); + try { + var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); + } catch (e) { + return onerror(e); + } + openRequest.onupgradeneeded = () => { + out('creating db'); + var db = openRequest.result; + db.createObjectStore(FS.DB_STORE_NAME); + }; + openRequest.onsuccess = () => { + var db = openRequest.result; + var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite'); + var files = transaction.objectStore(FS.DB_STORE_NAME); + var ok = 0, fail = 0, total = paths.length; + function finish() { + if (fail == 0) onload(); else onerror(); + } + paths.forEach((path) => { + var putRequest = files.put(FS.analyzePath(path).object.contents, path); + putRequest.onsuccess = () => { ok++; if (ok + fail == total) finish() }; + putRequest.onerror = () => { fail++; if (ok + fail == total) finish() }; + }); + transaction.onerror = onerror; + }; + openRequest.onerror = onerror; + },loadFilesFromDB:(paths, onload = (() => {}), onerror = (() => {})) => { + var indexedDB = FS.indexedDB(); + try { + var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); + } catch (e) { + return onerror(e); + } + openRequest.onupgradeneeded = onerror; // no database to load from + openRequest.onsuccess = () => { + var db = openRequest.result; + try { + var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly'); + } catch(e) { + onerror(e); + return; + } + var files = transaction.objectStore(FS.DB_STORE_NAME); + var ok = 0, fail = 0, total = paths.length; + function finish() { + if (fail == 0) onload(); else onerror(); + } + paths.forEach((path) => { + var getRequest = files.get(path); + getRequest.onsuccess = () => { + if (FS.analyzePath(path).exists) { + FS.unlink(path); + } + FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true); + ok++; + if (ok + fail == total) finish(); + }; + getRequest.onerror = () => { fail++; if (ok + fail == total) finish() }; + }); + transaction.onerror = onerror; + }; + openRequest.onerror = onerror; + },absolutePath:() => { + abort('FS.absolutePath has been removed; use PATH_FS.resolve instead'); + },createFolder:() => { + abort('FS.createFolder has been removed; use FS.mkdir instead'); + },createLink:() => { + abort('FS.createLink has been removed; use FS.symlink instead'); + },joinPath:() => { + abort('FS.joinPath has been removed; use PATH.join instead'); + },mmapAlloc:() => { + abort('FS.mmapAlloc has been replaced by the top level function mmapAlloc'); + },standardizePath:() => { + abort('FS.standardizePath has been removed; use PATH.normalize instead'); + }}; + var SYSCALLS = {DEFAULT_POLLMASK:5,calculateAt:function(dirfd, path, allowEmpty) { + if (PATH.isAbs(path)) { + return path; + } + // relative path + var dir; + if (dirfd === -100) { + dir = FS.cwd(); + } else { + var dirstream = SYSCALLS.getStreamFromFD(dirfd); + dir = dirstream.path; + } + if (path.length == 0) { + if (!allowEmpty) { + throw new FS.ErrnoError(44);; + } + return dir; + } + return PATH.join2(dir, path); + },doStat:function(func, path, buf) { + try { + var stat = func(path); + } catch (e) { + if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) { + // an error occurred while trying to look up the path; we should just report ENOTDIR + return -54; + } + throw e; + } + HEAP32[((buf)>>2)] = stat.dev; + HEAP32[(((buf)+(8))>>2)] = stat.ino; + HEAP32[(((buf)+(12))>>2)] = stat.mode; + HEAPU32[(((buf)+(16))>>2)] = stat.nlink; + HEAP32[(((buf)+(20))>>2)] = stat.uid; + HEAP32[(((buf)+(24))>>2)] = stat.gid; + HEAP32[(((buf)+(28))>>2)] = stat.rdev; + (tempI64 = [stat.size>>>0,(tempDouble=stat.size,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((buf)+(40))>>2)] = tempI64[0],HEAP32[(((buf)+(44))>>2)] = tempI64[1]); + HEAP32[(((buf)+(48))>>2)] = 4096; + HEAP32[(((buf)+(52))>>2)] = stat.blocks; + var atime = stat.atime.getTime(); + var mtime = stat.mtime.getTime(); + var ctime = stat.ctime.getTime(); + (tempI64 = [Math.floor(atime / 1000)>>>0,(tempDouble=Math.floor(atime / 1000),(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((buf)+(56))>>2)] = tempI64[0],HEAP32[(((buf)+(60))>>2)] = tempI64[1]); + HEAPU32[(((buf)+(64))>>2)] = (atime % 1000) * 1000; + (tempI64 = [Math.floor(mtime / 1000)>>>0,(tempDouble=Math.floor(mtime / 1000),(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((buf)+(72))>>2)] = tempI64[0],HEAP32[(((buf)+(76))>>2)] = tempI64[1]); + HEAPU32[(((buf)+(80))>>2)] = (mtime % 1000) * 1000; + (tempI64 = [Math.floor(ctime / 1000)>>>0,(tempDouble=Math.floor(ctime / 1000),(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((buf)+(88))>>2)] = tempI64[0],HEAP32[(((buf)+(92))>>2)] = tempI64[1]); + HEAPU32[(((buf)+(96))>>2)] = (ctime % 1000) * 1000; + (tempI64 = [stat.ino>>>0,(tempDouble=stat.ino,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((buf)+(104))>>2)] = tempI64[0],HEAP32[(((buf)+(108))>>2)] = tempI64[1]); + return 0; + },doMsync:function(addr, stream, len, flags, offset) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + if (flags & 2) { + // MAP_PRIVATE calls need not to be synced back to underlying fs + return 0; + } + var buffer = HEAPU8.slice(addr, addr + len); + FS.msync(stream, buffer, offset, len, flags); + },varargs:undefined,get:function() { + assert(SYSCALLS.varargs != undefined); + SYSCALLS.varargs += 4; + var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)]; + return ret; + },getStr:function(ptr) { + var ret = UTF8ToString(ptr); + return ret; + },getStreamFromFD:function(fd) { + var stream = FS.getStream(fd); + if (!stream) throw new FS.ErrnoError(8); + return stream; + }}; + function ___syscall__newselect(nfds, readfds, writefds, exceptfds, timeout) { + try { + + // readfds are supported, + // writefds checks socket open status + // exceptfds not supported + // timeout is always 0 - fully async + assert(nfds <= 64, 'nfds must be less than or equal to 64'); // fd sets have 64 bits // TODO: this could be 1024 based on current musl headers + assert(!exceptfds, 'exceptfds not supported'); + + var total = 0; + + var srcReadLow = (readfds ? HEAP32[((readfds)>>2)] : 0), + srcReadHigh = (readfds ? HEAP32[(((readfds)+(4))>>2)] : 0); + var srcWriteLow = (writefds ? HEAP32[((writefds)>>2)] : 0), + srcWriteHigh = (writefds ? HEAP32[(((writefds)+(4))>>2)] : 0); + var srcExceptLow = (exceptfds ? HEAP32[((exceptfds)>>2)] : 0), + srcExceptHigh = (exceptfds ? HEAP32[(((exceptfds)+(4))>>2)] : 0); + + var dstReadLow = 0, + dstReadHigh = 0; + var dstWriteLow = 0, + dstWriteHigh = 0; + var dstExceptLow = 0, + dstExceptHigh = 0; + + var allLow = (readfds ? HEAP32[((readfds)>>2)] : 0) | + (writefds ? HEAP32[((writefds)>>2)] : 0) | + (exceptfds ? HEAP32[((exceptfds)>>2)] : 0); + var allHigh = (readfds ? HEAP32[(((readfds)+(4))>>2)] : 0) | + (writefds ? HEAP32[(((writefds)+(4))>>2)] : 0) | + (exceptfds ? HEAP32[(((exceptfds)+(4))>>2)] : 0); + + var check = function(fd, low, high, val) { + return (fd < 32 ? (low & val) : (high & val)); + }; + + for (var fd = 0; fd < nfds; fd++) { + var mask = 1 << (fd % 32); + if (!(check(fd, allLow, allHigh, mask))) { + continue; // index isn't in the set + } + + var stream = SYSCALLS.getStreamFromFD(fd); + + var flags = SYSCALLS.DEFAULT_POLLMASK; + + if (stream.stream_ops.poll) { + flags = stream.stream_ops.poll(stream); + } + + if ((flags & 1) && check(fd, srcReadLow, srcReadHigh, mask)) { + fd < 32 ? (dstReadLow = dstReadLow | mask) : (dstReadHigh = dstReadHigh | mask); + total++; + } + if ((flags & 4) && check(fd, srcWriteLow, srcWriteHigh, mask)) { + fd < 32 ? (dstWriteLow = dstWriteLow | mask) : (dstWriteHigh = dstWriteHigh | mask); + total++; + } + if ((flags & 2) && check(fd, srcExceptLow, srcExceptHigh, mask)) { + fd < 32 ? (dstExceptLow = dstExceptLow | mask) : (dstExceptHigh = dstExceptHigh | mask); + total++; + } + } + + if (readfds) { + HEAP32[((readfds)>>2)] = dstReadLow; + HEAP32[(((readfds)+(4))>>2)] = dstReadHigh; + } + if (writefds) { + HEAP32[((writefds)>>2)] = dstWriteLow; + HEAP32[(((writefds)+(4))>>2)] = dstWriteHigh; + } + if (exceptfds) { + HEAP32[((exceptfds)>>2)] = dstExceptLow; + HEAP32[(((exceptfds)+(4))>>2)] = dstExceptHigh; + } + + return total; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + var SOCKFS = {mount:function(mount) { + // If Module['websocket'] has already been defined (e.g. for configuring + // the subprotocol/url) use that, if not initialise it to a new object. + Module['websocket'] = (Module['websocket'] && + ('object' === typeof Module['websocket'])) ? Module['websocket'] : {}; + + // Add the Event registration mechanism to the exported websocket configuration + // object so we can register network callbacks from native JavaScript too. + // For more documentation see system/include/emscripten/emscripten.h + Module['websocket']._callbacks = {}; + Module['websocket']['on'] = /** @this{Object} */ function(event, callback) { + if ('function' === typeof callback) { + this._callbacks[event] = callback; + } + return this; + }; + + Module['websocket'].emit = /** @this{Object} */ function(event, param) { + if ('function' === typeof this._callbacks[event]) { + this._callbacks[event].call(this, param); + } + }; + + // If debug is enabled register simple default logging callbacks for each Event. + + return FS.createNode(null, '/', 16384 | 511 /* 0777 */, 0); + },createSocket:function(family, type, protocol) { + type &= ~526336; // Some applications may pass it; it makes no sense for a single process. + var streaming = type == 1; + if (streaming && protocol && protocol != 6) { + throw new FS.ErrnoError(66); // if SOCK_STREAM, must be tcp or 0. + } + + // create our internal socket structure + var sock = { + family: family, + type: type, + protocol: protocol, + server: null, + error: null, // Used in getsockopt for SOL_SOCKET/SO_ERROR test + peers: {}, + pending: [], + recv_queue: [], + sock_ops: SOCKFS.websocket_sock_ops + }; + + // create the filesystem node to store the socket structure + var name = SOCKFS.nextname(); + var node = FS.createNode(SOCKFS.root, name, 49152, 0); + node.sock = sock; + + // and the wrapping stream that enables library functions such + // as read and write to indirectly interact with the socket + var stream = FS.createStream({ + path: name, + node: node, + flags: 2, + seekable: false, + stream_ops: SOCKFS.stream_ops + }); + + // map the new stream to the socket structure (sockets have a 1:1 + // relationship with a stream) + sock.stream = stream; + + return sock; + },getSocket:function(fd) { + var stream = FS.getStream(fd); + if (!stream || !FS.isSocket(stream.node.mode)) { + return null; + } + return stream.node.sock; + },stream_ops:{poll:function(stream) { + var sock = stream.node.sock; + return sock.sock_ops.poll(sock); + },ioctl:function(stream, request, varargs) { + var sock = stream.node.sock; + return sock.sock_ops.ioctl(sock, request, varargs); + },read:function(stream, buffer, offset, length, position /* ignored */) { + var sock = stream.node.sock; + var msg = sock.sock_ops.recvmsg(sock, length); + if (!msg) { + // socket is closed + return 0; + } + buffer.set(msg.buffer, offset); + return msg.buffer.length; + },write:function(stream, buffer, offset, length, position /* ignored */) { + var sock = stream.node.sock; + return sock.sock_ops.sendmsg(sock, buffer, offset, length); + },close:function(stream) { + var sock = stream.node.sock; + sock.sock_ops.close(sock); + }},nextname:function() { + if (!SOCKFS.nextname.current) { + SOCKFS.nextname.current = 0; + } + return 'socket[' + (SOCKFS.nextname.current++) + ']'; + },websocket_sock_ops:{createPeer:function(sock, addr, port) { + var ws; + + if (typeof addr == 'object') { + ws = addr; + addr = null; + port = null; + } + + if (ws) { + // for sockets that've already connected (e.g. we're the server) + // we can inspect the _socket property for the address + if (ws._socket) { + addr = ws._socket.remoteAddress; + port = ws._socket.remotePort; + } + // if we're just now initializing a connection to the remote, + // inspect the url property + else { + var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url); + if (!result) { + throw new Error('WebSocket URL must be in the format ws(s)://address:port'); + } + addr = result[1]; + port = parseInt(result[2], 10); + } + } else { + // create the actual websocket object and connect + try { + // runtimeConfig gets set to true if WebSocket runtime configuration is available. + var runtimeConfig = (Module['websocket'] && ('object' === typeof Module['websocket'])); + + // The default value is 'ws://' the replace is needed because the compiler replaces '//' comments with '#' + // comments without checking context, so we'd end up with ws:#, the replace swaps the '#' for '//' again. + var url = 'ws:#'.replace('#', '//'); + + if (runtimeConfig) { + if ('string' === typeof Module['websocket']['url']) { + url = Module['websocket']['url']; // Fetch runtime WebSocket URL config. + } + } + + if (url === 'ws://' || url === 'wss://') { // Is the supplied URL config just a prefix, if so complete it. + var parts = addr.split('/'); + url = url + parts[0] + ":" + port + "/" + parts.slice(1).join('/'); + } + + // Make the WebSocket subprotocol (Sec-WebSocket-Protocol) default to binary if no configuration is set. + var subProtocols = 'binary'; // The default value is 'binary' + + if (runtimeConfig) { + if ('string' === typeof Module['websocket']['subprotocol']) { + subProtocols = Module['websocket']['subprotocol']; // Fetch runtime WebSocket subprotocol config. + } + } + + // The default WebSocket options + var opts = undefined; + + if (subProtocols !== 'null') { + // The regex trims the string (removes spaces at the beginning and end, then splits the string by + // , into an Array. Whitespace removal is important for Websockify and ws. + subProtocols = subProtocols.replace(/^ +| +$/g,"").split(/ *, */); + + opts = subProtocols; + } + + // some webservers (azure) does not support subprotocol header + if (runtimeConfig && null === Module['websocket']['subprotocol']) { + subProtocols = 'null'; + opts = undefined; + } + + // If node we use the ws library. + var WebSocketConstructor; + if (ENVIRONMENT_IS_NODE) { + WebSocketConstructor = /** @type{(typeof WebSocket)} */(require('ws')); + } else + { + WebSocketConstructor = WebSocket; + } + ws = new WebSocketConstructor(url, opts); + ws.binaryType = 'arraybuffer'; + } catch (e) { + throw new FS.ErrnoError(23); + } + } + + var peer = { + addr: addr, + port: port, + socket: ws, + dgram_send_queue: [] + }; + + SOCKFS.websocket_sock_ops.addPeer(sock, peer); + SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer); + + // if this is a bound dgram socket, send the port number first to allow + // us to override the ephemeral port reported to us by remotePort on the + // remote end. + if (sock.type === 2 && typeof sock.sport != 'undefined') { + peer.dgram_send_queue.push(new Uint8Array([ + 255, 255, 255, 255, + 'p'.charCodeAt(0), 'o'.charCodeAt(0), 'r'.charCodeAt(0), 't'.charCodeAt(0), + ((sock.sport & 0xff00) >> 8) , (sock.sport & 0xff) + ])); + } + + return peer; + },getPeer:function(sock, addr, port) { + return sock.peers[addr + ':' + port]; + },addPeer:function(sock, peer) { + sock.peers[peer.addr + ':' + peer.port] = peer; + },removePeer:function(sock, peer) { + delete sock.peers[peer.addr + ':' + peer.port]; + },handlePeerEvents:function(sock, peer) { + var first = true; + + var handleOpen = function () { + + Module['websocket'].emit('open', sock.stream.fd); + + try { + var queued = peer.dgram_send_queue.shift(); + while (queued) { + peer.socket.send(queued); + queued = peer.dgram_send_queue.shift(); + } + } catch (e) { + // not much we can do here in the way of proper error handling as we've already + // lied and said this data was sent. shut it down. + peer.socket.close(); + } + }; + + function handleMessage(data) { + if (typeof data == 'string') { + var encoder = new TextEncoder(); // should be utf-8 + data = encoder.encode(data); // make a typed array from the string + } else { + assert(data.byteLength !== undefined); // must receive an ArrayBuffer + if (data.byteLength == 0) { + // An empty ArrayBuffer will emit a pseudo disconnect event + // as recv/recvmsg will return zero which indicates that a socket + // has performed a shutdown although the connection has not been disconnected yet. + return; + } + data = new Uint8Array(data); // make a typed array view on the array buffer + } + + // if this is the port message, override the peer's port with it + var wasfirst = first; + first = false; + if (wasfirst && + data.length === 10 && + data[0] === 255 && data[1] === 255 && data[2] === 255 && data[3] === 255 && + data[4] === 'p'.charCodeAt(0) && data[5] === 'o'.charCodeAt(0) && data[6] === 'r'.charCodeAt(0) && data[7] === 't'.charCodeAt(0)) { + // update the peer's port and it's key in the peer map + var newport = ((data[8] << 8) | data[9]); + SOCKFS.websocket_sock_ops.removePeer(sock, peer); + peer.port = newport; + SOCKFS.websocket_sock_ops.addPeer(sock, peer); + return; + } + + sock.recv_queue.push({ addr: peer.addr, port: peer.port, data: data }); + Module['websocket'].emit('message', sock.stream.fd); + }; + + if (ENVIRONMENT_IS_NODE) { + peer.socket.on('open', handleOpen); + peer.socket.on('message', function(data, isBinary) { + if (!isBinary) { + return; + } + handleMessage((new Uint8Array(data)).buffer); // copy from node Buffer -> ArrayBuffer + }); + peer.socket.on('close', function() { + Module['websocket'].emit('close', sock.stream.fd); + }); + peer.socket.on('error', function(error) { + // Although the ws library may pass errors that may be more descriptive than + // ECONNREFUSED they are not necessarily the expected error code e.g. + // ENOTFOUND on getaddrinfo seems to be node.js specific, so using ECONNREFUSED + // is still probably the most useful thing to do. + sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test. + Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']); + // don't throw + }); + } else { + peer.socket.onopen = handleOpen; + peer.socket.onclose = function() { + Module['websocket'].emit('close', sock.stream.fd); + }; + peer.socket.onmessage = function peer_socket_onmessage(event) { + handleMessage(event.data); + }; + peer.socket.onerror = function(error) { + // The WebSocket spec only allows a 'simple event' to be thrown on error, + // so we only really know as much as ECONNREFUSED. + sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test. + Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']); + }; + } + },poll:function(sock) { + if (sock.type === 1 && sock.server) { + // listen sockets should only say they're available for reading + // if there are pending clients. + return sock.pending.length ? (64 | 1) : 0; + } + + var mask = 0; + var dest = sock.type === 1 ? // we only care about the socket state for connection-based sockets + SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) : + null; + + if (sock.recv_queue.length || + !dest || // connection-less sockets are always ready to read + (dest && dest.socket.readyState === dest.socket.CLOSING) || + (dest && dest.socket.readyState === dest.socket.CLOSED)) { // let recv return 0 once closed + mask |= (64 | 1); + } + + if (!dest || // connection-less sockets are always ready to write + (dest && dest.socket.readyState === dest.socket.OPEN)) { + mask |= 4; + } + + if ((dest && dest.socket.readyState === dest.socket.CLOSING) || + (dest && dest.socket.readyState === dest.socket.CLOSED)) { + mask |= 16; + } + + return mask; + },ioctl:function(sock, request, arg) { + switch (request) { + case 21531: + var bytes = 0; + if (sock.recv_queue.length) { + bytes = sock.recv_queue[0].data.length; + } + HEAP32[((arg)>>2)] = bytes; + return 0; + default: + return 28; + } + },close:function(sock) { + // if we've spawned a listen server, close it + if (sock.server) { + try { + sock.server.close(); + } catch (e) { + } + sock.server = null; + } + // close any peer connections + var peers = Object.keys(sock.peers); + for (var i = 0; i < peers.length; i++) { + var peer = sock.peers[peers[i]]; + try { + peer.socket.close(); + } catch (e) { + } + SOCKFS.websocket_sock_ops.removePeer(sock, peer); + } + return 0; + },bind:function(sock, addr, port) { + if (typeof sock.saddr != 'undefined' || typeof sock.sport != 'undefined') { + throw new FS.ErrnoError(28); // already bound + } + sock.saddr = addr; + sock.sport = port; + // in order to emulate dgram sockets, we need to launch a listen server when + // binding on a connection-less socket + // note: this is only required on the server side + if (sock.type === 2) { + // close the existing server if it exists + if (sock.server) { + sock.server.close(); + sock.server = null; + } + // swallow error operation not supported error that occurs when binding in the + // browser where this isn't supported + try { + sock.sock_ops.listen(sock, 0); + } catch (e) { + if (!(e instanceof FS.ErrnoError)) throw e; + if (e.errno !== 138) throw e; + } + } + },connect:function(sock, addr, port) { + if (sock.server) { + throw new FS.ErrnoError(138); + } + + // TODO autobind + // if (!sock.addr && sock.type == 2) { + // } + + // early out if we're already connected / in the middle of connecting + if (typeof sock.daddr != 'undefined' && typeof sock.dport != 'undefined') { + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport); + if (dest) { + if (dest.socket.readyState === dest.socket.CONNECTING) { + throw new FS.ErrnoError(7); + } else { + throw new FS.ErrnoError(30); + } + } + } + + // add the socket to our peer list and set our + // destination address / port to match + var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port); + sock.daddr = peer.addr; + sock.dport = peer.port; + + // always "fail" in non-blocking mode + throw new FS.ErrnoError(26); + },listen:function(sock, backlog) { + if (!ENVIRONMENT_IS_NODE) { + throw new FS.ErrnoError(138); + } + if (sock.server) { + throw new FS.ErrnoError(28); // already listening + } + var WebSocketServer = require('ws').Server; + var host = sock.saddr; + sock.server = new WebSocketServer({ + host: host, + port: sock.sport + // TODO support backlog + }); + Module['websocket'].emit('listen', sock.stream.fd); // Send Event with listen fd. + + sock.server.on('connection', function(ws) { + if (sock.type === 1) { + var newsock = SOCKFS.createSocket(sock.family, sock.type, sock.protocol); + + // create a peer on the new socket + var peer = SOCKFS.websocket_sock_ops.createPeer(newsock, ws); + newsock.daddr = peer.addr; + newsock.dport = peer.port; + + // push to queue for accept to pick up + sock.pending.push(newsock); + Module['websocket'].emit('connection', newsock.stream.fd); + } else { + // create a peer on the listen socket so calling sendto + // with the listen socket and an address will resolve + // to the correct client + SOCKFS.websocket_sock_ops.createPeer(sock, ws); + Module['websocket'].emit('connection', sock.stream.fd); + } + }); + sock.server.on('close', function() { + Module['websocket'].emit('close', sock.stream.fd); + sock.server = null; + }); + sock.server.on('error', function(error) { + // Although the ws library may pass errors that may be more descriptive than + // ECONNREFUSED they are not necessarily the expected error code e.g. + // ENOTFOUND on getaddrinfo seems to be node.js specific, so using EHOSTUNREACH + // is still probably the most useful thing to do. This error shouldn't + // occur in a well written app as errors should get trapped in the compiled + // app's own getaddrinfo call. + sock.error = 23; // Used in getsockopt for SOL_SOCKET/SO_ERROR test. + Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'EHOSTUNREACH: Host is unreachable']); + // don't throw + }); + },accept:function(listensock) { + if (!listensock.server || !listensock.pending.length) { + throw new FS.ErrnoError(28); + } + var newsock = listensock.pending.shift(); + newsock.stream.flags = listensock.stream.flags; + return newsock; + },getname:function(sock, peer) { + var addr, port; + if (peer) { + if (sock.daddr === undefined || sock.dport === undefined) { + throw new FS.ErrnoError(53); + } + addr = sock.daddr; + port = sock.dport; + } else { + // TODO saddr and sport will be set for bind()'d UDP sockets, but what + // should we be returning for TCP sockets that've been connect()'d? + addr = sock.saddr || 0; + port = sock.sport || 0; + } + return { addr: addr, port: port }; + },sendmsg:function(sock, buffer, offset, length, addr, port) { + if (sock.type === 2) { + // connection-less sockets will honor the message address, + // and otherwise fall back to the bound destination address + if (addr === undefined || port === undefined) { + addr = sock.daddr; + port = sock.dport; + } + // if there was no address to fall back to, error out + if (addr === undefined || port === undefined) { + throw new FS.ErrnoError(17); + } + } else { + // connection-based sockets will only use the bound + addr = sock.daddr; + port = sock.dport; + } + + // find the peer for the destination address + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port); + + // early out if not connected with a connection-based socket + if (sock.type === 1) { + if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + throw new FS.ErrnoError(53); + } else if (dest.socket.readyState === dest.socket.CONNECTING) { + throw new FS.ErrnoError(6); + } + } + + // create a copy of the incoming data to send, as the WebSocket API + // doesn't work entirely with an ArrayBufferView, it'll just send + // the entire underlying buffer + if (ArrayBuffer.isView(buffer)) { + offset += buffer.byteOffset; + buffer = buffer.buffer; + } + + var data; + data = buffer.slice(offset, offset + length); + + // if we're emulating a connection-less dgram socket and don't have + // a cached connection, queue the buffer to send upon connect and + // lie, saying the data was sent now. + if (sock.type === 2) { + if (!dest || dest.socket.readyState !== dest.socket.OPEN) { + // if we're not connected, open a new connection + if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port); + } + dest.dgram_send_queue.push(data); + return length; + } + } + + try { + // send the actual data + dest.socket.send(data); + return length; + } catch (e) { + throw new FS.ErrnoError(28); + } + },recvmsg:function(sock, length) { + // http://pubs.opengroup.org/onlinepubs/7908799/xns/recvmsg.html + if (sock.type === 1 && sock.server) { + // tcp servers should not be recv()'ing on the listen socket + throw new FS.ErrnoError(53); + } + + var queued = sock.recv_queue.shift(); + if (!queued) { + if (sock.type === 1) { + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport); + + if (!dest) { + // if we have a destination address but are not connected, error out + throw new FS.ErrnoError(53); + } + if (dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + // return null if the socket has closed + return null; + } + // else, our socket is in a valid state but truly has nothing available + throw new FS.ErrnoError(6); + } + throw new FS.ErrnoError(6); + } + + // queued.data will be an ArrayBuffer if it's unadulterated, but if it's + // requeued TCP data it'll be an ArrayBufferView + var queuedLength = queued.data.byteLength || queued.data.length; + var queuedOffset = queued.data.byteOffset || 0; + var queuedBuffer = queued.data.buffer || queued.data; + var bytesRead = Math.min(length, queuedLength); + var res = { + buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead), + addr: queued.addr, + port: queued.port + }; + + // push back any unread data for TCP connections + if (sock.type === 1 && bytesRead < queuedLength) { + var bytesRemaining = queuedLength - bytesRead; + queued.data = new Uint8Array(queuedBuffer, queuedOffset + bytesRead, bytesRemaining); + sock.recv_queue.unshift(queued); + } + + return res; + }}}; + + function getSocketFromFD(fd) { + var socket = SOCKFS.getSocket(fd); + if (!socket) throw new FS.ErrnoError(8); + return socket; + } + + function setErrNo(value) { + HEAP32[((___errno_location())>>2)] = value; + return value; + } + var Sockets = {BUFFER_SIZE:10240,MAX_BUFFER_SIZE:10485760,nextFd:1,fds:{},nextport:1,maxport:65535,peer:null,connections:{},portmap:{},localAddr:4261412874,addrPool:[33554442,50331658,67108874,83886090,100663306,117440522,134217738,150994954,167772170,184549386,201326602,218103818,234881034]}; + + function inetNtop4(addr) { + return (addr & 0xff) + '.' + ((addr >> 8) & 0xff) + '.' + ((addr >> 16) & 0xff) + '.' + ((addr >> 24) & 0xff) + } + + + function inetNtop6(ints) { + // ref: http://www.ietf.org/rfc/rfc2373.txt - section 2.5.4 + // Format for IPv4 compatible and mapped 128-bit IPv6 Addresses + // 128-bits are split into eight 16-bit words + // stored in network byte order (big-endian) + // | 80 bits | 16 | 32 bits | + // +-----------------------------------------------------------------+ + // | 10 bytes | 2 | 4 bytes | + // +--------------------------------------+--------------------------+ + // + 5 words | 1 | 2 words | + // +--------------------------------------+--------------------------+ + // |0000..............................0000|0000| IPv4 ADDRESS | (compatible) + // +--------------------------------------+----+---------------------+ + // |0000..............................0000|FFFF| IPv4 ADDRESS | (mapped) + // +--------------------------------------+----+---------------------+ + var str = ""; + var word = 0; + var longest = 0; + var lastzero = 0; + var zstart = 0; + var len = 0; + var i = 0; + var parts = [ + ints[0] & 0xffff, + (ints[0] >> 16), + ints[1] & 0xffff, + (ints[1] >> 16), + ints[2] & 0xffff, + (ints[2] >> 16), + ints[3] & 0xffff, + (ints[3] >> 16) + ]; + + // Handle IPv4-compatible, IPv4-mapped, loopback and any/unspecified addresses + + var hasipv4 = true; + var v4part = ""; + // check if the 10 high-order bytes are all zeros (first 5 words) + for (i = 0; i < 5; i++) { + if (parts[i] !== 0) { hasipv4 = false; break; } + } + + if (hasipv4) { + // low-order 32-bits store an IPv4 address (bytes 13 to 16) (last 2 words) + v4part = inetNtop4(parts[6] | (parts[7] << 16)); + // IPv4-mapped IPv6 address if 16-bit value (bytes 11 and 12) == 0xFFFF (6th word) + if (parts[5] === -1) { + str = "::ffff:"; + str += v4part; + return str; + } + // IPv4-compatible IPv6 address if 16-bit value (bytes 11 and 12) == 0x0000 (6th word) + if (parts[5] === 0) { + str = "::"; + //special case IPv6 addresses + if (v4part === "0.0.0.0") v4part = ""; // any/unspecified address + if (v4part === "0.0.0.1") v4part = "1";// loopback address + str += v4part; + return str; + } + } + + // Handle all other IPv6 addresses + + // first run to find the longest contiguous zero words + for (word = 0; word < 8; word++) { + if (parts[word] === 0) { + if (word - lastzero > 1) { + len = 0; + } + lastzero = word; + len++; + } + if (len > longest) { + longest = len; + zstart = word - longest + 1; + } + } + + for (word = 0; word < 8; word++) { + if (longest > 1) { + // compress contiguous zeros - to produce "::" + if (parts[word] === 0 && word >= zstart && word < (zstart + longest) ) { + if (word === zstart) { + str += ":"; + if (zstart === 0) str += ":"; //leading zeros case + } + continue; + } + } + // converts 16-bit words from big-endian to little-endian before converting to hex string + str += Number(_ntohs(parts[word] & 0xffff)).toString(16); + str += word < 7 ? ":" : ""; + } + return str; + } + + function readSockaddr(sa, salen) { + // family / port offsets are common to both sockaddr_in and sockaddr_in6 + var family = HEAP16[((sa)>>1)]; + var port = _ntohs(HEAPU16[(((sa)+(2))>>1)]); + var addr; + + switch (family) { + case 2: + if (salen !== 16) { + return { errno: 28 }; + } + addr = HEAP32[(((sa)+(4))>>2)]; + addr = inetNtop4(addr); + break; + case 10: + if (salen !== 28) { + return { errno: 28 }; + } + addr = [ + HEAP32[(((sa)+(8))>>2)], + HEAP32[(((sa)+(12))>>2)], + HEAP32[(((sa)+(16))>>2)], + HEAP32[(((sa)+(20))>>2)] + ]; + addr = inetNtop6(addr); + break; + default: + return { errno: 5 }; + } + + return { family: family, addr: addr, port: port }; + } + + + function inetPton4(str) { + var b = str.split('.'); + for (var i = 0; i < 4; i++) { + var tmp = Number(b[i]); + if (isNaN(tmp)) return null; + b[i] = tmp; + } + return (b[0] | (b[1] << 8) | (b[2] << 16) | (b[3] << 24)) >>> 0; + } + + + /** @suppress {checkTypes} */ + function jstoi_q(str) { + return parseInt(str); + } + function inetPton6(str) { + var words; + var w, offset, z, i; + /* http://home.deds.nl/~aeron/regex/ */ + var valid6regx = /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i + var parts = []; + if (!valid6regx.test(str)) { + return null; + } + if (str === "::") { + return [0, 0, 0, 0, 0, 0, 0, 0]; + } + // Z placeholder to keep track of zeros when splitting the string on ":" + if (str.startsWith("::")) { + str = str.replace("::", "Z:"); // leading zeros case + } else { + str = str.replace("::", ":Z:"); + } + + if (str.indexOf(".") > 0) { + // parse IPv4 embedded stress + str = str.replace(new RegExp('[.]', 'g'), ":"); + words = str.split(":"); + words[words.length-4] = jstoi_q(words[words.length-4]) + jstoi_q(words[words.length-3])*256; + words[words.length-3] = jstoi_q(words[words.length-2]) + jstoi_q(words[words.length-1])*256; + words = words.slice(0, words.length-2); + } else { + words = str.split(":"); + } + + offset = 0; z = 0; + for (w=0; w < words.length; w++) { + if (typeof words[w] == 'string') { + if (words[w] === 'Z') { + // compressed zeros - write appropriate number of zero words + for (z = 0; z < (8 - words.length+1); z++) { + parts[w+z] = 0; + } + offset = z-1; + } else { + // parse hex to field to 16-bit value and write it in network byte-order + parts[w+offset] = _htons(parseInt(words[w],16)); + } + } else { + // parsed IPv4 words + parts[w+offset] = words[w]; + } + } + return [ + (parts[1] << 16) | parts[0], + (parts[3] << 16) | parts[2], + (parts[5] << 16) | parts[4], + (parts[7] << 16) | parts[6] + ]; + } + var DNS = {address_map:{id:1,addrs:{},names:{}},lookup_name:function (name) { + // If the name is already a valid ipv4 / ipv6 address, don't generate a fake one. + var res = inetPton4(name); + if (res !== null) { + return name; + } + res = inetPton6(name); + if (res !== null) { + return name; + } + + // See if this name is already mapped. + var addr; + + if (DNS.address_map.addrs[name]) { + addr = DNS.address_map.addrs[name]; + } else { + var id = DNS.address_map.id++; + assert(id < 65535, 'exceeded max address mappings of 65535'); + + addr = '172.29.' + (id & 0xff) + '.' + (id & 0xff00); + + DNS.address_map.names[addr] = name; + DNS.address_map.addrs[name] = addr; + } + + return addr; + },lookup_addr:function (addr) { + if (DNS.address_map.names[addr]) { + return DNS.address_map.names[addr]; + } + + return null; + }}; + /** @param {boolean=} allowNull */ + function getSocketAddress(addrp, addrlen, allowNull) { + if (allowNull && addrp === 0) return null; + var info = readSockaddr(addrp, addrlen); + if (info.errno) throw new FS.ErrnoError(info.errno); + info.addr = DNS.lookup_addr(info.addr) || info.addr; + return info; + } + + function ___syscall_bind(fd, addr, addrlen) { + try { + + var sock = getSocketFromFD(fd); + var info = getSocketAddress(addr, addrlen); + sock.sock_ops.bind(sock, info.addr, info.port); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + + + function ___syscall_connect(fd, addr, addrlen) { + try { + + var sock = getSocketFromFD(fd); + var info = getSocketAddress(addr, addrlen); + sock.sock_ops.connect(sock, info.addr, info.port); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_dup(fd) { + try { + + var old = SYSCALLS.getStreamFromFD(fd); + return FS.createStream(old, 0).fd; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_dup3(fd, suggestFD, flags) { + try { + + var old = SYSCALLS.getStreamFromFD(fd); + assert(!flags); + if (old.fd === suggestFD) return -28; + var suggest = FS.getStream(suggestFD); + if (suggest) FS.close(suggest); + return FS.createStream(old, suggestFD, suggestFD + 1).fd; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_faccessat(dirfd, path, amode, flags) { + try { + + path = SYSCALLS.getStr(path); + assert(flags === 0); + path = SYSCALLS.calculateAt(dirfd, path); + if (amode & ~7) { + // need a valid mode + return -28; + } + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + if (!node) { + return -44; + } + var perms = ''; + if (amode & 4) perms += 'r'; + if (amode & 2) perms += 'w'; + if (amode & 1) perms += 'x'; + if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) { + return -2; + } + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + + function ___syscall_fcntl64(fd, cmd, varargs) { + SYSCALLS.varargs = varargs; + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + switch (cmd) { + case 0: { + var arg = SYSCALLS.get(); + if (arg < 0) { + return -28; + } + var newStream; + newStream = FS.createStream(stream, arg); + return newStream.fd; + } + case 1: + case 2: + return 0; // FD_CLOEXEC makes no sense for a single process. + case 3: + return stream.flags; + case 4: { + var arg = SYSCALLS.get(); + stream.flags |= arg; + return 0; + } + case 5: + /* case 5: Currently in musl F_GETLK64 has same value as F_GETLK, so omitted to avoid duplicate case blocks. If that changes, uncomment this */ { + + var arg = SYSCALLS.get(); + var offset = 0; + // We're always unlocked. + HEAP16[(((arg)+(offset))>>1)] = 2; + return 0; + } + case 6: + case 7: + /* case 6: Currently in musl F_SETLK64 has same value as F_SETLK, so omitted to avoid duplicate case blocks. If that changes, uncomment this */ + /* case 7: Currently in musl F_SETLKW64 has same value as F_SETLKW, so omitted to avoid duplicate case blocks. If that changes, uncomment this */ + + + return 0; // Pretend that the locking is successful. + case 16: + case 8: + return -28; // These are for sockets. We don't have them fully implemented yet. + case 9: + // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fcntl() returns that, and we set errno ourselves. + setErrNo(28); + return -1; + default: { + return -28; + } + } + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_fstat64(fd, buf) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + return SYSCALLS.doStat(FS.stat, stream.path, buf); + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function convertI32PairToI53Checked(lo, hi) { + assert(lo == (lo >>> 0) || lo == (lo|0)); // lo should either be a i32 or a u32 + assert(hi === (hi|0)); // hi should be a i32 + return ((hi + 0x200000) >>> 0 < 0x400001 - !!lo) ? (lo >>> 0) + hi * 4294967296 : NaN; + } + + + + + function ___syscall_ftruncate64(fd, length_low, length_high) { + try { + + var length = convertI32PairToI53Checked(length_low, length_high); if (isNaN(length)) return -61; + FS.ftruncate(fd, length); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_getdents64(fd, dirp, count) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd) + if (!stream.getdents) { + stream.getdents = FS.readdir(stream.path); + } + + var struct_size = 280; + var pos = 0; + var off = FS.llseek(stream, 0, 1); + + var idx = Math.floor(off / struct_size); + + while (idx < stream.getdents.length && pos + struct_size <= count) { + var id; + var type; + var name = stream.getdents[idx]; + if (name === '.') { + id = stream.node.id; + type = 4; // DT_DIR + } + else if (name === '..') { + var lookup = FS.lookupPath(stream.path, { parent: true }); + id = lookup.node.id; + type = 4; // DT_DIR + } + else { + var child = FS.lookupNode(stream.node, name); + id = child.id; + type = FS.isChrdev(child.mode) ? 2 : // DT_CHR, character device. + FS.isDir(child.mode) ? 4 : // DT_DIR, directory. + FS.isLink(child.mode) ? 10 : // DT_LNK, symbolic link. + 8; // DT_REG, regular file. + } + assert(id); + (tempI64 = [id>>>0,(tempDouble=id,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((dirp + pos)>>2)] = tempI64[0],HEAP32[(((dirp + pos)+(4))>>2)] = tempI64[1]); + (tempI64 = [(idx + 1) * struct_size>>>0,(tempDouble=(idx + 1) * struct_size,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((dirp + pos)+(8))>>2)] = tempI64[0],HEAP32[(((dirp + pos)+(12))>>2)] = tempI64[1]); + HEAP16[(((dirp + pos)+(16))>>1)] = 280; + HEAP8[(((dirp + pos)+(18))>>0)] = type; + stringToUTF8(name, dirp + pos + 19, 256); + pos += struct_size; + idx += 1; + } + FS.llseek(stream, idx * struct_size, 0); + return pos; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_ioctl(fd, op, varargs) { + SYSCALLS.varargs = varargs; + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + switch (op) { + case 21509: + case 21505: { + if (!stream.tty) return -59; + return 0; + } + case 21510: + case 21511: + case 21512: + case 21506: + case 21507: + case 21508: { + if (!stream.tty) return -59; + return 0; // no-op, not actually adjusting terminal settings + } + case 21519: { + if (!stream.tty) return -59; + var argp = SYSCALLS.get(); + HEAP32[((argp)>>2)] = 0; + return 0; + } + case 21520: { + if (!stream.tty) return -59; + return -28; // not supported + } + case 21531: { + var argp = SYSCALLS.get(); + return FS.ioctl(stream, op, argp); + } + case 21523: { + // TODO: in theory we should write to the winsize struct that gets + // passed in, but for now musl doesn't read anything on it + if (!stream.tty) return -59; + return 0; + } + case 21524: { + // TODO: technically, this ioctl call should change the window size. + // but, since emscripten doesn't have any concept of a terminal window + // yet, we'll just silently throw it away as we do TIOCGWINSZ + if (!stream.tty) return -59; + return 0; + } + default: return -28; // not supported + } + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_lstat64(path, buf) { + try { + + path = SYSCALLS.getStr(path); + return SYSCALLS.doStat(FS.lstat, path, buf); + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_mkdirat(dirfd, path, mode) { + try { + + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + // remove a trailing slash, if one - /a/b/ has basename of '', but + // we want to create b in the context of this function + path = PATH.normalize(path); + if (path[path.length-1] === '/') path = path.substr(0, path.length-1); + FS.mkdir(path, mode, 0); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_newfstatat(dirfd, path, buf, flags) { + try { + + path = SYSCALLS.getStr(path); + var nofollow = flags & 256; + var allowEmpty = flags & 4096; + flags = flags & (~6400); + assert(!flags, 'unknown flags in __syscall_newfstatat: ' + flags); + path = SYSCALLS.calculateAt(dirfd, path, allowEmpty); + return SYSCALLS.doStat(nofollow ? FS.lstat : FS.stat, path, buf); + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_openat(dirfd, path, flags, varargs) { + SYSCALLS.varargs = varargs; + try { + + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + var mode = varargs ? SYSCALLS.get() : 0; + return FS.open(path, flags, mode).fd; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + + + + + /** @param {number=} addrlen */ + function writeSockaddr(sa, family, addr, port, addrlen) { + switch (family) { + case 2: + addr = inetPton4(addr); + zeroMemory(sa, 16); + if (addrlen) { + HEAP32[((addrlen)>>2)] = 16; + } + HEAP16[((sa)>>1)] = family; + HEAP32[(((sa)+(4))>>2)] = addr; + HEAP16[(((sa)+(2))>>1)] = _htons(port); + break; + case 10: + addr = inetPton6(addr); + zeroMemory(sa, 28); + if (addrlen) { + HEAP32[((addrlen)>>2)] = 28; + } + HEAP32[((sa)>>2)] = family; + HEAP32[(((sa)+(8))>>2)] = addr[0]; + HEAP32[(((sa)+(12))>>2)] = addr[1]; + HEAP32[(((sa)+(16))>>2)] = addr[2]; + HEAP32[(((sa)+(20))>>2)] = addr[3]; + HEAP16[(((sa)+(2))>>1)] = _htons(port); + break; + default: + return 5; + } + return 0; + } + + + function ___syscall_recvfrom(fd, buf, len, flags, addr, addrlen) { + try { + + var sock = getSocketFromFD(fd); + var msg = sock.sock_ops.recvmsg(sock, len); + if (!msg) return 0; // socket is closed + if (addr) { + var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(msg.addr), msg.port, addrlen); + assert(!errno); + } + HEAPU8.set(msg.buffer, buf); + return msg.buffer.byteLength; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_renameat(olddirfd, oldpath, newdirfd, newpath) { + try { + + oldpath = SYSCALLS.getStr(oldpath); + newpath = SYSCALLS.getStr(newpath); + oldpath = SYSCALLS.calculateAt(olddirfd, oldpath); + newpath = SYSCALLS.calculateAt(newdirfd, newpath); + FS.rename(oldpath, newpath); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_rmdir(path) { + try { + + path = SYSCALLS.getStr(path); + FS.rmdir(path); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + + + function ___syscall_sendto(fd, message, length, flags, addr, addr_len) { + try { + + var sock = getSocketFromFD(fd); + var dest = getSocketAddress(addr, addr_len, true); + if (!dest) { + // send, no address provided + return FS.write(sock.stream, HEAP8,message, length); + } + // sendto an address + return sock.sock_ops.sendmsg(sock, HEAP8,message, length, dest.addr, dest.port); + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + + function ___syscall_socket(domain, type, protocol) { + try { + + var sock = SOCKFS.createSocket(domain, type, protocol); + assert(sock.stream.fd < 64); // XXX ? select() assumes socket fd values are in 0..63 + return sock.stream.fd; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_stat64(path, buf) { + try { + + path = SYSCALLS.getStr(path); + return SYSCALLS.doStat(FS.stat, path, buf); + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_unlinkat(dirfd, path, flags) { + try { + + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + if (flags === 0) { + FS.unlink(path); + } else if (flags === 512) { + FS.rmdir(path); + } else { + abort('Invalid flags passed to unlinkat'); + } + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function __dlinit(main_dso_handle) {} + + var dlopenMissingError = 'To use dlopen, you need enable dynamic linking, see https://github.com/emscripten-core/emscripten/wiki/Linking'; + function __dlopen_js(handle) { + abort(dlopenMissingError); + } + + function __dlsym_js(handle, symbol) { + abort(dlopenMissingError); + } + + var structRegistrations = {}; + + function runDestructors(destructors) { + while (destructors.length) { + var ptr = destructors.pop(); + var del = destructors.pop(); + del(ptr); + } + } + + function simpleReadValueFromPointer(pointer) { + return this['fromWireType'](HEAP32[((pointer)>>2)]); + } + + var awaitingDependencies = {}; + + var registeredTypes = {}; + + var typeDependencies = {}; + + var char_0 = 48; + + var char_9 = 57; + function makeLegalFunctionName(name) { + if (undefined === name) { + return '_unknown'; + } + name = name.replace(/[^a-zA-Z0-9_]/g, '$'); + var f = name.charCodeAt(0); + if (f >= char_0 && f <= char_9) { + return '_' + name; + } + return name; + } + function createNamedFunction(name, body) { + name = makeLegalFunctionName(name); + /*jshint evil:true*/ + return new Function( + "body", + "return function " + name + "() {\n" + + " \"use strict\";" + + " return body.apply(this, arguments);\n" + + "};\n" + )(body); + } + function extendError(baseErrorType, errorName) { + var errorClass = createNamedFunction(errorName, function(message) { + this.name = errorName; + this.message = message; + + var stack = (new Error(message)).stack; + if (stack !== undefined) { + this.stack = this.toString() + '\n' + + stack.replace(/^Error(:[^\n]*)?\n/, ''); + } + }); + errorClass.prototype = Object.create(baseErrorType.prototype); + errorClass.prototype.constructor = errorClass; + errorClass.prototype.toString = function() { + if (this.message === undefined) { + return this.name; + } else { + return this.name + ': ' + this.message; + } + }; + + return errorClass; + } + var InternalError = undefined; + function throwInternalError(message) { + throw new InternalError(message); + } + function whenDependentTypesAreResolved(myTypes, dependentTypes, getTypeConverters) { + myTypes.forEach(function(type) { + typeDependencies[type] = dependentTypes; + }); + + function onComplete(typeConverters) { + var myTypeConverters = getTypeConverters(typeConverters); + if (myTypeConverters.length !== myTypes.length) { + throwInternalError('Mismatched type converter count'); + } + for (var i = 0; i < myTypes.length; ++i) { + registerType(myTypes[i], myTypeConverters[i]); + } + } + + var typeConverters = new Array(dependentTypes.length); + var unregisteredTypes = []; + var registered = 0; + dependentTypes.forEach((dt, i) => { + if (registeredTypes.hasOwnProperty(dt)) { + typeConverters[i] = registeredTypes[dt]; + } else { + unregisteredTypes.push(dt); + if (!awaitingDependencies.hasOwnProperty(dt)) { + awaitingDependencies[dt] = []; + } + awaitingDependencies[dt].push(() => { + typeConverters[i] = registeredTypes[dt]; + ++registered; + if (registered === unregisteredTypes.length) { + onComplete(typeConverters); + } + }); + } + }); + if (0 === unregisteredTypes.length) { + onComplete(typeConverters); + } + } + function __embind_finalize_value_object(structType) { + var reg = structRegistrations[structType]; + delete structRegistrations[structType]; + + var rawConstructor = reg.rawConstructor; + var rawDestructor = reg.rawDestructor; + var fieldRecords = reg.fields; + var fieldTypes = fieldRecords.map((field) => field.getterReturnType). + concat(fieldRecords.map((field) => field.setterArgumentType)); + whenDependentTypesAreResolved([structType], fieldTypes, (fieldTypes) => { + var fields = {}; + fieldRecords.forEach((field, i) => { + var fieldName = field.fieldName; + var getterReturnType = fieldTypes[i]; + var getter = field.getter; + var getterContext = field.getterContext; + var setterArgumentType = fieldTypes[i + fieldRecords.length]; + var setter = field.setter; + var setterContext = field.setterContext; + fields[fieldName] = { + read: (ptr) => { + return getterReturnType['fromWireType']( + getter(getterContext, ptr)); + }, + write: (ptr, o) => { + var destructors = []; + setter(setterContext, ptr, setterArgumentType['toWireType'](destructors, o)); + runDestructors(destructors); + } + }; + }); + + return [{ + name: reg.name, + 'fromWireType': function(ptr) { + var rv = {}; + for (var i in fields) { + rv[i] = fields[i].read(ptr); + } + rawDestructor(ptr); + return rv; + }, + 'toWireType': function(destructors, o) { + // todo: Here we have an opportunity for -O3 level "unsafe" optimizations: + // assume all fields are present without checking. + for (var fieldName in fields) { + if (!(fieldName in o)) { + throw new TypeError('Missing field: "' + fieldName + '"'); + } + } + var ptr = rawConstructor(); + for (fieldName in fields) { + fields[fieldName].write(ptr, o[fieldName]); + } + if (destructors !== null) { + destructors.push(rawDestructor, ptr); + } + return ptr; + }, + 'argPackAdvance': 8, + 'readValueFromPointer': simpleReadValueFromPointer, + destructorFunction: rawDestructor, + }]; + }); + } + + function __embind_register_bigint(primitiveType, name, size, minRange, maxRange) {} + + function getShiftFromSize(size) { + switch (size) { + case 1: return 0; + case 2: return 1; + case 4: return 2; + case 8: return 3; + default: + throw new TypeError('Unknown type size: ' + size); + } + } + + function embind_init_charCodes() { + var codes = new Array(256); + for (var i = 0; i < 256; ++i) { + codes[i] = String.fromCharCode(i); + } + embind_charCodes = codes; + } + var embind_charCodes = undefined; + function readLatin1String(ptr) { + var ret = ""; + var c = ptr; + while (HEAPU8[c]) { + ret += embind_charCodes[HEAPU8[c++]]; + } + return ret; + } + + + + + var BindingError = undefined; + function throwBindingError(message) { + throw new BindingError(message); + } + + /** @param {Object=} options */ + function registerType(rawType, registeredInstance, options = {}) { + if (!('argPackAdvance' in registeredInstance)) { + throw new TypeError('registerType registeredInstance requires argPackAdvance'); + } + + var name = registeredInstance.name; + if (!rawType) { + throwBindingError('type "' + name + '" must have a positive integer typeid pointer'); + } + if (registeredTypes.hasOwnProperty(rawType)) { + if (options.ignoreDuplicateRegistrations) { + return; + } else { + throwBindingError("Cannot register type '" + name + "' twice"); + } + } + + registeredTypes[rawType] = registeredInstance; + delete typeDependencies[rawType]; + + if (awaitingDependencies.hasOwnProperty(rawType)) { + var callbacks = awaitingDependencies[rawType]; + delete awaitingDependencies[rawType]; + callbacks.forEach((cb) => cb()); + } + } + function __embind_register_bool(rawType, name, size, trueValue, falseValue) { + var shift = getShiftFromSize(size); + + name = readLatin1String(name); + registerType(rawType, { + name: name, + 'fromWireType': function(wt) { + // ambiguous emscripten ABI: sometimes return values are + // true or false, and sometimes integers (0 or 1) + return !!wt; + }, + 'toWireType': function(destructors, o) { + return o ? trueValue : falseValue; + }, + 'argPackAdvance': 8, + 'readValueFromPointer': function(pointer) { + // TODO: if heap is fixed (like in asm.js) this could be executed outside + var heap; + if (size === 1) { + heap = HEAP8; + } else if (size === 2) { + heap = HEAP16; + } else if (size === 4) { + heap = HEAP32; + } else { + throw new TypeError("Unknown boolean type size: " + name); + } + return this['fromWireType'](heap[pointer >> shift]); + }, + destructorFunction: null, // This type does not need a destructor + }); + } + + + function ClassHandle_isAliasOf(other) { + if (!(this instanceof ClassHandle)) { + return false; + } + if (!(other instanceof ClassHandle)) { + return false; + } + + var leftClass = this.$$.ptrType.registeredClass; + var left = this.$$.ptr; + var rightClass = other.$$.ptrType.registeredClass; + var right = other.$$.ptr; + + while (leftClass.baseClass) { + left = leftClass.upcast(left); + leftClass = leftClass.baseClass; + } + + while (rightClass.baseClass) { + right = rightClass.upcast(right); + rightClass = rightClass.baseClass; + } + + return leftClass === rightClass && left === right; + } + + function shallowCopyInternalPointer(o) { + return { + count: o.count, + deleteScheduled: o.deleteScheduled, + preservePointerOnDelete: o.preservePointerOnDelete, + ptr: o.ptr, + ptrType: o.ptrType, + smartPtr: o.smartPtr, + smartPtrType: o.smartPtrType, + }; + } + + function throwInstanceAlreadyDeleted(obj) { + function getInstanceTypeName(handle) { + return handle.$$.ptrType.registeredClass.name; + } + throwBindingError(getInstanceTypeName(obj) + ' instance already deleted'); + } + + var finalizationRegistry = false; + + function detachFinalizer(handle) {} + + function runDestructor($$) { + if ($$.smartPtr) { + $$.smartPtrType.rawDestructor($$.smartPtr); + } else { + $$.ptrType.registeredClass.rawDestructor($$.ptr); + } + } + function releaseClassHandle($$) { + $$.count.value -= 1; + var toDelete = 0 === $$.count.value; + if (toDelete) { + runDestructor($$); + } + } + + function downcastPointer(ptr, ptrClass, desiredClass) { + if (ptrClass === desiredClass) { + return ptr; + } + if (undefined === desiredClass.baseClass) { + return null; // no conversion + } + + var rv = downcastPointer(ptr, ptrClass, desiredClass.baseClass); + if (rv === null) { + return null; + } + return desiredClass.downcast(rv); + } + + var registeredPointers = {}; + + function getInheritedInstanceCount() { + return Object.keys(registeredInstances).length; + } + + function getLiveInheritedInstances() { + var rv = []; + for (var k in registeredInstances) { + if (registeredInstances.hasOwnProperty(k)) { + rv.push(registeredInstances[k]); + } + } + return rv; + } + + var deletionQueue = []; + function flushPendingDeletes() { + while (deletionQueue.length) { + var obj = deletionQueue.pop(); + obj.$$.deleteScheduled = false; + obj['delete'](); + } + } + + var delayFunction = undefined; + + + function setDelayFunction(fn) { + delayFunction = fn; + if (deletionQueue.length && delayFunction) { + delayFunction(flushPendingDeletes); + } + } + function init_embind() { + Module['getInheritedInstanceCount'] = getInheritedInstanceCount; + Module['getLiveInheritedInstances'] = getLiveInheritedInstances; + Module['flushPendingDeletes'] = flushPendingDeletes; + Module['setDelayFunction'] = setDelayFunction; + } + var registeredInstances = {}; + + function getBasestPointer(class_, ptr) { + if (ptr === undefined) { + throwBindingError('ptr should not be undefined'); + } + while (class_.baseClass) { + ptr = class_.upcast(ptr); + class_ = class_.baseClass; + } + return ptr; + } + function getInheritedInstance(class_, ptr) { + ptr = getBasestPointer(class_, ptr); + return registeredInstances[ptr]; + } + + + function makeClassHandle(prototype, record) { + if (!record.ptrType || !record.ptr) { + throwInternalError('makeClassHandle requires ptr and ptrType'); + } + var hasSmartPtrType = !!record.smartPtrType; + var hasSmartPtr = !!record.smartPtr; + if (hasSmartPtrType !== hasSmartPtr) { + throwInternalError('Both smartPtrType and smartPtr must be specified'); + } + record.count = { value: 1 }; + return attachFinalizer(Object.create(prototype, { + $$: { + value: record, + }, + })); + } + function RegisteredPointer_fromWireType(ptr) { + // ptr is a raw pointer (or a raw smartpointer) + + // rawPointer is a maybe-null raw pointer + var rawPointer = this.getPointee(ptr); + if (!rawPointer) { + this.destructor(ptr); + return null; + } + + var registeredInstance = getInheritedInstance(this.registeredClass, rawPointer); + if (undefined !== registeredInstance) { + // JS object has been neutered, time to repopulate it + if (0 === registeredInstance.$$.count.value) { + registeredInstance.$$.ptr = rawPointer; + registeredInstance.$$.smartPtr = ptr; + return registeredInstance['clone'](); + } else { + // else, just increment reference count on existing object + // it already has a reference to the smart pointer + var rv = registeredInstance['clone'](); + this.destructor(ptr); + return rv; + } + } + + function makeDefaultHandle() { + if (this.isSmartPointer) { + return makeClassHandle(this.registeredClass.instancePrototype, { + ptrType: this.pointeeType, + ptr: rawPointer, + smartPtrType: this, + smartPtr: ptr, + }); + } else { + return makeClassHandle(this.registeredClass.instancePrototype, { + ptrType: this, + ptr: ptr, + }); + } + } + + var actualType = this.registeredClass.getActualType(rawPointer); + var registeredPointerRecord = registeredPointers[actualType]; + if (!registeredPointerRecord) { + return makeDefaultHandle.call(this); + } + + var toType; + if (this.isConst) { + toType = registeredPointerRecord.constPointerType; + } else { + toType = registeredPointerRecord.pointerType; + } + var dp = downcastPointer( + rawPointer, + this.registeredClass, + toType.registeredClass); + if (dp === null) { + return makeDefaultHandle.call(this); + } + if (this.isSmartPointer) { + return makeClassHandle(toType.registeredClass.instancePrototype, { + ptrType: toType, + ptr: dp, + smartPtrType: this, + smartPtr: ptr, + }); + } else { + return makeClassHandle(toType.registeredClass.instancePrototype, { + ptrType: toType, + ptr: dp, + }); + } + } + function attachFinalizer(handle) { + if ('undefined' === typeof FinalizationRegistry) { + attachFinalizer = (handle) => handle; + return handle; + } + // If the running environment has a FinalizationRegistry (see + // https://github.com/tc39/proposal-weakrefs), then attach finalizers + // for class handles. We check for the presence of FinalizationRegistry + // at run-time, not build-time. + finalizationRegistry = new FinalizationRegistry((info) => { + console.warn(info.leakWarning.stack.replace(/^Error: /, '')); + releaseClassHandle(info.$$); + }); + attachFinalizer = (handle) => { + var $$ = handle.$$; + var hasSmartPtr = !!$$.smartPtr; + if (hasSmartPtr) { + // We should not call the destructor on raw pointers in case other code expects the pointee to live + var info = { $$: $$ }; + // Create a warning as an Error instance in advance so that we can store + // the current stacktrace and point to it when / if a leak is detected. + // This is more useful than the empty stacktrace of `FinalizationRegistry` + // callback. + var cls = $$.ptrType.registeredClass; + info.leakWarning = new Error("Embind found a leaked C++ instance " + cls.name + " <" + ptrToString($$.ptr) + ">.\n" + + "We'll free it automatically in this case, but this functionality is not reliable across various environments.\n" + + "Make sure to invoke .delete() manually once you're done with the instance instead.\n" + + "Originally allocated"); // `.stack` will add "at ..." after this sentence + if ('captureStackTrace' in Error) { + Error.captureStackTrace(info.leakWarning, RegisteredPointer_fromWireType); + } + finalizationRegistry.register(handle, info, handle); + } + return handle; + }; + detachFinalizer = (handle) => finalizationRegistry.unregister(handle); + return attachFinalizer(handle); + } + function ClassHandle_clone() { + if (!this.$$.ptr) { + throwInstanceAlreadyDeleted(this); + } + + if (this.$$.preservePointerOnDelete) { + this.$$.count.value += 1; + return this; + } else { + var clone = attachFinalizer(Object.create(Object.getPrototypeOf(this), { + $$: { + value: shallowCopyInternalPointer(this.$$), + } + })); + + clone.$$.count.value += 1; + clone.$$.deleteScheduled = false; + return clone; + } + } + + + + + function ClassHandle_delete() { + if (!this.$$.ptr) { + throwInstanceAlreadyDeleted(this); + } + + if (this.$$.deleteScheduled && !this.$$.preservePointerOnDelete) { + throwBindingError('Object already scheduled for deletion'); + } + + detachFinalizer(this); + releaseClassHandle(this.$$); + + if (!this.$$.preservePointerOnDelete) { + this.$$.smartPtr = undefined; + this.$$.ptr = undefined; + } + } + + function ClassHandle_isDeleted() { + return !this.$$.ptr; + } + + + + function ClassHandle_deleteLater() { + if (!this.$$.ptr) { + throwInstanceAlreadyDeleted(this); + } + if (this.$$.deleteScheduled && !this.$$.preservePointerOnDelete) { + throwBindingError('Object already scheduled for deletion'); + } + deletionQueue.push(this); + if (deletionQueue.length === 1 && delayFunction) { + delayFunction(flushPendingDeletes); + } + this.$$.deleteScheduled = true; + return this; + } + function init_ClassHandle() { + ClassHandle.prototype['isAliasOf'] = ClassHandle_isAliasOf; + ClassHandle.prototype['clone'] = ClassHandle_clone; + ClassHandle.prototype['delete'] = ClassHandle_delete; + ClassHandle.prototype['isDeleted'] = ClassHandle_isDeleted; + ClassHandle.prototype['deleteLater'] = ClassHandle_deleteLater; + } + function ClassHandle() { + } + + + + function ensureOverloadTable(proto, methodName, humanName) { + if (undefined === proto[methodName].overloadTable) { + var prevFunc = proto[methodName]; + // Inject an overload resolver function that routes to the appropriate overload based on the number of arguments. + proto[methodName] = function() { + // TODO This check can be removed in -O3 level "unsafe" optimizations. + if (!proto[methodName].overloadTable.hasOwnProperty(arguments.length)) { + throwBindingError("Function '" + humanName + "' called with an invalid number of arguments (" + arguments.length + ") - expects one of (" + proto[methodName].overloadTable + ")!"); + } + return proto[methodName].overloadTable[arguments.length].apply(this, arguments); + }; + // Move the previous function into the overload table. + proto[methodName].overloadTable = []; + proto[methodName].overloadTable[prevFunc.argCount] = prevFunc; + } + } + + /** @param {number=} numArguments */ + function exposePublicSymbol(name, value, numArguments) { + if (Module.hasOwnProperty(name)) { + if (undefined === numArguments || (undefined !== Module[name].overloadTable && undefined !== Module[name].overloadTable[numArguments])) { + throwBindingError("Cannot register public name '" + name + "' twice"); + } + + // We are exposing a function with the same name as an existing function. Create an overload table and a function selector + // that routes between the two. + ensureOverloadTable(Module, name, name); + if (Module.hasOwnProperty(numArguments)) { + throwBindingError("Cannot register multiple overloads of a function with the same number of arguments (" + numArguments + ")!"); + } + // Add the new function into the overload table. + Module[name].overloadTable[numArguments] = value; + } + else { + Module[name] = value; + if (undefined !== numArguments) { + Module[name].numArguments = numArguments; + } + } + } + + + + /** @constructor */ + function RegisteredClass(name, + constructor, + instancePrototype, + rawDestructor, + baseClass, + getActualType, + upcast, + downcast) { + this.name = name; + this.constructor = constructor; + this.instancePrototype = instancePrototype; + this.rawDestructor = rawDestructor; + this.baseClass = baseClass; + this.getActualType = getActualType; + this.upcast = upcast; + this.downcast = downcast; + this.pureVirtualFunctions = []; + } + + + function upcastPointer(ptr, ptrClass, desiredClass) { + while (ptrClass !== desiredClass) { + if (!ptrClass.upcast) { + throwBindingError("Expected null or instance of " + desiredClass.name + ", got an instance of " + ptrClass.name); + } + ptr = ptrClass.upcast(ptr); + ptrClass = ptrClass.baseClass; + } + return ptr; + } + function constNoSmartPtrRawPointerToWireType(destructors, handle) { + if (handle === null) { + if (this.isReference) { + throwBindingError('null is not a valid ' + this.name); + } + return 0; + } + + if (!handle.$$) { + throwBindingError('Cannot pass "' + embindRepr(handle) + '" as a ' + this.name); + } + if (!handle.$$.ptr) { + throwBindingError('Cannot pass deleted object as a pointer of type ' + this.name); + } + var handleClass = handle.$$.ptrType.registeredClass; + var ptr = upcastPointer(handle.$$.ptr, handleClass, this.registeredClass); + return ptr; + } + + + function genericPointerToWireType(destructors, handle) { + var ptr; + if (handle === null) { + if (this.isReference) { + throwBindingError('null is not a valid ' + this.name); + } + + if (this.isSmartPointer) { + ptr = this.rawConstructor(); + if (destructors !== null) { + destructors.push(this.rawDestructor, ptr); + } + return ptr; + } else { + return 0; + } + } + + if (!handle.$$) { + throwBindingError('Cannot pass "' + embindRepr(handle) + '" as a ' + this.name); + } + if (!handle.$$.ptr) { + throwBindingError('Cannot pass deleted object as a pointer of type ' + this.name); + } + if (!this.isConst && handle.$$.ptrType.isConst) { + throwBindingError('Cannot convert argument of type ' + (handle.$$.smartPtrType ? handle.$$.smartPtrType.name : handle.$$.ptrType.name) + ' to parameter type ' + this.name); + } + var handleClass = handle.$$.ptrType.registeredClass; + ptr = upcastPointer(handle.$$.ptr, handleClass, this.registeredClass); + + if (this.isSmartPointer) { + // TODO: this is not strictly true + // We could support BY_EMVAL conversions from raw pointers to smart pointers + // because the smart pointer can hold a reference to the handle + if (undefined === handle.$$.smartPtr) { + throwBindingError('Passing raw pointer to smart pointer is illegal'); + } + + switch (this.sharingPolicy) { + case 0: // NONE + // no upcasting + if (handle.$$.smartPtrType === this) { + ptr = handle.$$.smartPtr; + } else { + throwBindingError('Cannot convert argument of type ' + (handle.$$.smartPtrType ? handle.$$.smartPtrType.name : handle.$$.ptrType.name) + ' to parameter type ' + this.name); + } + break; + + case 1: // INTRUSIVE + ptr = handle.$$.smartPtr; + break; + + case 2: // BY_EMVAL + if (handle.$$.smartPtrType === this) { + ptr = handle.$$.smartPtr; + } else { + var clonedHandle = handle['clone'](); + ptr = this.rawShare( + ptr, + Emval.toHandle(function() { + clonedHandle['delete'](); + }) + ); + if (destructors !== null) { + destructors.push(this.rawDestructor, ptr); + } + } + break; + + default: + throwBindingError('Unsupporting sharing policy'); + } + } + return ptr; + } + + + function nonConstNoSmartPtrRawPointerToWireType(destructors, handle) { + if (handle === null) { + if (this.isReference) { + throwBindingError('null is not a valid ' + this.name); + } + return 0; + } + + if (!handle.$$) { + throwBindingError('Cannot pass "' + embindRepr(handle) + '" as a ' + this.name); + } + if (!handle.$$.ptr) { + throwBindingError('Cannot pass deleted object as a pointer of type ' + this.name); + } + if (handle.$$.ptrType.isConst) { + throwBindingError('Cannot convert argument of type ' + handle.$$.ptrType.name + ' to parameter type ' + this.name); + } + var handleClass = handle.$$.ptrType.registeredClass; + var ptr = upcastPointer(handle.$$.ptr, handleClass, this.registeredClass); + return ptr; + } + + + function RegisteredPointer_getPointee(ptr) { + if (this.rawGetPointee) { + ptr = this.rawGetPointee(ptr); + } + return ptr; + } + + function RegisteredPointer_destructor(ptr) { + if (this.rawDestructor) { + this.rawDestructor(ptr); + } + } + + function RegisteredPointer_deleteObject(handle) { + if (handle !== null) { + handle['delete'](); + } + } + + function init_RegisteredPointer() { + RegisteredPointer.prototype.getPointee = RegisteredPointer_getPointee; + RegisteredPointer.prototype.destructor = RegisteredPointer_destructor; + RegisteredPointer.prototype['argPackAdvance'] = 8; + RegisteredPointer.prototype['readValueFromPointer'] = simpleReadValueFromPointer; + RegisteredPointer.prototype['deleteObject'] = RegisteredPointer_deleteObject; + RegisteredPointer.prototype['fromWireType'] = RegisteredPointer_fromWireType; + } + /** @constructor + @param {*=} pointeeType, + @param {*=} sharingPolicy, + @param {*=} rawGetPointee, + @param {*=} rawConstructor, + @param {*=} rawShare, + @param {*=} rawDestructor, + */ + function RegisteredPointer( + name, + registeredClass, + isReference, + isConst, + + // smart pointer properties + isSmartPointer, + pointeeType, + sharingPolicy, + rawGetPointee, + rawConstructor, + rawShare, + rawDestructor + ) { + this.name = name; + this.registeredClass = registeredClass; + this.isReference = isReference; + this.isConst = isConst; + + // smart pointer properties + this.isSmartPointer = isSmartPointer; + this.pointeeType = pointeeType; + this.sharingPolicy = sharingPolicy; + this.rawGetPointee = rawGetPointee; + this.rawConstructor = rawConstructor; + this.rawShare = rawShare; + this.rawDestructor = rawDestructor; + + if (!isSmartPointer && registeredClass.baseClass === undefined) { + if (isConst) { + this['toWireType'] = constNoSmartPtrRawPointerToWireType; + this.destructorFunction = null; + } else { + this['toWireType'] = nonConstNoSmartPtrRawPointerToWireType; + this.destructorFunction = null; + } + } else { + this['toWireType'] = genericPointerToWireType; + // Here we must leave this.destructorFunction undefined, since whether genericPointerToWireType returns + // a pointer that needs to be freed up is runtime-dependent, and cannot be evaluated at registration time. + // TODO: Create an alternative mechanism that allows removing the use of var destructors = []; array in + // craftInvokerFunction altogether. + } + } + + /** @param {number=} numArguments */ + function replacePublicSymbol(name, value, numArguments) { + if (!Module.hasOwnProperty(name)) { + throwInternalError('Replacing nonexistant public symbol'); + } + // If there's an overload table for this symbol, replace the symbol in the overload table instead. + if (undefined !== Module[name].overloadTable && undefined !== numArguments) { + Module[name].overloadTable[numArguments] = value; + } + else { + Module[name] = value; + Module[name].argCount = numArguments; + } + } + + + + function dynCallLegacy(sig, ptr, args) { + assert(('dynCall_' + sig) in Module, 'bad function pointer type - dynCall function not found for sig \'' + sig + '\''); + if (args && args.length) { + // j (64-bit integer) must be passed in as two numbers [low 32, high 32]. + assert(args.length === sig.substring(1).replace(/j/g, '--').length); + } else { + assert(sig.length == 1); + } + var f = Module['dynCall_' + sig]; + return args && args.length ? f.apply(null, [ptr].concat(args)) : f.call(null, ptr); + } + + var wasmTableMirror = []; + + function getWasmTableEntry(funcPtr) { + var func = wasmTableMirror[funcPtr]; + if (!func) { + if (funcPtr >= wasmTableMirror.length) wasmTableMirror.length = funcPtr + 1; + wasmTableMirror[funcPtr] = func = wasmTable.get(funcPtr); + } + assert(wasmTable.get(funcPtr) == func, "JavaScript-side Wasm function table mirror is out of date!"); + return func; + } + /** @param {Object=} args */ + function dynCall(sig, ptr, args) { + return dynCallLegacy(sig, ptr, args); + } + + function getDynCaller(sig, ptr) { + var argCache = []; + return function() { + argCache.length = 0; + Object.assign(argCache, arguments); + return dynCall(sig, ptr, argCache); + }; + } + + function embind__requireFunction(signature, rawFunction) { + signature = readLatin1String(signature); + + function makeDynCaller() { + return getDynCaller(signature, rawFunction); + } + + var fp = makeDynCaller(); + if (typeof fp != "function") { + throwBindingError("unknown function pointer with signature " + signature + ": " + rawFunction); + } + return fp; + } + + + + var UnboundTypeError = undefined; + + + function getTypeName(type) { + var ptr = ___getTypeName(type); + var rv = readLatin1String(ptr); + _free(ptr); + return rv; + } + function throwUnboundTypeError(message, types) { + var unboundTypes = []; + var seen = {}; + function visit(type) { + if (seen[type]) { + return; + } + if (registeredTypes[type]) { + return; + } + if (typeDependencies[type]) { + typeDependencies[type].forEach(visit); + return; + } + unboundTypes.push(type); + seen[type] = true; + } + types.forEach(visit); + + throw new UnboundTypeError(message + ': ' + unboundTypes.map(getTypeName).join([', '])); + } + + function __embind_register_class(rawType, + rawPointerType, + rawConstPointerType, + baseClassRawType, + getActualTypeSignature, + getActualType, + upcastSignature, + upcast, + downcastSignature, + downcast, + name, + destructorSignature, + rawDestructor) { + name = readLatin1String(name); + getActualType = embind__requireFunction(getActualTypeSignature, getActualType); + if (upcast) { + upcast = embind__requireFunction(upcastSignature, upcast); + } + if (downcast) { + downcast = embind__requireFunction(downcastSignature, downcast); + } + rawDestructor = embind__requireFunction(destructorSignature, rawDestructor); + var legalFunctionName = makeLegalFunctionName(name); + + exposePublicSymbol(legalFunctionName, function() { + // this code cannot run if baseClassRawType is zero + throwUnboundTypeError('Cannot construct ' + name + ' due to unbound types', [baseClassRawType]); + }); + + whenDependentTypesAreResolved( + [rawType, rawPointerType, rawConstPointerType], + baseClassRawType ? [baseClassRawType] : [], + function(base) { + base = base[0]; + + var baseClass; + var basePrototype; + if (baseClassRawType) { + baseClass = base.registeredClass; + basePrototype = baseClass.instancePrototype; + } else { + basePrototype = ClassHandle.prototype; + } + + var constructor = createNamedFunction(legalFunctionName, function() { + if (Object.getPrototypeOf(this) !== instancePrototype) { + throw new BindingError("Use 'new' to construct " + name); + } + if (undefined === registeredClass.constructor_body) { + throw new BindingError(name + " has no accessible constructor"); + } + var body = registeredClass.constructor_body[arguments.length]; + if (undefined === body) { + throw new BindingError("Tried to invoke ctor of " + name + " with invalid number of parameters (" + arguments.length + ") - expected (" + Object.keys(registeredClass.constructor_body).toString() + ") parameters instead!"); + } + return body.apply(this, arguments); + }); + + var instancePrototype = Object.create(basePrototype, { + constructor: { value: constructor }, + }); + + constructor.prototype = instancePrototype; + + var registeredClass = new RegisteredClass(name, + constructor, + instancePrototype, + rawDestructor, + baseClass, + getActualType, + upcast, + downcast); + + var referenceConverter = new RegisteredPointer(name, + registeredClass, + true, + false, + false); + + var pointerConverter = new RegisteredPointer(name + '*', + registeredClass, + false, + false, + false); + + var constPointerConverter = new RegisteredPointer(name + ' const*', + registeredClass, + false, + true, + false); + + registeredPointers[rawType] = { + pointerType: pointerConverter, + constPointerType: constPointerConverter + }; + + replacePublicSymbol(legalFunctionName, constructor); + + return [referenceConverter, pointerConverter, constPointerConverter]; + } + ); + } + + function heap32VectorToArray(count, firstElement) { + var array = []; + for (var i = 0; i < count; i++) { + // TODO(https://github.com/emscripten-core/emscripten/issues/17310): + // Find a way to hoist the `>> 2` or `>> 3` out of this loop. + array.push(HEAPU32[(((firstElement)+(i * 4))>>2)]); + } + return array; + } + + + + + + + + function new_(constructor, argumentList) { + if (!(constructor instanceof Function)) { + throw new TypeError('new_ called with constructor type ' + typeof(constructor) + " which is not a function"); + } + /* + * Previously, the following line was just: + * function dummy() {}; + * Unfortunately, Chrome was preserving 'dummy' as the object's name, even + * though at creation, the 'dummy' has the correct constructor name. Thus, + * objects created with IMVU.new would show up in the debugger as 'dummy', + * which isn't very helpful. Using IMVU.createNamedFunction addresses the + * issue. Doublely-unfortunately, there's no way to write a test for this + * behavior. -NRD 2013.02.22 + */ + var dummy = createNamedFunction(constructor.name || 'unknownFunctionName', function(){}); + dummy.prototype = constructor.prototype; + var obj = new dummy; + + var r = constructor.apply(obj, argumentList); + return (r instanceof Object) ? r : obj; + } + + + function craftInvokerFunction(humanName, argTypes, classType, cppInvokerFunc, cppTargetFunc) { + // humanName: a human-readable string name for the function to be generated. + // argTypes: An array that contains the embind type objects for all types in the function signature. + // argTypes[0] is the type object for the function return value. + // argTypes[1] is the type object for function this object/class type, or null if not crafting an invoker for a class method. + // argTypes[2...] are the actual function parameters. + // classType: The embind type object for the class to be bound, or null if this is not a method of a class. + // cppInvokerFunc: JS Function object to the C++-side function that interops into C++ code. + // cppTargetFunc: Function pointer (an integer to FUNCTION_TABLE) to the target C++ function the cppInvokerFunc will end up calling. + var argCount = argTypes.length; + + if (argCount < 2) { + throwBindingError("argTypes array size mismatch! Must at least get return value and 'this' types!"); + } + + var isClassMethodFunc = (argTypes[1] !== null && classType !== null); + + // Free functions with signature "void function()" do not need an invoker that marshalls between wire types. + // TODO: This omits argument count check - enable only at -O3 or similar. + // if (ENABLE_UNSAFE_OPTS && argCount == 2 && argTypes[0].name == "void" && !isClassMethodFunc) { + // return FUNCTION_TABLE[fn]; + // } + + // Determine if we need to use a dynamic stack to store the destructors for the function parameters. + // TODO: Remove this completely once all function invokers are being dynamically generated. + var needsDestructorStack = false; + + for (var i = 1; i < argTypes.length; ++i) { // Skip return value at index 0 - it's not deleted here. + if (argTypes[i] !== null && argTypes[i].destructorFunction === undefined) { // The type does not define a destructor function - must use dynamic stack + needsDestructorStack = true; + break; + } + } + + var returns = (argTypes[0].name !== "void"); + + var argsList = ""; + var argsListWired = ""; + for (var i = 0; i < argCount - 2; ++i) { + argsList += (i!==0?", ":"")+"arg"+i; + argsListWired += (i!==0?", ":"")+"arg"+i+"Wired"; + } + + var invokerFnBody = + "return function "+makeLegalFunctionName(humanName)+"("+argsList+") {\n" + + "if (arguments.length !== "+(argCount - 2)+") {\n" + + "throwBindingError('function "+humanName+" called with ' + arguments.length + ' arguments, expected "+(argCount - 2)+" args!');\n" + + "}\n"; + + if (needsDestructorStack) { + invokerFnBody += "var destructors = [];\n"; + } + + var dtorStack = needsDestructorStack ? "destructors" : "null"; + var args1 = ["throwBindingError", "invoker", "fn", "runDestructors", "retType", "classParam"]; + var args2 = [throwBindingError, cppInvokerFunc, cppTargetFunc, runDestructors, argTypes[0], argTypes[1]]; + + if (isClassMethodFunc) { + invokerFnBody += "var thisWired = classParam.toWireType("+dtorStack+", this);\n"; + } + + for (var i = 0; i < argCount - 2; ++i) { + invokerFnBody += "var arg"+i+"Wired = argType"+i+".toWireType("+dtorStack+", arg"+i+"); // "+argTypes[i+2].name+"\n"; + args1.push("argType"+i); + args2.push(argTypes[i+2]); + } + + if (isClassMethodFunc) { + argsListWired = "thisWired" + (argsListWired.length > 0 ? ", " : "") + argsListWired; + } + + invokerFnBody += + (returns?"var rv = ":"") + "invoker(fn"+(argsListWired.length>0?", ":"")+argsListWired+");\n"; + + if (needsDestructorStack) { + invokerFnBody += "runDestructors(destructors);\n"; + } else { + for (var i = isClassMethodFunc?1:2; i < argTypes.length; ++i) { // Skip return value at index 0 - it's not deleted here. Also skip class type if not a method. + var paramName = (i === 1 ? "thisWired" : ("arg"+(i - 2)+"Wired")); + if (argTypes[i].destructorFunction !== null) { + invokerFnBody += paramName+"_dtor("+paramName+"); // "+argTypes[i].name+"\n"; + args1.push(paramName+"_dtor"); + args2.push(argTypes[i].destructorFunction); + } + } + } + + if (returns) { + invokerFnBody += "var ret = retType.fromWireType(rv);\n" + + "return ret;\n"; + } else { + } + + invokerFnBody += "}\n"; + + args1.push(invokerFnBody); + + var invokerFunction = new_(Function, args1).apply(null, args2); + return invokerFunction; + } + function __embind_register_class_constructor( + rawClassType, + argCount, + rawArgTypesAddr, + invokerSignature, + invoker, + rawConstructor + ) { + assert(argCount > 0); + var rawArgTypes = heap32VectorToArray(argCount, rawArgTypesAddr); + invoker = embind__requireFunction(invokerSignature, invoker); + var args = [rawConstructor]; + var destructors = []; + + whenDependentTypesAreResolved([], [rawClassType], function(classType) { + classType = classType[0]; + var humanName = 'constructor ' + classType.name; + + if (undefined === classType.registeredClass.constructor_body) { + classType.registeredClass.constructor_body = []; + } + if (undefined !== classType.registeredClass.constructor_body[argCount - 1]) { + throw new BindingError("Cannot register multiple constructors with identical number of parameters (" + (argCount-1) + ") for class '" + classType.name + "'! Overload resolution is currently only performed using the parameter count, not actual type info!"); + } + classType.registeredClass.constructor_body[argCount - 1] = () => { + throwUnboundTypeError('Cannot construct ' + classType.name + ' due to unbound types', rawArgTypes); + }; + + whenDependentTypesAreResolved([], rawArgTypes, function(argTypes) { + // Insert empty slot for context type (argTypes[1]). + argTypes.splice(1, 0, null); + classType.registeredClass.constructor_body[argCount - 1] = craftInvokerFunction(humanName, argTypes, null, invoker, rawConstructor); + return []; + }); + return []; + }); + } + + + + + + + function __embind_register_class_function(rawClassType, + methodName, + argCount, + rawArgTypesAddr, // [ReturnType, ThisType, Args...] + invokerSignature, + rawInvoker, + context, + isPureVirtual) { + var rawArgTypes = heap32VectorToArray(argCount, rawArgTypesAddr); + methodName = readLatin1String(methodName); + rawInvoker = embind__requireFunction(invokerSignature, rawInvoker); + + whenDependentTypesAreResolved([], [rawClassType], function(classType) { + classType = classType[0]; + var humanName = classType.name + '.' + methodName; + + if (methodName.startsWith("@@")) { + methodName = Symbol[methodName.substring(2)]; + } + + if (isPureVirtual) { + classType.registeredClass.pureVirtualFunctions.push(methodName); + } + + function unboundTypesHandler() { + throwUnboundTypeError('Cannot call ' + humanName + ' due to unbound types', rawArgTypes); + } + + var proto = classType.registeredClass.instancePrototype; + var method = proto[methodName]; + if (undefined === method || (undefined === method.overloadTable && method.className !== classType.name && method.argCount === argCount - 2)) { + // This is the first overload to be registered, OR we are replacing a + // function in the base class with a function in the derived class. + unboundTypesHandler.argCount = argCount - 2; + unboundTypesHandler.className = classType.name; + proto[methodName] = unboundTypesHandler; + } else { + // There was an existing function with the same name registered. Set up + // a function overload routing table. + ensureOverloadTable(proto, methodName, humanName); + proto[methodName].overloadTable[argCount - 2] = unboundTypesHandler; + } + + whenDependentTypesAreResolved([], rawArgTypes, function(argTypes) { + var memberFunction = craftInvokerFunction(humanName, argTypes, classType, rawInvoker, context); + + // Replace the initial unbound-handler-stub function with the appropriate member function, now that all types + // are resolved. If multiple overloads are registered for this function, the function goes into an overload table. + if (undefined === proto[methodName].overloadTable) { + // Set argCount in case an overload is registered later + memberFunction.argCount = argCount - 2; + proto[methodName] = memberFunction; + } else { + proto[methodName].overloadTable[argCount - 2] = memberFunction; + } + + return []; + }); + return []; + }); + } + + var emval_free_list = []; + + var emval_handle_array = [{},{value:undefined},{value:null},{value:true},{value:false}]; + function __emval_decref(handle) { + if (handle > 4 && 0 === --emval_handle_array[handle].refcount) { + emval_handle_array[handle] = undefined; + emval_free_list.push(handle); + } + } + + + + + function count_emval_handles() { + var count = 0; + for (var i = 5; i < emval_handle_array.length; ++i) { + if (emval_handle_array[i] !== undefined) { + ++count; + } + } + return count; + } + + function get_first_emval() { + for (var i = 5; i < emval_handle_array.length; ++i) { + if (emval_handle_array[i] !== undefined) { + return emval_handle_array[i]; + } + } + return null; + } + function init_emval() { + Module['count_emval_handles'] = count_emval_handles; + Module['get_first_emval'] = get_first_emval; + } + var Emval = {toValue:(handle) => { + if (!handle) { + throwBindingError('Cannot use deleted val. handle = ' + handle); + } + return emval_handle_array[handle].value; + },toHandle:(value) => { + switch (value) { + case undefined: return 1; + case null: return 2; + case true: return 3; + case false: return 4; + default:{ + var handle = emval_free_list.length ? + emval_free_list.pop() : + emval_handle_array.length; + + emval_handle_array[handle] = {refcount: 1, value: value}; + return handle; + } + } + }}; + + + + function __embind_register_emval(rawType, name) { + name = readLatin1String(name); + registerType(rawType, { + name: name, + 'fromWireType': function(handle) { + var rv = Emval.toValue(handle); + __emval_decref(handle); + return rv; + }, + 'toWireType': function(destructors, value) { + return Emval.toHandle(value); + }, + 'argPackAdvance': 8, + 'readValueFromPointer': simpleReadValueFromPointer, + destructorFunction: null, // This type does not need a destructor + + // TODO: do we need a deleteObject here? write a test where + // emval is passed into JS via an interface + }); + } + + function embindRepr(v) { + if (v === null) { + return 'null'; + } + var t = typeof v; + if (t === 'object' || t === 'array' || t === 'function') { + return v.toString(); + } else { + return '' + v; + } + } + + function floatReadValueFromPointer(name, shift) { + switch (shift) { + case 2: return function(pointer) { + return this['fromWireType'](HEAPF32[pointer >> 2]); + }; + case 3: return function(pointer) { + return this['fromWireType'](HEAPF64[pointer >> 3]); + }; + default: + throw new TypeError("Unknown float type: " + name); + } + } + + + + function __embind_register_float(rawType, name, size) { + var shift = getShiftFromSize(size); + name = readLatin1String(name); + registerType(rawType, { + name: name, + 'fromWireType': function(value) { + return value; + }, + 'toWireType': function(destructors, value) { + if (typeof value != "number" && typeof value != "boolean") { + throw new TypeError('Cannot convert "' + embindRepr(value) + '" to ' + this.name); + } + // The VM will perform JS to Wasm value conversion, according to the spec: + // https://www.w3.org/TR/wasm-js-api-1/#towebassemblyvalue + return value; + }, + 'argPackAdvance': 8, + 'readValueFromPointer': floatReadValueFromPointer(name, shift), + destructorFunction: null, // This type does not need a destructor + }); + } + + + + + + + + + function __embind_register_function(name, argCount, rawArgTypesAddr, signature, rawInvoker, fn) { + var argTypes = heap32VectorToArray(argCount, rawArgTypesAddr); + name = readLatin1String(name); + + rawInvoker = embind__requireFunction(signature, rawInvoker); + + exposePublicSymbol(name, function() { + throwUnboundTypeError('Cannot call ' + name + ' due to unbound types', argTypes); + }, argCount - 1); + + whenDependentTypesAreResolved([], argTypes, function(argTypes) { + var invokerArgsArray = [argTypes[0] /* return value */, null /* no class 'this'*/].concat(argTypes.slice(1) /* actual params */); + replacePublicSymbol(name, craftInvokerFunction(name, invokerArgsArray, null /* no class 'this'*/, rawInvoker, fn), argCount - 1); + return []; + }); + } + + + + function integerReadValueFromPointer(name, shift, signed) { + // integers are quite common, so generate very specialized functions + switch (shift) { + case 0: return signed ? + function readS8FromPointer(pointer) { return HEAP8[pointer]; } : + function readU8FromPointer(pointer) { return HEAPU8[pointer]; }; + case 1: return signed ? + function readS16FromPointer(pointer) { return HEAP16[pointer >> 1]; } : + function readU16FromPointer(pointer) { return HEAPU16[pointer >> 1]; }; + case 2: return signed ? + function readS32FromPointer(pointer) { return HEAP32[pointer >> 2]; } : + function readU32FromPointer(pointer) { return HEAPU32[pointer >> 2]; }; + default: + throw new TypeError("Unknown integer type: " + name); + } + } + + + function __embind_register_integer(primitiveType, name, size, minRange, maxRange) { + name = readLatin1String(name); + // LLVM doesn't have signed and unsigned 32-bit types, so u32 literals come + // out as 'i32 -1'. Always treat those as max u32. + if (maxRange === -1) { + maxRange = 4294967295; + } + + var shift = getShiftFromSize(size); + + var fromWireType = (value) => value; + + if (minRange === 0) { + var bitshift = 32 - 8*size; + fromWireType = (value) => (value << bitshift) >>> bitshift; + } + + var isUnsignedType = (name.includes('unsigned')); + var checkAssertions = (value, toTypeName) => { + if (typeof value != "number" && typeof value != "boolean") { + throw new TypeError('Cannot convert "' + embindRepr(value) + '" to ' + toTypeName); + } + if (value < minRange || value > maxRange) { + throw new TypeError('Passing a number "' + embindRepr(value) + '" from JS side to C/C++ side to an argument of type "' + name + '", which is outside the valid range [' + minRange + ', ' + maxRange + ']!'); + } + } + var toWireType; + if (isUnsignedType) { + toWireType = function(destructors, value) { + checkAssertions(value, this.name); + return value >>> 0; + } + } else { + toWireType = function(destructors, value) { + checkAssertions(value, this.name); + // The VM will perform JS to Wasm value conversion, according to the spec: + // https://www.w3.org/TR/wasm-js-api-1/#towebassemblyvalue + return value; + } + } + registerType(primitiveType, { + name: name, + 'fromWireType': fromWireType, + 'toWireType': toWireType, + 'argPackAdvance': 8, + 'readValueFromPointer': integerReadValueFromPointer(name, shift, minRange !== 0), + destructorFunction: null, // This type does not need a destructor + }); + } + + + function __embind_register_memory_view(rawType, dataTypeIndex, name) { + var typeMapping = [ + Int8Array, + Uint8Array, + Int16Array, + Uint16Array, + Int32Array, + Uint32Array, + Float32Array, + Float64Array, + ]; + + var TA = typeMapping[dataTypeIndex]; + + function decodeMemoryView(handle) { + handle = handle >> 2; + var heap = HEAPU32; + var size = heap[handle]; // in elements + var data = heap[handle + 1]; // byte offset into emscripten heap + return new TA(heap.buffer, data, size); + } + + name = readLatin1String(name); + registerType(rawType, { + name: name, + 'fromWireType': decodeMemoryView, + 'argPackAdvance': 8, + 'readValueFromPointer': decodeMemoryView, + }, { + ignoreDuplicateRegistrations: true, + }); + } + + + + + function __embind_register_std_string(rawType, name) { + name = readLatin1String(name); + var stdStringIsUTF8 + //process only std::string bindings with UTF8 support, in contrast to e.g. std::basic_string + = (name === "std::string"); + + registerType(rawType, { + name: name, + 'fromWireType': function(value) { + var length = HEAPU32[((value)>>2)]; + var payload = value + 4; + + var str; + if (stdStringIsUTF8) { + var decodeStartPtr = payload; + // Looping here to support possible embedded '0' bytes + for (var i = 0; i <= length; ++i) { + var currentBytePtr = payload + i; + if (i == length || HEAPU8[currentBytePtr] == 0) { + var maxRead = currentBytePtr - decodeStartPtr; + var stringSegment = UTF8ToString(decodeStartPtr, maxRead); + if (str === undefined) { + str = stringSegment; + } else { + str += String.fromCharCode(0); + str += stringSegment; + } + decodeStartPtr = currentBytePtr + 1; + } + } + } else { + var a = new Array(length); + for (var i = 0; i < length; ++i) { + a[i] = String.fromCharCode(HEAPU8[payload + i]); + } + str = a.join(''); + } + + _free(value); + + return str; + }, + 'toWireType': function(destructors, value) { + if (value instanceof ArrayBuffer) { + value = new Uint8Array(value); + } + + var length; + var valueIsOfTypeString = (typeof value == 'string'); + + if (!(valueIsOfTypeString || value instanceof Uint8Array || value instanceof Uint8ClampedArray || value instanceof Int8Array)) { + throwBindingError('Cannot pass non-string to std::string'); + } + if (stdStringIsUTF8 && valueIsOfTypeString) { + length = lengthBytesUTF8(value); + } else { + length = value.length; + } + + // assumes 4-byte alignment + var base = _malloc(4 + length + 1); + var ptr = base + 4; + HEAPU32[((base)>>2)] = length; + if (stdStringIsUTF8 && valueIsOfTypeString) { + stringToUTF8(value, ptr, length + 1); + } else { + if (valueIsOfTypeString) { + for (var i = 0; i < length; ++i) { + var charCode = value.charCodeAt(i); + if (charCode > 255) { + _free(ptr); + throwBindingError('String has UTF-16 code units that do not fit in 8 bits'); + } + HEAPU8[ptr + i] = charCode; + } + } else { + for (var i = 0; i < length; ++i) { + HEAPU8[ptr + i] = value[i]; + } + } + } + + if (destructors !== null) { + destructors.push(_free, base); + } + return base; + }, + 'argPackAdvance': 8, + 'readValueFromPointer': simpleReadValueFromPointer, + destructorFunction: function(ptr) { _free(ptr); }, + }); + } + + + + + var UTF16Decoder = typeof TextDecoder != 'undefined' ? new TextDecoder('utf-16le') : undefined;; + function UTF16ToString(ptr, maxBytesToRead) { + assert(ptr % 2 == 0, 'Pointer passed to UTF16ToString must be aligned to two bytes!'); + var endPtr = ptr; + // TextDecoder needs to know the byte length in advance, it doesn't stop on + // null terminator by itself. + // Also, use the length info to avoid running tiny strings through + // TextDecoder, since .subarray() allocates garbage. + var idx = endPtr >> 1; + var maxIdx = idx + maxBytesToRead / 2; + // If maxBytesToRead is not passed explicitly, it will be undefined, and this + // will always evaluate to true. This saves on code size. + while (!(idx >= maxIdx) && HEAPU16[idx]) ++idx; + endPtr = idx << 1; + + if (endPtr - ptr > 32 && UTF16Decoder) + return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr)); + + // Fallback: decode without UTF16Decoder + var str = ''; + + // If maxBytesToRead is not passed explicitly, it will be undefined, and the + // for-loop's condition will always evaluate to true. The loop is then + // terminated on the first null char. + for (var i = 0; !(i >= maxBytesToRead / 2); ++i) { + var codeUnit = HEAP16[(((ptr)+(i*2))>>1)]; + if (codeUnit == 0) break; + // fromCharCode constructs a character from a UTF-16 code unit, so we can + // pass the UTF16 string right through. + str += String.fromCharCode(codeUnit); + } + + return str; + } + + function stringToUTF16(str, outPtr, maxBytesToWrite) { + assert(outPtr % 2 == 0, 'Pointer passed to stringToUTF16 must be aligned to two bytes!'); + assert(typeof maxBytesToWrite == 'number', 'stringToUTF16(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); + // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. + if (maxBytesToWrite === undefined) { + maxBytesToWrite = 0x7FFFFFFF; + } + if (maxBytesToWrite < 2) return 0; + maxBytesToWrite -= 2; // Null terminator. + var startPtr = outPtr; + var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length; + for (var i = 0; i < numCharsToWrite; ++i) { + // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP. + var codeUnit = str.charCodeAt(i); // possibly a lead surrogate + HEAP16[((outPtr)>>1)] = codeUnit; + outPtr += 2; + } + // Null-terminate the pointer to the HEAP. + HEAP16[((outPtr)>>1)] = 0; + return outPtr - startPtr; + } + + function lengthBytesUTF16(str) { + return str.length*2; + } + + function UTF32ToString(ptr, maxBytesToRead) { + assert(ptr % 4 == 0, 'Pointer passed to UTF32ToString must be aligned to four bytes!'); + var i = 0; + + var str = ''; + // If maxBytesToRead is not passed explicitly, it will be undefined, and this + // will always evaluate to true. This saves on code size. + while (!(i >= maxBytesToRead / 4)) { + var utf32 = HEAP32[(((ptr)+(i*4))>>2)]; + if (utf32 == 0) break; + ++i; + // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + if (utf32 >= 0x10000) { + var ch = utf32 - 0x10000; + str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); + } else { + str += String.fromCharCode(utf32); + } + } + return str; + } + + function stringToUTF32(str, outPtr, maxBytesToWrite) { + assert(outPtr % 4 == 0, 'Pointer passed to stringToUTF32 must be aligned to four bytes!'); + assert(typeof maxBytesToWrite == 'number', 'stringToUTF32(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); + // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. + if (maxBytesToWrite === undefined) { + maxBytesToWrite = 0x7FFFFFFF; + } + if (maxBytesToWrite < 4) return 0; + var startPtr = outPtr; + var endPtr = startPtr + maxBytesToWrite - 4; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var codeUnit = str.charCodeAt(i); // possibly a lead surrogate + if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) { + var trailSurrogate = str.charCodeAt(++i); + codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF); + } + HEAP32[((outPtr)>>2)] = codeUnit; + outPtr += 4; + if (outPtr + 4 > endPtr) break; + } + // Null-terminate the pointer to the HEAP. + HEAP32[((outPtr)>>2)] = 0; + return outPtr - startPtr; + } + + function lengthBytesUTF32(str) { + var len = 0; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var codeUnit = str.charCodeAt(i); + if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate. + len += 4; + } + + return len; + } + function __embind_register_std_wstring(rawType, charSize, name) { + name = readLatin1String(name); + var decodeString, encodeString, getHeap, lengthBytesUTF, shift; + if (charSize === 2) { + decodeString = UTF16ToString; + encodeString = stringToUTF16; + lengthBytesUTF = lengthBytesUTF16; + getHeap = () => HEAPU16; + shift = 1; + } else if (charSize === 4) { + decodeString = UTF32ToString; + encodeString = stringToUTF32; + lengthBytesUTF = lengthBytesUTF32; + getHeap = () => HEAPU32; + shift = 2; + } + registerType(rawType, { + name: name, + 'fromWireType': function(value) { + // Code mostly taken from _embind_register_std_string fromWireType + var length = HEAPU32[value >> 2]; + var HEAP = getHeap(); + var str; + + var decodeStartPtr = value + 4; + // Looping here to support possible embedded '0' bytes + for (var i = 0; i <= length; ++i) { + var currentBytePtr = value + 4 + i * charSize; + if (i == length || HEAP[currentBytePtr >> shift] == 0) { + var maxReadBytes = currentBytePtr - decodeStartPtr; + var stringSegment = decodeString(decodeStartPtr, maxReadBytes); + if (str === undefined) { + str = stringSegment; + } else { + str += String.fromCharCode(0); + str += stringSegment; + } + decodeStartPtr = currentBytePtr + charSize; + } + } + + _free(value); + + return str; + }, + 'toWireType': function(destructors, value) { + if (!(typeof value == 'string')) { + throwBindingError('Cannot pass non-string to C++ string type ' + name); + } + + // assumes 4-byte alignment + var length = lengthBytesUTF(value); + var ptr = _malloc(4 + length + charSize); + HEAPU32[ptr >> 2] = length >> shift; + + encodeString(value, ptr + 4, length + charSize); + + if (destructors !== null) { + destructors.push(_free, ptr); + } + return ptr; + }, + 'argPackAdvance': 8, + 'readValueFromPointer': simpleReadValueFromPointer, + destructorFunction: function(ptr) { _free(ptr); }, + }); + } + + + + function __embind_register_value_object( + rawType, + name, + constructorSignature, + rawConstructor, + destructorSignature, + rawDestructor + ) { + structRegistrations[rawType] = { + name: readLatin1String(name), + rawConstructor: embind__requireFunction(constructorSignature, rawConstructor), + rawDestructor: embind__requireFunction(destructorSignature, rawDestructor), + fields: [], + }; + } + + + + function __embind_register_value_object_field( + structType, + fieldName, + getterReturnType, + getterSignature, + getter, + getterContext, + setterArgumentType, + setterSignature, + setter, + setterContext + ) { + structRegistrations[structType].fields.push({ + fieldName: readLatin1String(fieldName), + getterReturnType: getterReturnType, + getter: embind__requireFunction(getterSignature, getter), + getterContext: getterContext, + setterArgumentType: setterArgumentType, + setter: embind__requireFunction(setterSignature, setter), + setterContext: setterContext, + }); + } + + + function __embind_register_void(rawType, name) { + name = readLatin1String(name); + registerType(rawType, { + isVoid: true, // void return values can be optimized out sometimes + name: name, + 'argPackAdvance': 0, + 'fromWireType': function() { + return undefined; + }, + 'toWireType': function(destructors, o) { + // TODO: assert if anything else is given? + return undefined; + }, + }); + } + + var nowIsMonotonic = true;; + function __emscripten_get_now_is_monotonic() { + return nowIsMonotonic; + } + + function __emscripten_throw_longjmp() { throw Infinity; } + + + function __emval_incref(handle) { + if (handle > 4) { + emval_handle_array[handle].refcount += 1; + } + } + + + + + function requireRegisteredType(rawType, humanName) { + var impl = registeredTypes[rawType]; + if (undefined === impl) { + throwBindingError(humanName + " has unknown type " + getTypeName(rawType)); + } + return impl; + } + function __emval_take_value(type, arg) { + type = requireRegisteredType(type, '_emval_take_value'); + var v = type['readValueFromPointer'](arg); + return Emval.toHandle(v); + } + + function readI53FromI64(ptr) { + return HEAPU32[ptr>>2] + HEAP32[ptr+4>>2] * 4294967296; + } + function __gmtime_js(time, tmPtr) { + var date = new Date(readI53FromI64(time)*1000); + HEAP32[((tmPtr)>>2)] = date.getUTCSeconds(); + HEAP32[(((tmPtr)+(4))>>2)] = date.getUTCMinutes(); + HEAP32[(((tmPtr)+(8))>>2)] = date.getUTCHours(); + HEAP32[(((tmPtr)+(12))>>2)] = date.getUTCDate(); + HEAP32[(((tmPtr)+(16))>>2)] = date.getUTCMonth(); + HEAP32[(((tmPtr)+(20))>>2)] = date.getUTCFullYear()-1900; + HEAP32[(((tmPtr)+(24))>>2)] = date.getUTCDay(); + var start = Date.UTC(date.getUTCFullYear(), 0, 1, 0, 0, 0, 0); + var yday = ((date.getTime() - start) / (1000 * 60 * 60 * 24))|0; + HEAP32[(((tmPtr)+(28))>>2)] = yday; + } + + + function __isLeapYear(year) { + return year%4 === 0 && (year%100 !== 0 || year%400 === 0); + } + + var __MONTH_DAYS_LEAP_CUMULATIVE = [0,31,60,91,121,152,182,213,244,274,305,335]; + + var __MONTH_DAYS_REGULAR_CUMULATIVE = [0,31,59,90,120,151,181,212,243,273,304,334]; + function __yday_from_date(date) { + var isLeapYear = __isLeapYear(date.getFullYear()); + var monthDaysCumulative = (isLeapYear ? __MONTH_DAYS_LEAP_CUMULATIVE : __MONTH_DAYS_REGULAR_CUMULATIVE); + var yday = monthDaysCumulative[date.getMonth()] + date.getDate() - 1; // -1 since it's days since Jan 1 + + return yday; + } + function __localtime_js(time, tmPtr) { + var date = new Date(readI53FromI64(time)*1000); + HEAP32[((tmPtr)>>2)] = date.getSeconds(); + HEAP32[(((tmPtr)+(4))>>2)] = date.getMinutes(); + HEAP32[(((tmPtr)+(8))>>2)] = date.getHours(); + HEAP32[(((tmPtr)+(12))>>2)] = date.getDate(); + HEAP32[(((tmPtr)+(16))>>2)] = date.getMonth(); + HEAP32[(((tmPtr)+(20))>>2)] = date.getFullYear()-1900; + HEAP32[(((tmPtr)+(24))>>2)] = date.getDay(); + + var yday = __yday_from_date(date)|0; + HEAP32[(((tmPtr)+(28))>>2)] = yday; + HEAP32[(((tmPtr)+(36))>>2)] = -(date.getTimezoneOffset() * 60); + + // Attention: DST is in December in South, and some regions don't have DST at all. + var start = new Date(date.getFullYear(), 0, 1); + var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset(); + var winterOffset = start.getTimezoneOffset(); + var dst = (summerOffset != winterOffset && date.getTimezoneOffset() == Math.min(winterOffset, summerOffset))|0; + HEAP32[(((tmPtr)+(32))>>2)] = dst; + } + + function __mktime_js(tmPtr) { + var date = new Date(HEAP32[(((tmPtr)+(20))>>2)] + 1900, + HEAP32[(((tmPtr)+(16))>>2)], + HEAP32[(((tmPtr)+(12))>>2)], + HEAP32[(((tmPtr)+(8))>>2)], + HEAP32[(((tmPtr)+(4))>>2)], + HEAP32[((tmPtr)>>2)], + 0); + + // There's an ambiguous hour when the time goes back; the tm_isdst field is + // used to disambiguate it. Date() basically guesses, so we fix it up if it + // guessed wrong, or fill in tm_isdst with the guess if it's -1. + var dst = HEAP32[(((tmPtr)+(32))>>2)]; + var guessedOffset = date.getTimezoneOffset(); + var start = new Date(date.getFullYear(), 0, 1); + var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset(); + var winterOffset = start.getTimezoneOffset(); + var dstOffset = Math.min(winterOffset, summerOffset); // DST is in December in South + if (dst < 0) { + // Attention: some regions don't have DST at all. + HEAP32[(((tmPtr)+(32))>>2)] = Number(summerOffset != winterOffset && dstOffset == guessedOffset); + } else if ((dst > 0) != (dstOffset == guessedOffset)) { + var nonDstOffset = Math.max(winterOffset, summerOffset); + var trueOffset = dst > 0 ? dstOffset : nonDstOffset; + // Don't try setMinutes(date.getMinutes() + ...) -- it's messed up. + date.setTime(date.getTime() + (trueOffset - guessedOffset)*60000); + } + + HEAP32[(((tmPtr)+(24))>>2)] = date.getDay(); + var yday = __yday_from_date(date)|0; + HEAP32[(((tmPtr)+(28))>>2)] = yday; + // To match expected behavior, update fields from date + HEAP32[((tmPtr)>>2)] = date.getSeconds(); + HEAP32[(((tmPtr)+(4))>>2)] = date.getMinutes(); + HEAP32[(((tmPtr)+(8))>>2)] = date.getHours(); + HEAP32[(((tmPtr)+(12))>>2)] = date.getDate(); + HEAP32[(((tmPtr)+(16))>>2)] = date.getMonth(); + HEAP32[(((tmPtr)+(20))>>2)] = date.getYear(); + + return (date.getTime() / 1000)|0; + } + + + + function __mmap_js(len, prot, flags, fd, off, allocated, addr) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + var res = FS.mmap(stream, len, off, prot, flags); + var ptr = res.ptr; + HEAP32[((allocated)>>2)] = res.allocated; + HEAPU32[((addr)>>2)] = ptr; + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + + + function __munmap_js(addr, len, prot, flags, fd, offset) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + if (prot & 2) { + SYSCALLS.doMsync(addr, stream, len, flags, offset); + } + FS.munmap(stream); + // implicitly return 0 + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function allocateUTF8(str) { + var size = lengthBytesUTF8(str) + 1; + var ret = _malloc(size); + if (ret) stringToUTF8Array(str, HEAP8, ret, size); + return ret; + } + function __tzset_js(timezone, daylight, tzname) { + // TODO: Use (malleable) environment variables instead of system settings. + var currentYear = new Date().getFullYear(); + var winter = new Date(currentYear, 0, 1); + var summer = new Date(currentYear, 6, 1); + var winterOffset = winter.getTimezoneOffset(); + var summerOffset = summer.getTimezoneOffset(); + + // Local standard timezone offset. Local standard time is not adjusted for daylight savings. + // This code uses the fact that getTimezoneOffset returns a greater value during Standard Time versus Daylight Saving Time (DST). + // Thus it determines the expected output during Standard Time, and it compares whether the output of the given date the same (Standard) or less (DST). + var stdTimezoneOffset = Math.max(winterOffset, summerOffset); + + // timezone is specified as seconds west of UTC ("The external variable + // `timezone` shall be set to the difference, in seconds, between + // Coordinated Universal Time (UTC) and local standard time."), the same + // as returned by stdTimezoneOffset. + // See http://pubs.opengroup.org/onlinepubs/009695399/functions/tzset.html + HEAPU32[((timezone)>>2)] = stdTimezoneOffset * 60; + + HEAP32[((daylight)>>2)] = Number(winterOffset != summerOffset); + + function extractZone(date) { + var match = date.toTimeString().match(/\(([A-Za-z ]+)\)$/); + return match ? match[1] : "GMT"; + }; + var winterName = extractZone(winter); + var summerName = extractZone(summer); + var winterNamePtr = allocateUTF8(winterName); + var summerNamePtr = allocateUTF8(summerName); + if (summerOffset < winterOffset) { + // Northern hemisphere + HEAPU32[((tzname)>>2)] = winterNamePtr; + HEAPU32[(((tzname)+(4))>>2)] = summerNamePtr; + } else { + HEAPU32[((tzname)>>2)] = summerNamePtr; + HEAPU32[(((tzname)+(4))>>2)] = winterNamePtr; + } + } + + function _abort() { + abort('native code called abort()'); + } + + function _emscripten_console_error(str) { + assert(typeof str == 'number'); + console.error(UTF8ToString(str)); + } + + function _emscripten_date_now() { + return Date.now(); + } + + function getHeapMax() { + // Stay one Wasm page short of 4GB: while e.g. Chrome is able to allocate + // full 4GB Wasm memories, the size will wrap back to 0 bytes in Wasm side + // for any code that deals with heap sizes, which would require special + // casing all heap size related code to treat 0 specially. + return 2147483648; + } + function _emscripten_get_heap_max() { + return getHeapMax(); + } + + var _emscripten_get_now;if (ENVIRONMENT_IS_NODE) { + _emscripten_get_now = () => { + var t = process['hrtime'](); + return t[0] * 1e3 + t[1] / 1e6; + }; + } else _emscripten_get_now = () => performance.now(); + ; + + function _emscripten_memcpy_big(dest, src, num) { + HEAPU8.copyWithin(dest, src, src + num); + } + + + function emscripten_realloc_buffer(size) { + var b = wasmMemory.buffer; + try { + // round size grow request up to wasm page size (fixed 64KB per spec) + wasmMemory.grow((size - b.byteLength + 65535) >>> 16); // .grow() takes a delta compared to the previous size + updateMemoryViews(); + return 1 /*success*/; + } catch(e) { + err('emscripten_realloc_buffer: Attempted to grow heap from ' + b.byteLength + ' bytes to ' + size + ' bytes, but got error: ' + e); + } + // implicit 0 return to save code size (caller will cast "undefined" into 0 + // anyhow) + } + function _emscripten_resize_heap(requestedSize) { + var oldSize = HEAPU8.length; + requestedSize = requestedSize >>> 0; + // With multithreaded builds, races can happen (another thread might increase the size + // in between), so return a failure, and let the caller retry. + assert(requestedSize > oldSize); + + // Memory resize rules: + // 1. Always increase heap size to at least the requested size, rounded up + // to next page multiple. + // 2a. If MEMORY_GROWTH_LINEAR_STEP == -1, excessively resize the heap + // geometrically: increase the heap size according to + // MEMORY_GROWTH_GEOMETRIC_STEP factor (default +20%), At most + // overreserve by MEMORY_GROWTH_GEOMETRIC_CAP bytes (default 96MB). + // 2b. If MEMORY_GROWTH_LINEAR_STEP != -1, excessively resize the heap + // linearly: increase the heap size by at least + // MEMORY_GROWTH_LINEAR_STEP bytes. + // 3. Max size for the heap is capped at 2048MB-WASM_PAGE_SIZE, or by + // MAXIMUM_MEMORY, or by ASAN limit, depending on which is smallest + // 4. If we were unable to allocate as much memory, it may be due to + // over-eager decision to excessively reserve due to (3) above. + // Hence if an allocation fails, cut down on the amount of excess + // growth, in an attempt to succeed to perform a smaller allocation. + + // A limit is set for how much we can grow. We should not exceed that + // (the wasm binary specifies it, so if we tried, we'd fail anyhow). + var maxHeapSize = getHeapMax(); + if (requestedSize > maxHeapSize) { + err('Cannot enlarge memory, asked to go up to ' + requestedSize + ' bytes, but the limit is ' + maxHeapSize + ' bytes!'); + return false; + } + + let alignUp = (x, multiple) => x + (multiple - x % multiple) % multiple; + + // Loop through potential heap size increases. If we attempt a too eager + // reservation that fails, cut down on the attempted size and reserve a + // smaller bump instead. (max 3 times, chosen somewhat arbitrarily) + for (var cutDown = 1; cutDown <= 4; cutDown *= 2) { + var overGrownHeapSize = oldSize * (1 + 0.2 / cutDown); // ensure geometric growth + // but limit overreserving (default to capping at +96MB overgrowth at most) + overGrownHeapSize = Math.min(overGrownHeapSize, requestedSize + 100663296 ); + + var newSize = Math.min(maxHeapSize, alignUp(Math.max(requestedSize, overGrownHeapSize), 65536)); + + var replacement = emscripten_realloc_buffer(newSize); + if (replacement) { + + return true; + } + } + err('Failed to grow the heap from ' + oldSize + ' bytes to ' + newSize + ' bytes, not enough memory!'); + return false; + } + + var ENV = {}; + + function getExecutableName() { + return thisProgram || './this.program'; + } + function getEnvStrings() { + if (!getEnvStrings.strings) { + // Default values. + // Browser language detection #8751 + var lang = ((typeof navigator == 'object' && navigator.languages && navigator.languages[0]) || 'C').replace('-', '_') + '.UTF-8'; + var env = { + 'USER': 'web_user', + 'LOGNAME': 'web_user', + 'PATH': '/', + 'PWD': '/', + 'HOME': '/home/web_user', + 'LANG': lang, + '_': getExecutableName() + }; + // Apply the user-provided values, if any. + for (var x in ENV) { + // x is a key in ENV; if ENV[x] is undefined, that means it was + // explicitly set to be so. We allow user code to do that to + // force variables with default values to remain unset. + if (ENV[x] === undefined) delete env[x]; + else env[x] = ENV[x]; + } + var strings = []; + for (var x in env) { + strings.push(x + '=' + env[x]); + } + getEnvStrings.strings = strings; + } + return getEnvStrings.strings; + } + + /** @param {boolean=} dontAddNull */ + function writeAsciiToMemory(str, buffer, dontAddNull) { + for (var i = 0; i < str.length; ++i) { + assert(str.charCodeAt(i) === (str.charCodeAt(i) & 0xff)); + HEAP8[((buffer++)>>0)] = str.charCodeAt(i); + } + // Null-terminate the pointer to the HEAP. + if (!dontAddNull) HEAP8[((buffer)>>0)] = 0; + } + + function _environ_get(__environ, environ_buf) { + var bufSize = 0; + getEnvStrings().forEach(function(string, i) { + var ptr = environ_buf + bufSize; + HEAPU32[(((__environ)+(i*4))>>2)] = ptr; + writeAsciiToMemory(string, ptr); + bufSize += string.length + 1; + }); + return 0; + } + + + function _environ_sizes_get(penviron_count, penviron_buf_size) { + var strings = getEnvStrings(); + HEAPU32[((penviron_count)>>2)] = strings.length; + var bufSize = 0; + strings.forEach(function(string) { + bufSize += string.length + 1; + }); + HEAPU32[((penviron_buf_size)>>2)] = bufSize; + return 0; + } + + + function _proc_exit(code) { + EXITSTATUS = code; + if (!keepRuntimeAlive()) { + if (Module['onExit']) Module['onExit'](code); + ABORT = true; + } + quit_(code, new ExitStatus(code)); + } + /** @param {boolean|number=} implicit */ + function exitJS(status, implicit) { + EXITSTATUS = status; + + checkUnflushedContent(); + + // if exit() was called explicitly, warn the user if the runtime isn't actually being shut down + if (keepRuntimeAlive() && !implicit) { + var msg = 'program exited (with status: ' + status + '), but EXIT_RUNTIME is not set, so halting execution but not exiting the runtime or preventing further async execution (build with EXIT_RUNTIME=1, if you want a true shutdown)'; + readyPromiseReject(msg); + err(msg); + } + + _proc_exit(status); + } + var _exit = exitJS; + + function _fd_close(fd) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + FS.close(stream); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return e.errno; + } + } + + function _fd_fdstat_get(fd, pbuf) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + // All character devices are terminals (other things a Linux system would + // assume is a character device, like the mouse, we have special APIs for). + var type = stream.tty ? 2 : + FS.isDir(stream.mode) ? 3 : + FS.isLink(stream.mode) ? 7 : + 4; + HEAP8[((pbuf)>>0)] = type; + // TODO HEAP16[(((pbuf)+(2))>>1)] = ?; + // TODO (tempI64 = [?>>>0,(tempDouble=?,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((pbuf)+(8))>>2)] = tempI64[0],HEAP32[(((pbuf)+(12))>>2)] = tempI64[1]); + // TODO (tempI64 = [?>>>0,(tempDouble=?,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((pbuf)+(16))>>2)] = tempI64[0],HEAP32[(((pbuf)+(20))>>2)] = tempI64[1]); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return e.errno; + } + } + + /** @param {number=} offset */ + function doReadv(stream, iov, iovcnt, offset) { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAPU32[((iov)>>2)]; + var len = HEAPU32[(((iov)+(4))>>2)]; + iov += 8; + var curr = FS.read(stream, HEAP8,ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + if (curr < len) break; // nothing more to read + if (typeof offset !== 'undefined') { + offset += curr; + } + } + return ret; + } + + function _fd_read(fd, iov, iovcnt, pnum) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + var num = doReadv(stream, iov, iovcnt); + HEAPU32[((pnum)>>2)] = num; + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return e.errno; + } + } + + + + + + function _fd_seek(fd, offset_low, offset_high, whence, newOffset) { + try { + + var offset = convertI32PairToI53Checked(offset_low, offset_high); if (isNaN(offset)) return 61; + var stream = SYSCALLS.getStreamFromFD(fd); + FS.llseek(stream, offset, whence); + (tempI64 = [stream.position>>>0,(tempDouble=stream.position,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((newOffset)>>2)] = tempI64[0],HEAP32[(((newOffset)+(4))>>2)] = tempI64[1]); + if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return e.errno; + } + } + + function _fd_sync(fd) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + if (stream.stream_ops && stream.stream_ops.fsync) { + return stream.stream_ops.fsync(stream); + } + return 0; // we can't do anything synchronously; the in-memory FS is already synced to + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return e.errno; + } + } + + /** @param {number=} offset */ + function doWritev(stream, iov, iovcnt, offset) { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAPU32[((iov)>>2)]; + var len = HEAPU32[(((iov)+(4))>>2)]; + iov += 8; + var curr = FS.write(stream, HEAP8,ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + if (typeof offset !== 'undefined') { + offset += curr; + } + } + return ret; + } + + function _fd_write(fd, iov, iovcnt, pnum) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + var num = doWritev(stream, iov, iovcnt); + HEAPU32[((pnum)>>2)] = num; + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return e.errno; + } + } + + function _getentropy(buffer, size) { + if (!_getentropy.randomDevice) { + _getentropy.randomDevice = getRandomDevice(); + } + for (var i = 0; i < size; i++) { + HEAP8[(((buffer)+(i))>>0)] = _getentropy.randomDevice(); + } + return 0; + } + + function _on_status(type, str_ptr) { + Module.handleStatus(type, UTF8ToString(str_ptr)); + } + + + + function __arraySum(array, index) { + var sum = 0; + for (var i = 0; i <= index; sum += array[i++]) { + // no-op + } + return sum; + } + + + var __MONTH_DAYS_LEAP = [31,29,31,30,31,30,31,31,30,31,30,31]; + + var __MONTH_DAYS_REGULAR = [31,28,31,30,31,30,31,31,30,31,30,31]; + function __addDays(date, days) { + var newDate = new Date(date.getTime()); + while (days > 0) { + var leap = __isLeapYear(newDate.getFullYear()); + var currentMonth = newDate.getMonth(); + var daysInCurrentMonth = (leap ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR)[currentMonth]; + + if (days > daysInCurrentMonth-newDate.getDate()) { + // we spill over to next month + days -= (daysInCurrentMonth-newDate.getDate()+1); + newDate.setDate(1); + if (currentMonth < 11) { + newDate.setMonth(currentMonth+1) + } else { + newDate.setMonth(0); + newDate.setFullYear(newDate.getFullYear()+1); + } + } else { + // we stay in current month + newDate.setDate(newDate.getDate()+days); + return newDate; + } + } + + return newDate; + } + + + + + function writeArrayToMemory(array, buffer) { + assert(array.length >= 0, 'writeArrayToMemory array must have a length (should be an array or typed array)') + HEAP8.set(array, buffer); + } + function _strftime(s, maxsize, format, tm) { + // size_t strftime(char *restrict s, size_t maxsize, const char *restrict format, const struct tm *restrict timeptr); + // http://pubs.opengroup.org/onlinepubs/009695399/functions/strftime.html + + var tm_zone = HEAP32[(((tm)+(40))>>2)]; + + var date = { + tm_sec: HEAP32[((tm)>>2)], + tm_min: HEAP32[(((tm)+(4))>>2)], + tm_hour: HEAP32[(((tm)+(8))>>2)], + tm_mday: HEAP32[(((tm)+(12))>>2)], + tm_mon: HEAP32[(((tm)+(16))>>2)], + tm_year: HEAP32[(((tm)+(20))>>2)], + tm_wday: HEAP32[(((tm)+(24))>>2)], + tm_yday: HEAP32[(((tm)+(28))>>2)], + tm_isdst: HEAP32[(((tm)+(32))>>2)], + tm_gmtoff: HEAP32[(((tm)+(36))>>2)], + tm_zone: tm_zone ? UTF8ToString(tm_zone) : '' + }; + + var pattern = UTF8ToString(format); + + // expand format + var EXPANSION_RULES_1 = { + '%c': '%a %b %d %H:%M:%S %Y', // Replaced by the locale's appropriate date and time representation - e.g., Mon Aug 3 14:02:01 2013 + '%D': '%m/%d/%y', // Equivalent to %m / %d / %y + '%F': '%Y-%m-%d', // Equivalent to %Y - %m - %d + '%h': '%b', // Equivalent to %b + '%r': '%I:%M:%S %p', // Replaced by the time in a.m. and p.m. notation + '%R': '%H:%M', // Replaced by the time in 24-hour notation + '%T': '%H:%M:%S', // Replaced by the time + '%x': '%m/%d/%y', // Replaced by the locale's appropriate date representation + '%X': '%H:%M:%S', // Replaced by the locale's appropriate time representation + // Modified Conversion Specifiers + '%Ec': '%c', // Replaced by the locale's alternative appropriate date and time representation. + '%EC': '%C', // Replaced by the name of the base year (period) in the locale's alternative representation. + '%Ex': '%m/%d/%y', // Replaced by the locale's alternative date representation. + '%EX': '%H:%M:%S', // Replaced by the locale's alternative time representation. + '%Ey': '%y', // Replaced by the offset from %EC (year only) in the locale's alternative representation. + '%EY': '%Y', // Replaced by the full alternative year representation. + '%Od': '%d', // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading zeros if there is any alternative symbol for zero; otherwise, with leading characters. + '%Oe': '%e', // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading characters. + '%OH': '%H', // Replaced by the hour (24-hour clock) using the locale's alternative numeric symbols. + '%OI': '%I', // Replaced by the hour (12-hour clock) using the locale's alternative numeric symbols. + '%Om': '%m', // Replaced by the month using the locale's alternative numeric symbols. + '%OM': '%M', // Replaced by the minutes using the locale's alternative numeric symbols. + '%OS': '%S', // Replaced by the seconds using the locale's alternative numeric symbols. + '%Ou': '%u', // Replaced by the weekday as a number in the locale's alternative representation (Monday=1). + '%OU': '%U', // Replaced by the week number of the year (Sunday as the first day of the week, rules corresponding to %U ) using the locale's alternative numeric symbols. + '%OV': '%V', // Replaced by the week number of the year (Monday as the first day of the week, rules corresponding to %V ) using the locale's alternative numeric symbols. + '%Ow': '%w', // Replaced by the number of the weekday (Sunday=0) using the locale's alternative numeric symbols. + '%OW': '%W', // Replaced by the week number of the year (Monday as the first day of the week) using the locale's alternative numeric symbols. + '%Oy': '%y', // Replaced by the year (offset from %C ) using the locale's alternative numeric symbols. + }; + for (var rule in EXPANSION_RULES_1) { + pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_1[rule]); + } + + var WEEKDAYS = ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday']; + var MONTHS = ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December']; + + function leadingSomething(value, digits, character) { + var str = typeof value == 'number' ? value.toString() : (value || ''); + while (str.length < digits) { + str = character[0]+str; + } + return str; + } + + function leadingNulls(value, digits) { + return leadingSomething(value, digits, '0'); + } + + function compareByDay(date1, date2) { + function sgn(value) { + return value < 0 ? -1 : (value > 0 ? 1 : 0); + } + + var compare; + if ((compare = sgn(date1.getFullYear()-date2.getFullYear())) === 0) { + if ((compare = sgn(date1.getMonth()-date2.getMonth())) === 0) { + compare = sgn(date1.getDate()-date2.getDate()); + } + } + return compare; + } + + function getFirstWeekStartDate(janFourth) { + switch (janFourth.getDay()) { + case 0: // Sunday + return new Date(janFourth.getFullYear()-1, 11, 29); + case 1: // Monday + return janFourth; + case 2: // Tuesday + return new Date(janFourth.getFullYear(), 0, 3); + case 3: // Wednesday + return new Date(janFourth.getFullYear(), 0, 2); + case 4: // Thursday + return new Date(janFourth.getFullYear(), 0, 1); + case 5: // Friday + return new Date(janFourth.getFullYear()-1, 11, 31); + case 6: // Saturday + return new Date(janFourth.getFullYear()-1, 11, 30); + } + } + + function getWeekBasedYear(date) { + var thisDate = __addDays(new Date(date.tm_year+1900, 0, 1), date.tm_yday); + + var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4); + var janFourthNextYear = new Date(thisDate.getFullYear()+1, 0, 4); + + var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear); + var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear); + + if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) { + // this date is after the start of the first week of this year + if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) { + return thisDate.getFullYear()+1; + } + return thisDate.getFullYear(); + } + return thisDate.getFullYear()-1; + } + + var EXPANSION_RULES_2 = { + '%a': function(date) { + return WEEKDAYS[date.tm_wday].substring(0,3); + }, + '%A': function(date) { + return WEEKDAYS[date.tm_wday]; + }, + '%b': function(date) { + return MONTHS[date.tm_mon].substring(0,3); + }, + '%B': function(date) { + return MONTHS[date.tm_mon]; + }, + '%C': function(date) { + var year = date.tm_year+1900; + return leadingNulls((year/100)|0,2); + }, + '%d': function(date) { + return leadingNulls(date.tm_mday, 2); + }, + '%e': function(date) { + return leadingSomething(date.tm_mday, 2, ' '); + }, + '%g': function(date) { + // %g, %G, and %V give values according to the ISO 8601:2000 standard week-based year. + // In this system, weeks begin on a Monday and week 1 of the year is the week that includes + // January 4th, which is also the week that includes the first Thursday of the year, and + // is also the first week that contains at least four days in the year. + // If the first Monday of January is the 2nd, 3rd, or 4th, the preceding days are part of + // the last week of the preceding year; thus, for Saturday 2nd January 1999, + // %G is replaced by 1998 and %V is replaced by 53. If December 29th, 30th, + // or 31st is a Monday, it and any following days are part of week 1 of the following year. + // Thus, for Tuesday 30th December 1997, %G is replaced by 1998 and %V is replaced by 01. + + return getWeekBasedYear(date).toString().substring(2); + }, + '%G': function(date) { + return getWeekBasedYear(date); + }, + '%H': function(date) { + return leadingNulls(date.tm_hour, 2); + }, + '%I': function(date) { + var twelveHour = date.tm_hour; + if (twelveHour == 0) twelveHour = 12; + else if (twelveHour > 12) twelveHour -= 12; + return leadingNulls(twelveHour, 2); + }, + '%j': function(date) { + // Day of the year (001-366) + return leadingNulls(date.tm_mday+__arraySum(__isLeapYear(date.tm_year+1900) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, date.tm_mon-1), 3); + }, + '%m': function(date) { + return leadingNulls(date.tm_mon+1, 2); + }, + '%M': function(date) { + return leadingNulls(date.tm_min, 2); + }, + '%n': function() { + return '\n'; + }, + '%p': function(date) { + if (date.tm_hour >= 0 && date.tm_hour < 12) { + return 'AM'; + } + return 'PM'; + }, + '%S': function(date) { + return leadingNulls(date.tm_sec, 2); + }, + '%t': function() { + return '\t'; + }, + '%u': function(date) { + return date.tm_wday || 7; + }, + '%U': function(date) { + var days = date.tm_yday + 7 - date.tm_wday; + return leadingNulls(Math.floor(days / 7), 2); + }, + '%V': function(date) { + // Replaced by the week number of the year (Monday as the first day of the week) + // as a decimal number [01,53]. If the week containing 1 January has four + // or more days in the new year, then it is considered week 1. + // Otherwise, it is the last week of the previous year, and the next week is week 1. + // Both January 4th and the first Thursday of January are always in week 1. [ tm_year, tm_wday, tm_yday] + var val = Math.floor((date.tm_yday + 7 - (date.tm_wday + 6) % 7 ) / 7); + // If 1 Jan is just 1-3 days past Monday, the previous week + // is also in this year. + if ((date.tm_wday + 371 - date.tm_yday - 2) % 7 <= 2) { + val++; + } + if (!val) { + val = 52; + // If 31 December of prev year a Thursday, or Friday of a + // leap year, then the prev year has 53 weeks. + var dec31 = (date.tm_wday + 7 - date.tm_yday - 1) % 7; + if (dec31 == 4 || (dec31 == 5 && __isLeapYear(date.tm_year%400-1))) { + val++; + } + } else if (val == 53) { + // If 1 January is not a Thursday, and not a Wednesday of a + // leap year, then this year has only 52 weeks. + var jan1 = (date.tm_wday + 371 - date.tm_yday) % 7; + if (jan1 != 4 && (jan1 != 3 || !__isLeapYear(date.tm_year))) + val = 1; + } + return leadingNulls(val, 2); + }, + '%w': function(date) { + return date.tm_wday; + }, + '%W': function(date) { + var days = date.tm_yday + 7 - ((date.tm_wday + 6) % 7); + return leadingNulls(Math.floor(days / 7), 2); + }, + '%y': function(date) { + // Replaced by the last two digits of the year as a decimal number [00,99]. [ tm_year] + return (date.tm_year+1900).toString().substring(2); + }, + '%Y': function(date) { + // Replaced by the year as a decimal number (for example, 1997). [ tm_year] + return date.tm_year+1900; + }, + '%z': function(date) { + // Replaced by the offset from UTC in the ISO 8601:2000 standard format ( +hhmm or -hhmm ). + // For example, "-0430" means 4 hours 30 minutes behind UTC (west of Greenwich). + var off = date.tm_gmtoff; + var ahead = off >= 0; + off = Math.abs(off) / 60; + // convert from minutes into hhmm format (which means 60 minutes = 100 units) + off = (off / 60)*100 + (off % 60); + return (ahead ? '+' : '-') + String("0000" + off).slice(-4); + }, + '%Z': function(date) { + return date.tm_zone; + }, + '%%': function() { + return '%'; + } + }; + + // Replace %% with a pair of NULLs (which cannot occur in a C string), then + // re-inject them after processing. + pattern = pattern.replace(/%%/g, '\0\0') + for (var rule in EXPANSION_RULES_2) { + if (pattern.includes(rule)) { + pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_2[rule](date)); + } + } + pattern = pattern.replace(/\0\0/g, '%') + + var bytes = intArrayFromString(pattern, false); + if (bytes.length > maxsize) { + return 0; + } + + writeArrayToMemory(bytes, s); + return bytes.length-1; + } + + + + + + + + function _strptime(buf, format, tm) { + // char *strptime(const char *restrict buf, const char *restrict format, struct tm *restrict tm); + // http://pubs.opengroup.org/onlinepubs/009695399/functions/strptime.html + var pattern = UTF8ToString(format); + + // escape special characters + // TODO: not sure we really need to escape all of these in JS regexps + var SPECIAL_CHARS = '\\!@#$^&*()+=-[]/{}|:<>?,.'; + for (var i=0, ii=SPECIAL_CHARS.length; i=0; i=pattern.indexOf('%')) { + capture.push(pattern[i+1]); + pattern = pattern.replace(new RegExp('\\%'+pattern[i+1], 'g'), ''); + } + + var matches = new RegExp('^'+pattern, "i").exec(UTF8ToString(buf)) + // out(UTF8ToString(buf)+ ' is matched by '+((new RegExp('^'+pattern)).source)+' into: '+JSON.stringify(matches)); + + function initDate() { + function fixup(value, min, max) { + return (typeof value != 'number' || isNaN(value)) ? min : (value>=min ? (value<=max ? value: max): min); + }; + return { + year: fixup(HEAP32[(((tm)+(20))>>2)] + 1900 , 1970, 9999), + month: fixup(HEAP32[(((tm)+(16))>>2)], 0, 11), + day: fixup(HEAP32[(((tm)+(12))>>2)], 1, 31), + hour: fixup(HEAP32[(((tm)+(8))>>2)], 0, 23), + min: fixup(HEAP32[(((tm)+(4))>>2)], 0, 59), + sec: fixup(HEAP32[((tm)>>2)], 0, 59) + }; + }; + + if (matches) { + var date = initDate(); + var value; + + var getMatch = (symbol) => { + var pos = capture.indexOf(symbol); + // check if symbol appears in regexp + if (pos >= 0) { + // return matched value or null (falsy!) for non-matches + return matches[pos+1]; + } + return; + }; + + // seconds + if ((value=getMatch('S'))) { + date.sec = jstoi_q(value); + } + + // minutes + if ((value=getMatch('M'))) { + date.min = jstoi_q(value); + } + + // hours + if ((value=getMatch('H'))) { + // 24h clock + date.hour = jstoi_q(value); + } else if ((value = getMatch('I'))) { + // AM/PM clock + var hour = jstoi_q(value); + if ((value=getMatch('p'))) { + hour += value.toUpperCase()[0] === 'P' ? 12 : 0; + } + date.hour = hour; + } + + // year + if ((value=getMatch('Y'))) { + // parse from four-digit year + date.year = jstoi_q(value); + } else if ((value=getMatch('y'))) { + // parse from two-digit year... + var year = jstoi_q(value); + if ((value=getMatch('C'))) { + // ...and century + year += jstoi_q(value)*100; + } else { + // ...and rule-of-thumb + year += year<69 ? 2000 : 1900; + } + date.year = year; + } + + // month + if ((value=getMatch('m'))) { + // parse from month number + date.month = jstoi_q(value)-1; + } else if ((value=getMatch('b'))) { + // parse from month name + date.month = MONTH_NUMBERS[value.substring(0,3).toUpperCase()] || 0; + // TODO: derive month from day in year+year, week number+day of week+year + } + + // day + if ((value=getMatch('d'))) { + // get day of month directly + date.day = jstoi_q(value); + } else if ((value=getMatch('j'))) { + // get day of month from day of year ... + var day = jstoi_q(value); + var leapYear = __isLeapYear(date.year); + for (var month=0; month<12; ++month) { + var daysUntilMonth = __arraySum(leapYear ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, month-1); + if (day<=daysUntilMonth+(leapYear ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR)[month]) { + date.day = day-daysUntilMonth; + } + } + } else if ((value=getMatch('a'))) { + // get day of month from weekday ... + var weekDay = value.substring(0,3).toUpperCase(); + if ((value=getMatch('U'))) { + // ... and week number (Sunday being first day of week) + // Week number of the year (Sunday as the first day of the week) as a decimal number [00,53]. + // All days in a new year preceding the first Sunday are considered to be in week 0. + var weekDayNumber = DAY_NUMBERS_SUN_FIRST[weekDay]; + var weekNumber = jstoi_q(value); + + // January 1st + var janFirst = new Date(date.year, 0, 1); + var endDate; + if (janFirst.getDay() === 0) { + // Jan 1st is a Sunday, and, hence in the 1st CW + endDate = __addDays(janFirst, weekDayNumber+7*(weekNumber-1)); + } else { + // Jan 1st is not a Sunday, and, hence still in the 0th CW + endDate = __addDays(janFirst, 7-janFirst.getDay()+weekDayNumber+7*(weekNumber-1)); + } + date.day = endDate.getDate(); + date.month = endDate.getMonth(); + } else if ((value=getMatch('W'))) { + // ... and week number (Monday being first day of week) + // Week number of the year (Monday as the first day of the week) as a decimal number [00,53]. + // All days in a new year preceding the first Monday are considered to be in week 0. + var weekDayNumber = DAY_NUMBERS_MON_FIRST[weekDay]; + var weekNumber = jstoi_q(value); + + // January 1st + var janFirst = new Date(date.year, 0, 1); + var endDate; + if (janFirst.getDay()===1) { + // Jan 1st is a Monday, and, hence in the 1st CW + endDate = __addDays(janFirst, weekDayNumber+7*(weekNumber-1)); + } else { + // Jan 1st is not a Monday, and, hence still in the 0th CW + endDate = __addDays(janFirst, 7-janFirst.getDay()+1+weekDayNumber+7*(weekNumber-1)); + } + + date.day = endDate.getDate(); + date.month = endDate.getMonth(); + } + } + + /* + tm_sec int seconds after the minute 0-61* + tm_min int minutes after the hour 0-59 + tm_hour int hours since midnight 0-23 + tm_mday int day of the month 1-31 + tm_mon int months since January 0-11 + tm_year int years since 1900 + tm_wday int days since Sunday 0-6 + tm_yday int days since January 1 0-365 + tm_isdst int Daylight Saving Time flag + */ + + var fullDate = new Date(date.year, date.month, date.day, date.hour, date.min, date.sec, 0); + HEAP32[((tm)>>2)] = fullDate.getSeconds(); + HEAP32[(((tm)+(4))>>2)] = fullDate.getMinutes(); + HEAP32[(((tm)+(8))>>2)] = fullDate.getHours(); + HEAP32[(((tm)+(12))>>2)] = fullDate.getDate(); + HEAP32[(((tm)+(16))>>2)] = fullDate.getMonth(); + HEAP32[(((tm)+(20))>>2)] = fullDate.getFullYear()-1900; + HEAP32[(((tm)+(24))>>2)] = fullDate.getDay(); + HEAP32[(((tm)+(28))>>2)] = __arraySum(__isLeapYear(fullDate.getFullYear()) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, fullDate.getMonth()-1)+fullDate.getDate()-1; + HEAP32[(((tm)+(32))>>2)] = 0; + + // we need to convert the matched sequence into an integer array to take care of UTF-8 characters > 0x7F + // TODO: not sure that intArrayFromString handles all unicode characters correctly + return buf+intArrayFromString(matches[0]).length-1; + } + + return 0; + } + + function _system(command) { + if (ENVIRONMENT_IS_NODE) { + if (!command) return 1; // shell is available + + var cmdstr = UTF8ToString(command); + if (!cmdstr.length) return 0; // this is what glibc seems to do (shell works test?) + + var cp = require('child_process'); + var ret = cp.spawnSync(cmdstr, [], {shell:true, stdio:'inherit'}); + + var _W_EXITCODE = (ret, sig) => ((ret) << 8 | (sig)); + + // this really only can happen if process is killed by signal + if (ret.status === null) { + // sadly node doesn't expose such function + var signalToNumber = (sig) => { + // implement only the most common ones, and fallback to SIGINT + switch (sig) { + case 'SIGHUP': return 1; + case 'SIGINT': return 2; + case 'SIGQUIT': return 3; + case 'SIGFPE': return 8; + case 'SIGKILL': return 9; + case 'SIGALRM': return 14; + case 'SIGTERM': return 15; + } + return 2; // SIGINT + } + return _W_EXITCODE(0, signalToNumber(ret.signal)); + } + + return _W_EXITCODE(ret.status, 0); + } + // int system(const char *command); + // http://pubs.opengroup.org/onlinepubs/000095399/functions/system.html + // Can't call external programs. + if (!command) return 0; // no shell available + setErrNo(52); + return -1; + } + + + + + var FSNode = /** @constructor */ function(parent, name, mode, rdev) { + if (!parent) { + parent = this; // root node sets parent to itself + } + this.parent = parent; + this.mount = parent.mount; + this.mounted = null; + this.id = FS.nextInode++; + this.name = name; + this.mode = mode; + this.node_ops = {}; + this.stream_ops = {}; + this.rdev = rdev; + }; + var readMode = 292/*292*/ | 73/*73*/; + var writeMode = 146/*146*/; + Object.defineProperties(FSNode.prototype, { + read: { + get: /** @this{FSNode} */function() { + return (this.mode & readMode) === readMode; + }, + set: /** @this{FSNode} */function(val) { + val ? this.mode |= readMode : this.mode &= ~readMode; + } + }, + write: { + get: /** @this{FSNode} */function() { + return (this.mode & writeMode) === writeMode; + }, + set: /** @this{FSNode} */function(val) { + val ? this.mode |= writeMode : this.mode &= ~writeMode; + } + }, + isFolder: { + get: /** @this{FSNode} */function() { + return FS.isDir(this.mode); + } + }, + isDevice: { + get: /** @this{FSNode} */function() { + return FS.isChrdev(this.mode); + } + } + }); + FS.FSNode = FSNode; + FS.staticInit();Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_unlink"] = FS.unlink;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createDevice"] = FS.createDevice;; +ERRNO_CODES = { + 'EPERM': 63, + 'ENOENT': 44, + 'ESRCH': 71, + 'EINTR': 27, + 'EIO': 29, + 'ENXIO': 60, + 'E2BIG': 1, + 'ENOEXEC': 45, + 'EBADF': 8, + 'ECHILD': 12, + 'EAGAIN': 6, + 'EWOULDBLOCK': 6, + 'ENOMEM': 48, + 'EACCES': 2, + 'EFAULT': 21, + 'ENOTBLK': 105, + 'EBUSY': 10, + 'EEXIST': 20, + 'EXDEV': 75, + 'ENODEV': 43, + 'ENOTDIR': 54, + 'EISDIR': 31, + 'EINVAL': 28, + 'ENFILE': 41, + 'EMFILE': 33, + 'ENOTTY': 59, + 'ETXTBSY': 74, + 'EFBIG': 22, + 'ENOSPC': 51, + 'ESPIPE': 70, + 'EROFS': 69, + 'EMLINK': 34, + 'EPIPE': 64, + 'EDOM': 18, + 'ERANGE': 68, + 'ENOMSG': 49, + 'EIDRM': 24, + 'ECHRNG': 106, + 'EL2NSYNC': 156, + 'EL3HLT': 107, + 'EL3RST': 108, + 'ELNRNG': 109, + 'EUNATCH': 110, + 'ENOCSI': 111, + 'EL2HLT': 112, + 'EDEADLK': 16, + 'ENOLCK': 46, + 'EBADE': 113, + 'EBADR': 114, + 'EXFULL': 115, + 'ENOANO': 104, + 'EBADRQC': 103, + 'EBADSLT': 102, + 'EDEADLOCK': 16, + 'EBFONT': 101, + 'ENOSTR': 100, + 'ENODATA': 116, + 'ETIME': 117, + 'ENOSR': 118, + 'ENONET': 119, + 'ENOPKG': 120, + 'EREMOTE': 121, + 'ENOLINK': 47, + 'EADV': 122, + 'ESRMNT': 123, + 'ECOMM': 124, + 'EPROTO': 65, + 'EMULTIHOP': 36, + 'EDOTDOT': 125, + 'EBADMSG': 9, + 'ENOTUNIQ': 126, + 'EBADFD': 127, + 'EREMCHG': 128, + 'ELIBACC': 129, + 'ELIBBAD': 130, + 'ELIBSCN': 131, + 'ELIBMAX': 132, + 'ELIBEXEC': 133, + 'ENOSYS': 52, + 'ENOTEMPTY': 55, + 'ENAMETOOLONG': 37, + 'ELOOP': 32, + 'EOPNOTSUPP': 138, + 'EPFNOSUPPORT': 139, + 'ECONNRESET': 15, + 'ENOBUFS': 42, + 'EAFNOSUPPORT': 5, + 'EPROTOTYPE': 67, + 'ENOTSOCK': 57, + 'ENOPROTOOPT': 50, + 'ESHUTDOWN': 140, + 'ECONNREFUSED': 14, + 'EADDRINUSE': 3, + 'ECONNABORTED': 13, + 'ENETUNREACH': 40, + 'ENETDOWN': 38, + 'ETIMEDOUT': 73, + 'EHOSTDOWN': 142, + 'EHOSTUNREACH': 23, + 'EINPROGRESS': 26, + 'EALREADY': 7, + 'EDESTADDRREQ': 17, + 'EMSGSIZE': 35, + 'EPROTONOSUPPORT': 66, + 'ESOCKTNOSUPPORT': 137, + 'EADDRNOTAVAIL': 4, + 'ENETRESET': 39, + 'EISCONN': 30, + 'ENOTCONN': 53, + 'ETOOMANYREFS': 141, + 'EUSERS': 136, + 'EDQUOT': 19, + 'ESTALE': 72, + 'ENOTSUP': 138, + 'ENOMEDIUM': 148, + 'EILSEQ': 25, + 'EOVERFLOW': 61, + 'ECANCELED': 11, + 'ENOTRECOVERABLE': 56, + 'EOWNERDEAD': 62, + 'ESTRPIPE': 135, + };; +InternalError = Module['InternalError'] = extendError(Error, 'InternalError');; +embind_init_charCodes(); +BindingError = Module['BindingError'] = extendError(Error, 'BindingError');; +init_ClassHandle(); +init_embind();; +init_RegisteredPointer(); +UnboundTypeError = Module['UnboundTypeError'] = extendError(Error, 'UnboundTypeError');; +init_emval();; +// include: base64Utils.js +// Copied from https://github.com/strophe/strophejs/blob/e06d027/src/polyfills.js#L149 + +// This code was written by Tyler Akins and has been placed in the +// public domain. It would be nice if you left this header intact. +// Base64 code from Tyler Akins -- http://rumkin.com + +/** + * Decodes a base64 string. + * @param {string} input The string to decode. + */ +var decodeBase64 = typeof atob == 'function' ? atob : function (input) { + var keyStr = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/='; + + var output = ''; + var chr1, chr2, chr3; + var enc1, enc2, enc3, enc4; + var i = 0; + // remove all characters that are not A-Z, a-z, 0-9, +, /, or = + input = input.replace(/[^A-Za-z0-9\+\/\=]/g, ''); + do { + enc1 = keyStr.indexOf(input.charAt(i++)); + enc2 = keyStr.indexOf(input.charAt(i++)); + enc3 = keyStr.indexOf(input.charAt(i++)); + enc4 = keyStr.indexOf(input.charAt(i++)); + + chr1 = (enc1 << 2) | (enc2 >> 4); + chr2 = ((enc2 & 15) << 4) | (enc3 >> 2); + chr3 = ((enc3 & 3) << 6) | enc4; + + output = output + String.fromCharCode(chr1); + + if (enc3 !== 64) { + output = output + String.fromCharCode(chr2); + } + if (enc4 !== 64) { + output = output + String.fromCharCode(chr3); + } + } while (i < input.length); + return output; +}; + +// Converts a string of base64 into a byte array. +// Throws error on invalid input. +function intArrayFromBase64(s) { + if (typeof ENVIRONMENT_IS_NODE == 'boolean' && ENVIRONMENT_IS_NODE) { + var buf = Buffer.from(s, 'base64'); + return new Uint8Array(buf['buffer'], buf['byteOffset'], buf['byteLength']); + } + + try { + var decoded = decodeBase64(s); + var bytes = new Uint8Array(decoded.length); + for (var i = 0 ; i < decoded.length ; ++i) { + bytes[i] = decoded.charCodeAt(i); + } + return bytes; + } catch (_) { + throw new Error('Converting base64 string to bytes failed.'); + } +} + +// If filename is a base64 data URI, parses and returns data (Buffer on node, +// Uint8Array otherwise). If filename is not a base64 data URI, returns undefined. +function tryParseAsDataURI(filename) { + if (!isDataURI(filename)) { + return; + } + + return intArrayFromBase64(filename.slice(dataURIPrefix.length)); +} + + +// end include: base64Utils.js +function checkIncomingModuleAPI() { + ignoredModuleProp('fetchSettings'); +} +var wasmImports = { + "__assert_fail": ___assert_fail, + "__call_sighandler": ___call_sighandler, + "__cxa_throw": ___cxa_throw, + "__syscall__newselect": ___syscall__newselect, + "__syscall_bind": ___syscall_bind, + "__syscall_connect": ___syscall_connect, + "__syscall_dup": ___syscall_dup, + "__syscall_dup3": ___syscall_dup3, + "__syscall_faccessat": ___syscall_faccessat, + "__syscall_fcntl64": ___syscall_fcntl64, + "__syscall_fstat64": ___syscall_fstat64, + "__syscall_ftruncate64": ___syscall_ftruncate64, + "__syscall_getdents64": ___syscall_getdents64, + "__syscall_ioctl": ___syscall_ioctl, + "__syscall_lstat64": ___syscall_lstat64, + "__syscall_mkdirat": ___syscall_mkdirat, + "__syscall_newfstatat": ___syscall_newfstatat, + "__syscall_openat": ___syscall_openat, + "__syscall_recvfrom": ___syscall_recvfrom, + "__syscall_renameat": ___syscall_renameat, + "__syscall_rmdir": ___syscall_rmdir, + "__syscall_sendto": ___syscall_sendto, + "__syscall_socket": ___syscall_socket, + "__syscall_stat64": ___syscall_stat64, + "__syscall_unlinkat": ___syscall_unlinkat, + "_dlinit": __dlinit, + "_dlopen_js": __dlopen_js, + "_dlsym_js": __dlsym_js, + "_embind_finalize_value_object": __embind_finalize_value_object, + "_embind_register_bigint": __embind_register_bigint, + "_embind_register_bool": __embind_register_bool, + "_embind_register_class": __embind_register_class, + "_embind_register_class_constructor": __embind_register_class_constructor, + "_embind_register_class_function": __embind_register_class_function, + "_embind_register_emval": __embind_register_emval, + "_embind_register_float": __embind_register_float, + "_embind_register_function": __embind_register_function, + "_embind_register_integer": __embind_register_integer, + "_embind_register_memory_view": __embind_register_memory_view, + "_embind_register_std_string": __embind_register_std_string, + "_embind_register_std_wstring": __embind_register_std_wstring, + "_embind_register_value_object": __embind_register_value_object, + "_embind_register_value_object_field": __embind_register_value_object_field, + "_embind_register_void": __embind_register_void, + "_emscripten_get_now_is_monotonic": __emscripten_get_now_is_monotonic, + "_emscripten_throw_longjmp": __emscripten_throw_longjmp, + "_emval_decref": __emval_decref, + "_emval_incref": __emval_incref, + "_emval_take_value": __emval_take_value, + "_gmtime_js": __gmtime_js, + "_localtime_js": __localtime_js, + "_mktime_js": __mktime_js, + "_mmap_js": __mmap_js, + "_munmap_js": __munmap_js, + "_tzset_js": __tzset_js, + "abort": _abort, + "emscripten_console_error": _emscripten_console_error, + "emscripten_date_now": _emscripten_date_now, + "emscripten_get_heap_max": _emscripten_get_heap_max, + "emscripten_get_now": _emscripten_get_now, + "emscripten_memcpy_big": _emscripten_memcpy_big, + "emscripten_resize_heap": _emscripten_resize_heap, + "environ_get": _environ_get, + "environ_sizes_get": _environ_sizes_get, + "exit": _exit, + "fd_close": _fd_close, + "fd_fdstat_get": _fd_fdstat_get, + "fd_read": _fd_read, + "fd_seek": _fd_seek, + "fd_sync": _fd_sync, + "fd_write": _fd_write, + "getentropy": _getentropy, + "invoke_i": invoke_i, + "invoke_ii": invoke_ii, + "invoke_iii": invoke_iii, + "invoke_iiii": invoke_iiii, + "invoke_iiiii": invoke_iiiii, + "invoke_iiiiii": invoke_iiiiii, + "invoke_iiiiiii": invoke_iiiiiii, + "invoke_iiiiiiii": invoke_iiiiiiii, + "invoke_iiiiiiiii": invoke_iiiiiiiii, + "invoke_iiiiiiiiii": invoke_iiiiiiiiii, + "invoke_iiiiiiiiiii": invoke_iiiiiiiiiii, + "invoke_iiiiiiiiiiii": invoke_iiiiiiiiiiii, + "invoke_iiiiiiiiiiiii": invoke_iiiiiiiiiiiii, + "invoke_iiiiiij": invoke_iiiiiij, + "invoke_iiiiiijii": invoke_iiiiiijii, + "invoke_iiiijii": invoke_iiiijii, + "invoke_ij": invoke_ij, + "invoke_jii": invoke_jii, + "invoke_jiii": invoke_jiii, + "invoke_v": invoke_v, + "invoke_vi": invoke_vi, + "invoke_vid": invoke_vid, + "invoke_vii": invoke_vii, + "invoke_viii": invoke_viii, + "invoke_viiii": invoke_viiii, + "invoke_viiiii": invoke_viiiii, + "invoke_viiiiii": invoke_viiiiii, + "invoke_viiiiiii": invoke_viiiiiii, + "invoke_viiiiiiii": invoke_viiiiiiii, + "invoke_viiiiiiiii": invoke_viiiiiiiii, + "invoke_viiiiij": invoke_viiiiij, + "on_status": _on_status, + "proc_exit": _proc_exit, + "strftime": _strftime, + "strptime": _strptime, + "system": _system +}; +var asm = createWasm(); +/** @type {function(...*):?} */ +var ___wasm_call_ctors = createExportWrapper("__wasm_call_ctors"); +/** @type {function(...*):?} */ +var _malloc = Module["_malloc"] = createExportWrapper("malloc"); +/** @type {function(...*):?} */ +var _saveSetjmp = createExportWrapper("saveSetjmp"); +/** @type {function(...*):?} */ +var _free = createExportWrapper("free"); +/** @type {function(...*):?} */ +var ___errno_location = createExportWrapper("__errno_location"); +/** @type {function(...*):?} */ +var _fflush = Module["_fflush"] = createExportWrapper("fflush"); +/** @type {function(...*):?} */ +var _ntohs = createExportWrapper("ntohs"); +/** @type {function(...*):?} */ +var _htons = createExportWrapper("htons"); +/** @type {function(...*):?} */ +var ___getTypeName = Module["___getTypeName"] = createExportWrapper("__getTypeName"); +/** @type {function(...*):?} */ +var __embind_initialize_bindings = Module["__embind_initialize_bindings"] = createExportWrapper("_embind_initialize_bindings"); +/** @type {function(...*):?} */ +var ___dl_seterr = createExportWrapper("__dl_seterr"); +/** @type {function(...*):?} */ +var _emscripten_builtin_memalign = createExportWrapper("emscripten_builtin_memalign"); +/** @type {function(...*):?} */ +var _setThrew = createExportWrapper("setThrew"); +/** @type {function(...*):?} */ +var _emscripten_stack_init = function() { + return (_emscripten_stack_init = Module["asm"]["emscripten_stack_init"]).apply(null, arguments); +}; + +/** @type {function(...*):?} */ +var _emscripten_stack_get_free = function() { + return (_emscripten_stack_get_free = Module["asm"]["emscripten_stack_get_free"]).apply(null, arguments); +}; + +/** @type {function(...*):?} */ +var _emscripten_stack_get_base = function() { + return (_emscripten_stack_get_base = Module["asm"]["emscripten_stack_get_base"]).apply(null, arguments); +}; + +/** @type {function(...*):?} */ +var _emscripten_stack_get_end = function() { + return (_emscripten_stack_get_end = Module["asm"]["emscripten_stack_get_end"]).apply(null, arguments); +}; + +/** @type {function(...*):?} */ +var stackSave = createExportWrapper("stackSave"); +/** @type {function(...*):?} */ +var stackRestore = createExportWrapper("stackRestore"); +/** @type {function(...*):?} */ +var stackAlloc = createExportWrapper("stackAlloc"); +/** @type {function(...*):?} */ +var _emscripten_stack_get_current = function() { + return (_emscripten_stack_get_current = Module["asm"]["emscripten_stack_get_current"]).apply(null, arguments); +}; + +/** @type {function(...*):?} */ +var ___cxa_is_pointer_type = createExportWrapper("__cxa_is_pointer_type"); +/** @type {function(...*):?} */ +var dynCall_iii = Module["dynCall_iii"] = createExportWrapper("dynCall_iii"); +/** @type {function(...*):?} */ +var dynCall_ii = Module["dynCall_ii"] = createExportWrapper("dynCall_ii"); +/** @type {function(...*):?} */ +var dynCall_vi = Module["dynCall_vi"] = createExportWrapper("dynCall_vi"); +/** @type {function(...*):?} */ +var dynCall_vii = Module["dynCall_vii"] = createExportWrapper("dynCall_vii"); +/** @type {function(...*):?} */ +var dynCall_viii = Module["dynCall_viii"] = createExportWrapper("dynCall_viii"); +/** @type {function(...*):?} */ +var dynCall_iiiiii = Module["dynCall_iiiiii"] = createExportWrapper("dynCall_iiiiii"); +/** @type {function(...*):?} */ +var dynCall_viiii = Module["dynCall_viiii"] = createExportWrapper("dynCall_viiii"); +/** @type {function(...*):?} */ +var dynCall_i = Module["dynCall_i"] = createExportWrapper("dynCall_i"); +/** @type {function(...*):?} */ +var dynCall_iiii = Module["dynCall_iiii"] = createExportWrapper("dynCall_iiii"); +/** @type {function(...*):?} */ +var dynCall_viiiiii = Module["dynCall_viiiiii"] = createExportWrapper("dynCall_viiiiii"); +/** @type {function(...*):?} */ +var dynCall_v = Module["dynCall_v"] = createExportWrapper("dynCall_v"); +/** @type {function(...*):?} */ +var dynCall_iiiii = Module["dynCall_iiiii"] = createExportWrapper("dynCall_iiiii"); +/** @type {function(...*):?} */ +var dynCall_viiiii = Module["dynCall_viiiii"] = createExportWrapper("dynCall_viiiii"); +/** @type {function(...*):?} */ +var dynCall_dii = Module["dynCall_dii"] = createExportWrapper("dynCall_dii"); +/** @type {function(...*):?} */ +var dynCall_viid = Module["dynCall_viid"] = createExportWrapper("dynCall_viid"); +/** @type {function(...*):?} */ +var dynCall_iiiiiii = Module["dynCall_iiiiiii"] = createExportWrapper("dynCall_iiiiiii"); +/** @type {function(...*):?} */ +var dynCall_vid = Module["dynCall_vid"] = createExportWrapper("dynCall_vid"); +/** @type {function(...*):?} */ +var dynCall_di = Module["dynCall_di"] = createExportWrapper("dynCall_di"); +/** @type {function(...*):?} */ +var dynCall_vij = Module["dynCall_vij"] = createExportWrapper("dynCall_vij"); +/** @type {function(...*):?} */ +var dynCall_ji = Module["dynCall_ji"] = createExportWrapper("dynCall_ji"); +/** @type {function(...*):?} */ +var dynCall_iiiiiiii = Module["dynCall_iiiiiiii"] = createExportWrapper("dynCall_iiiiiiii"); +/** @type {function(...*):?} */ +var dynCall_iiiiiiiii = Module["dynCall_iiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiii"); +/** @type {function(...*):?} */ +var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = createExportWrapper("dynCall_viiiiiiii"); +/** @type {function(...*):?} */ +var dynCall_iijiiii = Module["dynCall_iijiiii"] = createExportWrapper("dynCall_iijiiii"); +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiiiii = Module["dynCall_iiiiiiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiiiiii"); +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiiii = Module["dynCall_iiiiiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiiiii"); +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiii = Module["dynCall_iiiiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiiii"); +/** @type {function(...*):?} */ +var dynCall_viiiiij = Module["dynCall_viiiiij"] = createExportWrapper("dynCall_viiiiij"); +/** @type {function(...*):?} */ +var dynCall_iiiiiij = Module["dynCall_iiiiiij"] = createExportWrapper("dynCall_iiiiiij"); +/** @type {function(...*):?} */ +var dynCall_iiiiiijii = Module["dynCall_iiiiiijii"] = createExportWrapper("dynCall_iiiiiijii"); +/** @type {function(...*):?} */ +var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = createExportWrapper("dynCall_viiiiiii"); +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiii = Module["dynCall_iiiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiii"); +/** @type {function(...*):?} */ +var dynCall_jiii = Module["dynCall_jiii"] = createExportWrapper("dynCall_jiii"); +/** @type {function(...*):?} */ +var dynCall_ij = Module["dynCall_ij"] = createExportWrapper("dynCall_ij"); +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiii = Module["dynCall_viiiiiiiiii"] = createExportWrapper("dynCall_viiiiiiiiii"); +/** @type {function(...*):?} */ +var dynCall_iiiijii = Module["dynCall_iiiijii"] = createExportWrapper("dynCall_iiiijii"); +/** @type {function(...*):?} */ +var dynCall_iji = Module["dynCall_iji"] = createExportWrapper("dynCall_iji"); +/** @type {function(...*):?} */ +var dynCall_jii = Module["dynCall_jii"] = createExportWrapper("dynCall_jii"); +/** @type {function(...*):?} */ +var dynCall_viiiiiiiii = Module["dynCall_viiiiiiiii"] = createExportWrapper("dynCall_viiiiiiiii"); +/** @type {function(...*):?} */ +var dynCall_jiji = Module["dynCall_jiji"] = createExportWrapper("dynCall_jiji"); +/** @type {function(...*):?} */ +var dynCall_iidiiii = Module["dynCall_iidiiii"] = createExportWrapper("dynCall_iidiiii"); + +function invoke_iiiiii(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + return dynCall_iiiiii(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iii(index,a1,a2) { + var sp = stackSave(); + try { + return dynCall_iii(index,a1,a2); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiii(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + dynCall_viiii(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vi(index,a1) { + var sp = stackSave(); + try { + dynCall_vi(index,a1); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_i(index) { + var sp = stackSave(); + try { + return dynCall_i(index); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vii(index,a1,a2) { + var sp = stackSave(); + try { + dynCall_vii(index,a1,a2); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_ii(index,a1) { + var sp = stackSave(); + try { + return dynCall_ii(index,a1); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiii(index,a1,a2,a3) { + var sp = stackSave(); + try { + return dynCall_iiii(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiii(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + return dynCall_iiiii(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiii(index,a1,a2,a3,a4,a5,a6,a7) { + var sp = stackSave(); + try { + return dynCall_iiiiiiii(index,a1,a2,a3,a4,a5,a6,a7); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiii(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + dynCall_viiiii(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viii(index,a1,a2,a3) { + var sp = stackSave(); + try { + dynCall_viii(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vid(index,a1,a2) { + var sp = stackSave(); + try { + dynCall_vid(index,a1,a2); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiii(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + return dynCall_iiiiiii(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) { + var sp = stackSave(); + try { + return dynCall_iiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) { + var sp = stackSave(); + try { + dynCall_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + dynCall_viiiiii(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12) { + var sp = stackSave(); + try { + return dynCall_iiiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11) { + var sp = stackSave(); + try { + return dynCall_iiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10) { + var sp = stackSave(); + try { + return dynCall_iiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) { + var sp = stackSave(); + try { + dynCall_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) { + var sp = stackSave(); + try { + return dynCall_iiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_v(index) { + var sp = stackSave(); + try { + dynCall_v(index); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) { + var sp = stackSave(); + try { + dynCall_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiij(index,a1,a2,a3,a4,a5,a6,a7) { + var sp = stackSave(); + try { + dynCall_viiiiij(index,a1,a2,a3,a4,a5,a6,a7); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiij(index,a1,a2,a3,a4,a5,a6,a7) { + var sp = stackSave(); + try { + return dynCall_iiiiiij(index,a1,a2,a3,a4,a5,a6,a7); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiijii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) { + var sp = stackSave(); + try { + return dynCall_iiiiiijii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_jiii(index,a1,a2,a3) { + var sp = stackSave(); + try { + return dynCall_jiii(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_ij(index,a1,a2) { + var sp = stackSave(); + try { + return dynCall_ij(index,a1,a2); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiijii(index,a1,a2,a3,a4,a5,a6,a7) { + var sp = stackSave(); + try { + return dynCall_iiiijii(index,a1,a2,a3,a4,a5,a6,a7); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_jii(index,a1,a2) { + var sp = stackSave(); + try { + return dynCall_jii(index,a1,a2); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + + +// include: postamble.js +// === Auto-generated postamble setup entry stuff === + +Module["addRunDependency"] = addRunDependency; +Module["removeRunDependency"] = removeRunDependency; +Module["FS_createPath"] = FS.createPath; +Module["FS_createDataFile"] = FS.createDataFile; +Module["FS_createPreloadedFile"] = FS.createPreloadedFile; +Module["FS_createLazyFile"] = FS.createLazyFile; +Module["FS_createDevice"] = FS.createDevice; +Module["FS_unlink"] = FS.unlink; +Module["FS"] = FS; +var missingLibrarySymbols = [ + 'stringToNewUTF8', + 'getHostByName', + 'traverseStack', + 'convertPCtoSourceLocation', + 'readEmAsmArgs', + 'jstoi_s', + 'listenOnce', + 'autoResumeAudioContext', + 'handleException', + 'runtimeKeepalivePush', + 'runtimeKeepalivePop', + 'callUserCallback', + 'maybeExit', + 'safeSetTimeout', + 'asmjsMangle', + 'handleAllocator', + 'getNativeTypeSize', + 'STACK_SIZE', + 'STACK_ALIGN', + 'POINTER_SIZE', + 'ASSERTIONS', + 'writeI53ToI64', + 'writeI53ToI64Clamped', + 'writeI53ToI64Signaling', + 'writeI53ToU64Clamped', + 'writeI53ToU64Signaling', + 'readI53FromU64', + 'convertI32PairToI53', + 'convertU32PairToI53', + 'getCFunc', + 'ccall', + 'cwrap', + 'uleb128Encode', + 'sigToWasmTypes', + 'generateFuncType', + 'convertJsFunctionToWasm', + 'getEmptyTableSlot', + 'updateTableMap', + 'getFunctionAddress', + 'addFunction', + 'removeFunction', + 'reallyNegative', + 'unSign', + 'strLen', + 'reSign', + 'formatString', + 'intArrayToString', + 'AsciiToString', + 'stringToAscii', + 'allocateUTF8OnStack', + 'writeStringToMemory', + 'registerKeyEventCallback', + 'maybeCStringToJsString', + 'findEventTarget', + 'findCanvasEventTarget', + 'getBoundingClientRect', + 'fillMouseEventData', + 'registerMouseEventCallback', + 'registerWheelEventCallback', + 'registerUiEventCallback', + 'registerFocusEventCallback', + 'fillDeviceOrientationEventData', + 'registerDeviceOrientationEventCallback', + 'fillDeviceMotionEventData', + 'registerDeviceMotionEventCallback', + 'screenOrientation', + 'fillOrientationChangeEventData', + 'registerOrientationChangeEventCallback', + 'fillFullscreenChangeEventData', + 'registerFullscreenChangeEventCallback', + 'JSEvents_requestFullscreen', + 'JSEvents_resizeCanvasForFullscreen', + 'registerRestoreOldStyle', + 'hideEverythingExceptGivenElement', + 'restoreHiddenElements', + 'setLetterbox', + 'softFullscreenResizeWebGLRenderTarget', + 'doRequestFullscreen', + 'fillPointerlockChangeEventData', + 'registerPointerlockChangeEventCallback', + 'registerPointerlockErrorEventCallback', + 'requestPointerLock', + 'fillVisibilityChangeEventData', + 'registerVisibilityChangeEventCallback', + 'registerTouchEventCallback', + 'fillGamepadEventData', + 'registerGamepadEventCallback', + 'registerBeforeUnloadEventCallback', + 'fillBatteryEventData', + 'battery', + 'registerBatteryEventCallback', + 'setCanvasElementSize', + 'getCanvasElementSize', + 'jsStackTrace', + 'stackTrace', + 'checkWasiClock', + 'createDyncallWrapper', + 'setImmediateWrapped', + 'clearImmediateWrapped', + 'polyfillSetImmediate', + 'newNativePromise', + 'getPromise', + 'exception_addRef', + 'exception_decRef', + 'setMainLoop', + '_setNetworkCallback', + 'heapObjectForWebGLType', + 'heapAccessShiftForWebGLHeap', + 'emscriptenWebGLGet', + 'computeUnpackAlignedImageSize', + 'emscriptenWebGLGetTexPixelData', + 'emscriptenWebGLGetUniform', + 'webglGetUniformLocation', + 'webglPrepareUniformLocationsBeforeFirstUse', + 'webglGetLeftBracePos', + 'emscriptenWebGLGetVertexAttrib', + 'writeGLArray', + 'SDL_unicode', + 'SDL_ttfContext', + 'SDL_audio', + 'GLFW_Window', + 'runAndAbortIfError', + 'ALLOC_NORMAL', + 'ALLOC_STACK', + 'allocate', + 'registerInheritedInstance', + 'unregisterInheritedInstance', + 'enumReadValueFromPointer', + 'validateThis', + 'getStringOrSymbol', + 'craftEmvalAllocator', + 'emval_get_global', + 'emval_lookupTypes', + 'emval_allocateDestructors', + 'emval_addMethodCaller', +]; +missingLibrarySymbols.forEach(missingLibrarySymbol) + +var unexportedSymbols = [ + 'run', + 'UTF8ArrayToString', + 'UTF8ToString', + 'stringToUTF8Array', + 'stringToUTF8', + 'lengthBytesUTF8', + 'addOnPreRun', + 'addOnInit', + 'addOnPreMain', + 'addOnExit', + 'addOnPostRun', + 'FS_createFolder', + 'FS_createLink', + 'out', + 'err', + 'callMain', + 'abort', + 'keepRuntimeAlive', + 'wasmMemory', + 'stackAlloc', + 'stackSave', + 'stackRestore', + 'getTempRet0', + 'setTempRet0', + 'writeStackCookie', + 'checkStackCookie', + 'ptrToString', + 'zeroMemory', + 'exitJS', + 'getHeapMax', + 'emscripten_realloc_buffer', + 'ENV', + 'ERRNO_CODES', + 'ERRNO_MESSAGES', + 'setErrNo', + 'inetPton4', + 'inetNtop4', + 'inetPton6', + 'inetNtop6', + 'readSockaddr', + 'writeSockaddr', + 'DNS', + 'Protocols', + 'Sockets', + 'getRandomDevice', + 'timers', + 'warnOnce', + 'UNWIND_CACHE', + 'readEmAsmArgsArray', + 'jstoi_q', + 'getExecutableName', + 'dynCallLegacy', + 'getDynCaller', + 'dynCall', + 'asyncLoad', + 'alignMemory', + 'mmapAlloc', + 'readI53FromI64', + 'convertI32PairToI53Checked', + 'freeTableIndexes', + 'functionsInTableMap', + 'setValue', + 'getValue', + 'PATH', + 'PATH_FS', + 'intArrayFromString', + 'UTF16Decoder', + 'UTF16ToString', + 'stringToUTF16', + 'lengthBytesUTF16', + 'UTF32ToString', + 'stringToUTF32', + 'lengthBytesUTF32', + 'allocateUTF8', + 'writeArrayToMemory', + 'writeAsciiToMemory', + 'SYSCALLS', + 'getSocketFromFD', + 'getSocketAddress', + 'JSEvents', + 'specialHTMLTargets', + 'currentFullscreenStrategy', + 'restoreOldWindowedStyle', + 'demangle', + 'demangleAll', + 'ExitStatus', + 'getEnvStrings', + 'doReadv', + 'doWritev', + 'dlopenMissingError', + 'promiseMap', + 'uncaughtExceptionCount', + 'exceptionLast', + 'exceptionCaught', + 'ExceptionInfo', + 'Browser', + 'wget', + 'MEMFS', + 'TTY', + 'PIPEFS', + 'SOCKFS', + 'tempFixedLengthArray', + 'miniTempWebGLFloatBuffers', + 'GL', + 'AL', + 'SDL', + 'SDL_gfx', + 'GLUT', + 'EGL', + 'GLFW', + 'GLEW', + 'IDBStore', + 'InternalError', + 'BindingError', + 'UnboundTypeError', + 'PureVirtualError', + 'init_embind', + 'throwInternalError', + 'throwBindingError', + 'throwUnboundTypeError', + 'ensureOverloadTable', + 'exposePublicSymbol', + 'replacePublicSymbol', + 'extendError', + 'createNamedFunction', + 'embindRepr', + 'registeredInstances', + 'getBasestPointer', + 'getInheritedInstance', + 'getInheritedInstanceCount', + 'getLiveInheritedInstances', + 'registeredTypes', + 'awaitingDependencies', + 'typeDependencies', + 'registeredPointers', + 'registerType', + 'whenDependentTypesAreResolved', + 'embind_charCodes', + 'embind_init_charCodes', + 'readLatin1String', + 'getTypeName', + 'heap32VectorToArray', + 'requireRegisteredType', + 'getShiftFromSize', + 'integerReadValueFromPointer', + 'floatReadValueFromPointer', + 'simpleReadValueFromPointer', + 'runDestructors', + 'new_', + 'craftInvokerFunction', + 'embind__requireFunction', + 'tupleRegistrations', + 'structRegistrations', + 'genericPointerToWireType', + 'constNoSmartPtrRawPointerToWireType', + 'nonConstNoSmartPtrRawPointerToWireType', + 'init_RegisteredPointer', + 'RegisteredPointer', + 'RegisteredPointer_getPointee', + 'RegisteredPointer_destructor', + 'RegisteredPointer_deleteObject', + 'RegisteredPointer_fromWireType', + 'runDestructor', + 'releaseClassHandle', + 'finalizationRegistry', + 'detachFinalizer_deps', + 'detachFinalizer', + 'attachFinalizer', + 'makeClassHandle', + 'init_ClassHandle', + 'ClassHandle', + 'ClassHandle_isAliasOf', + 'throwInstanceAlreadyDeleted', + 'ClassHandle_clone', + 'ClassHandle_delete', + 'deletionQueue', + 'ClassHandle_isDeleted', + 'ClassHandle_deleteLater', + 'flushPendingDeletes', + 'delayFunction', + 'setDelayFunction', + 'RegisteredClass', + 'shallowCopyInternalPointer', + 'downcastPointer', + 'upcastPointer', + 'char_0', + 'char_9', + 'makeLegalFunctionName', + 'emval_handle_array', + 'emval_free_list', + 'emval_symbols', + 'init_emval', + 'count_emval_handles', + 'get_first_emval', + 'Emval', + 'emval_newers', + 'emval_methodCallers', + 'emval_registeredMethods', +]; +unexportedSymbols.forEach(unexportedRuntimeSymbol); + + + +var calledRun; + +dependenciesFulfilled = function runCaller() { + // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false) + if (!calledRun) run(); + if (!calledRun) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled +}; + +function stackCheckInit() { + // This is normally called automatically during __wasm_call_ctors but need to + // get these values before even running any of the ctors so we call it redundantly + // here. + _emscripten_stack_init(); + // TODO(sbc): Move writeStackCookie to native to to avoid this. + writeStackCookie(); +} + +/** @type {function(Array=)} */ +function run() { + + if (runDependencies > 0) { + return; + } + + stackCheckInit(); + + preRun(); + + // a preRun added a dependency, run will be called later + if (runDependencies > 0) { + return; + } + + function doRun() { + // run may have just been called through dependencies being fulfilled just in this very frame, + // or while the async setStatus time below was happening + if (calledRun) return; + calledRun = true; + Module['calledRun'] = true; + + if (ABORT) return; + + initRuntime(); + + readyPromiseResolve(Module); + if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized'](); + + assert(!Module['_main'], 'compiled without a main, but one is present. if you added it from JS, use Module["onRuntimeInitialized"]'); + + postRun(); + } + + if (Module['setStatus']) { + Module['setStatus']('Running...'); + setTimeout(function() { + setTimeout(function() { + Module['setStatus'](''); + }, 1); + doRun(); + }, 1); + } else + { + doRun(); + } + checkStackCookie(); +} + +function checkUnflushedContent() { + // Compiler settings do not allow exiting the runtime, so flushing + // the streams is not possible. but in ASSERTIONS mode we check + // if there was something to flush, and if so tell the user they + // should request that the runtime be exitable. + // Normally we would not even include flush() at all, but in ASSERTIONS + // builds we do so just for this check, and here we see if there is any + // content to flush, that is, we check if there would have been + // something a non-ASSERTIONS build would have not seen. + // How we flush the streams depends on whether we are in SYSCALLS_REQUIRE_FILESYSTEM=0 + // mode (which has its own special function for this; otherwise, all + // the code is inside libc) + var oldOut = out; + var oldErr = err; + var has = false; + out = err = (x) => { + has = true; + } + try { // it doesn't matter if it fails + _fflush(0); + // also flush in the JS FS layer + ['stdout', 'stderr'].forEach(function(name) { + var info = FS.analyzePath('/dev/' + name); + if (!info) return; + var stream = info.object; + var rdev = stream.rdev; + var tty = TTY.ttys[rdev]; + if (tty && tty.output && tty.output.length) { + has = true; + } + }); + } catch(e) {} + out = oldOut; + err = oldErr; + if (has) { + warnOnce('stdio streams had content in them that was not flushed. you should set EXIT_RUNTIME to 1 (see the FAQ), or make sure to emit a newline when you printf etc.'); + } +} + +if (Module['preInit']) { + if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']]; + while (Module['preInit'].length > 0) { + Module['preInit'].pop()(); + } +} + +run(); + + +// end include: postamble.js + + + return loadWiregasm.ready +} +); +})(); +if (typeof exports === 'object' && typeof module === 'object') + module.exports = loadWiregasm; +else if (typeof define === 'function' && define['amd']) + define([], function() { return loadWiregasm; }); +else if (typeof exports === 'object') + exports["loadWiregasm"] = loadWiregasm; diff --git a/public/wiregasm/wiregasm.wasm.gz b/public/wiregasm/wiregasm.wasm.gz new file mode 100644 index 00000000..e0627641 Binary files /dev/null and b/public/wiregasm/wiregasm.wasm.gz differ diff --git a/public/wiregasm/wiregasm_new.js b/public/wiregasm/wiregasm_new.js new file mode 100644 index 00000000..2b99f5db --- /dev/null +++ b/public/wiregasm/wiregasm_new.js @@ -0,0 +1,166 @@ +/** + * Wraps the WiregasmLib lib functionality and manages a single DissectSession + */ +class Wiregasm { + constructor() { + this.initialized = false; + this.session = null; + } + /** + * Initialize the wrapper and the Wiregasm module + * + * @param loader Loader function for the Emscripten module + * @param overrides Overrides + */ + async init(loader, overrides = {}, beforeInit = null) { + if (this.initialized) { + return; + } + this.lib = await loader(overrides); + this.uploadDir = this.lib.getUploadDirectory(); + this.pluginsDir = this.lib.getPluginsDirectory(); + if (beforeInit !== null) { + await beforeInit(this.lib); + } + this.lib.init(); + this.initialized = true; + } + list_modules() { + return this.lib.listModules(); + } + list_prefs(module) { + return this.lib.listPreferences(module); + } + apply_prefs() { + this.lib.applyPreferences(); + } + set_pref(module, key, value) { + const ret = this.lib.setPref(module, key, value); + if (ret.code != PrefSetResult.PREFS_SET_OK) { + const message = + ret.error != '' ? ret.error : preferenceSetCodeToError(ret.code); + throw new Error( + `Failed to set preference (${module}.${key}): ${message}` + ); + } + } + get_pref(module, key) { + const response = this.lib.getPref(module, key); + if (response.code != 0) { + throw new Error(`Failed to get preference (${module}.${key})`); + } + return response.data; + } + /** + * Check the validity of a filter expression. + * + * @param filter A display filter expression + */ + test_filter(filter) { + return this.lib.checkFilter(filter); + } + complete_filter(filter) { + const out = this.lib.completeFilter(filter); + return { + err: out.err, + fields: vectorToArray(out.fields), + }; + } + reload_lua_plugins() { + this.lib.reloadLuaPlugins(); + } + add_plugin(name, data, opts = {}) { + const path = this.pluginsDir + '/' + name; + this.lib.FS.writeFile(path, data, opts); + } + /** + * Load a packet trace file for analysis. + * + * @returns Response containing the status and summary + */ + load(name, data, opts = {}) { + if (this.session != null) { + this.session.delete(); + } + const path = this.uploadDir + '/' + name; + this.lib.FS.writeFile(path, data, opts); + this.session = new this.lib.DissectSession(path); + return this.session.load(); + } + /** + * Get Packet List information for a range of packets. + * + * @param filter Output those frames that pass this filter expression + * @param skip Skip N frames + * @param limit Limit the output to N frames + */ + frames(filter, skip = 0, limit = 0) { + return this.session.getFrames(filter, skip, limit); + } + /** + * Get full information about a frame including the protocol tree. + * + * @param number Frame number + */ + frame(num) { + return this.session.getFrame(num); + } + follow(follow, filter) { + return this.session.follow(follow, filter); + } + destroy() { + if (this.initialized) { + if (this.session !== null) { + this.session.delete(); + this.session = null; + } + this.lib.destroy(); + this.initialized = false; + } + } + /** + * Returns the column headers + */ + columns() { + const vec = this.lib.getColumns(); + // convert it from a vector to array + return vectorToArray(vec); + } +} + +/** + * Converts a Vector to a JS array + * + * @param vec Vector + * @returns JS array of the Vector contents + */ +function vectorToArray(vec) { + return new Array(vec.size()).fill(0).map((_, id) => vec.get(id)); +} +function preferenceSetCodeToError(code) { + switch (code) { + case PrefSetResult.PREFS_SET_SYNTAX_ERR: + return 'Syntax error in string'; + case PrefSetResult.PREFS_SET_NO_SUCH_PREF: + return 'No such preference'; + case PrefSetResult.PREFS_SET_OBSOLETE: + return 'Preference used to exist but no longer does'; + default: + return 'Unknown error'; + } +} + +if (typeof exports === 'object' && typeof module === 'object') { + module.exports = Wiregasm; + module.exports = vectorToArray; +} else if (typeof define === 'function' && define['amd']) { + define([], function () { + return Wiregasm; + }); + define([], function () { + return vectorToArray; + }); +} else if (typeof exports === 'object') { + exports['loadWiregasm'] = Wiregasm; + exports['vectorToArray'] = vectorToArray; +} diff --git a/public/wiregasm/worker.js b/public/wiregasm/worker.js new file mode 100644 index 00000000..e4f1c208 --- /dev/null +++ b/public/wiregasm/worker.js @@ -0,0 +1,159 @@ +// load the Wiregasm library +importScripts( + '/wiregasm/wiregasm_new.js', + '/wiregasm/wiregasm.js' + // 'https://cdn.jsdelivr.net/npm/@goodtools/wiregasm/dist/wiregasm.js' +); + +const wg = new Wiregasm(); + +const inflateRemoteBuffer = async url => { + const res = await fetch(url); + return await res.arrayBuffer(); +}; + +const fetchPackages = async () => { + console.log('Fetching packages'); + let [wasmBuffer, dataBuffer] = await Promise.all([ + await inflateRemoteBuffer( + '/wiregasm/wiregasm.wasm.gz' + // 'https://cdn.jsdelivr.net/npm/@goodtools/wiregasm/dist/wiregasm.wasm.gz' + ), + await inflateRemoteBuffer( + '/wiregasm/wiregasm.data.gz' + // 'https://cdn.jsdelivr.net/npm/@goodtools/wiregasm/dist/wiregasm.data.gz' + ), + ]); + + return { wasmBuffer, dataBuffer }; +}; + +// Load the Wiregasm Wasm data +fetchPackages() + .then(({ wasmBuffer, dataBuffer }) => { + return wg.init(loadWiregasm, { + wasmBinary: wasmBuffer, + getPreloadedPackage() { + return dataBuffer; + }, + handleStatus: (type, status) => { + postMessage({ type: 'status', code: type, status: status }); + }, + printErr: error => { + postMessage({ type: 'error', error: error }); + }, + }); + }) + .then(() => { + postMessage({ type: 'init' }); + }) + .catch(e => { + postMessage({ type: 'error', error: e }); + }); + +/**Converts a Vector to a JS array */ +function replacer(key, value) { + if (value.constructor.name.startsWith('Vector')) { + return vectorToArray(value); + } + return value; +} + +// Event listener to receive messages from the main script +this.onmessage = ev => { + const data = ev.data; + switch (data.type) { + case 'columns': + const columns = wg.columns(); + if (Array.isArray(columns)) { + this.postMessage({ type: 'columns', data: columns }); + } + break; + case 'select': // select a frame + const number = data.number; + const frameData = wg.frame(number); + const frameDataToJSON = JSON.parse(JSON.stringify(frameData, replacer)); + this.postMessage({ + type: 'selected', + data: frameDataToJSON, + }); + break; + case 'frames': // get frames list + const skip = data.skip; + const limit = data.limit; + const filter = data.filter; + const framesData = wg.frames(filter, skip, limit); + const framesDataToJSON = JSON.parse(JSON.stringify(framesData, replacer)); + this.postMessage({ + type: 'frames', + data: framesDataToJSON, + }); + break; + case 'process-data': + const loadData = wg.load(data.name, new Uint8Array(data.data)); + this.postMessage({ type: 'processed', data: loadData }); + break; + case 'process': + const f = data.file; + const reader = new FileReader(); + reader.addEventListener('load', event => { + // XXX: this blocks the worker thread + const loadData = wg.load(f.name, new Uint8Array(event.target.result)); + postMessage({ type: 'processed', data: loadData }); + }); + reader.readAsArrayBuffer(f); + break; + case 'check-filter': + const filterStr = data.filter; + const checkFilterRes = wg.lib.checkFilter(filterStr); + this.postMessage({ type: 'filter', data: checkFilterRes }); + break; + } + + if (data.type === 'reload-quick') { + if (wg.session) { + // TODO: this is a hack, we should be able to reload the session + const name = data.name; + const res = wg.session.load(); + + postMessage({ type: 'processed', name: name, data: res }); + } + } else if (data.type === 'module-tree') { + const res = wg.list_modules(); + // send it to the correct port + event.ports[0].postMessage({ + result: JSON.parse(JSON.stringify(res, replacer)), + }); + } else if (data.type === 'module-prefs') { + const res = wg.list_prefs(data.name); + // send it to the correct port + event.ports[0].postMessage({ + result: JSON.parse(JSON.stringify(res, replacer)), + }); + } else if (data.type === 'upload-file') { + const f = data.file; + const reader = new FileReader(); + reader.addEventListener('load', e => { + // XXX: this blocks the worker thread + const path = '/uploads/' + f.name; + wg.lib.FS.writeFile(path, Buffer.from(e.target.result)); + event.ports[0].postMessage({ result: path }); + }); + reader.readAsArrayBuffer(f); + } else if (data.type === 'update-pref') { + try { + console.log(`set_pref(${data.module}, ${data.key}, ${data.value})`); + wg.set_pref(data.module, data.key, data.value); + event.ports[0].postMessage({ result: 'ok' }); + } catch (e) { + console.error( + `set_pref(${data.module}, ${data.key}, ${data.value}) failed: ${e.message}` + ); + event.ports[0].postMessage({ error: e.message }); + } + } else if (data.type === 'apply-prefs') { + console.log(`apply_prefs()`); + wg.apply_prefs(); + event.ports[0].postMessage({ result: 'ok' }); + } +}; diff --git a/src/api/faultManage/actAlarm.ts b/src/api/faultManage/actAlarm.ts index d668a4b5..29c5466b 100644 --- a/src/api/faultManage/actAlarm.ts +++ b/src/api/faultManage/actAlarm.ts @@ -241,6 +241,7 @@ export function listSync() { return request({ url: `/api/rest/faultManagement/v1/elementType/all/objectType/alarms`, method: 'get', + timeout: 180_000, }); } diff --git a/src/api/faultManage/eventAlarm.ts b/src/api/faultManage/eventAlarm.ts index 20cf5cd0..e84dfca5 100644 --- a/src/api/faultManage/eventAlarm.ts +++ b/src/api/faultManage/eventAlarm.ts @@ -4,8 +4,6 @@ import { parseObjLineToHump } from '@/utils/parse-utils'; import { parseDateToStr } from '@/utils/date-utils'; import useUserStore from '@/store/modules/user'; - - /** * 查询列表 * @param query 查询参数 @@ -28,8 +26,6 @@ export async function listAct(query: Record) { querySQL += ` and pv_flag = '${query.pvFlag}' `; } - - if (query.neId) { querySQL += ` and ne_id like '%${query.neId}%' `; } @@ -69,7 +65,6 @@ export async function listAct(query: Record) { msg: result.msg, }; result.data.data.forEach((item: any) => { - console.log(item) const itemData = item['alarm_event']; if (Array.isArray(itemData)) { if (itemData.length === 1 && itemData[0]['total'] >= 0) { @@ -84,12 +79,6 @@ export async function listAct(query: Record) { return result; } - - - - - - /** * 事件告警导出 * @param query 查询参数 @@ -133,7 +122,3 @@ export async function exportAll(query: Record) { } return result; } - - - - diff --git a/src/api/logManage/exportFile.ts b/src/api/logManage/exportFile.ts new file mode 100644 index 00000000..d3f48477 --- /dev/null +++ b/src/api/logManage/exportFile.ts @@ -0,0 +1,53 @@ +import { request } from '@/plugins/http-fetch'; + +/** + * 获取下拉框数据 + * @returns object + */ +export function getBakFile() { + return request({ + url: '/lm/table/list', + method: 'get', + }); +} + +/** + * 获取对应类型的文件列表 + * @param query 查询参数 + * @returns object + */ +export function getBakFileList(query: Record) { + return request({ + url: '/lm/file/list', + method: 'get', + params: query, + }); +} + +/** + * 下载远端文件 + * @param query 查询参数 + * @returns object + */ +export function downFile(query: Record) { + return request({ + url: `/lm/file/${query.fileName}`, + method: 'get', + params: query, + responseType: 'blob', + timeout: 180_000, + }); +} + +/** + * 删除远端获取文件 + * @param query 查询参数 + * @returns object + */ +export function delFile(query: Record) { + return request({ + url: `/lm/file/${query.fileName}`, + method: 'delete', + params: query, + }); +} diff --git a/src/api/neData/smf.ts b/src/api/neData/smf.ts index 4139c3ed..02b20e2f 100644 --- a/src/api/neData/smf.ts +++ b/src/api/neData/smf.ts @@ -40,3 +40,16 @@ export function exportSMFDataCDR(data: Record) { timeout: 60_000, }); } + +/** + * SMF-在线订阅用户列表信息 + * @param query 查询参数 + * @returns object + */ +export function listSMFSubscribers(query: Record) { + return request({ + url: '/neData/smf/subscribers', + method: 'get', + params: query, + }); +} diff --git a/src/api/perfManage/customData.ts b/src/api/perfManage/customData.ts new file mode 100644 index 00000000..237b0a65 --- /dev/null +++ b/src/api/perfManage/customData.ts @@ -0,0 +1,19 @@ +import { RESULT_CODE_SUCCESS } from '@/constants/result-constants'; +import { request } from '@/plugins/http-fetch'; +import { parseObjLineToHump } from '@/utils/parse-utils'; +import { parseDateToStr } from '@/utils/date-utils'; + +/** + * 新 查询自定义指标数据 + * @param query 查询参数 + * @returns object + */ +export async function listCustomData(query: Record) { + // 发起请求 + const result = await request({ + url: `/pm/kpiC/report`, + method: 'get', + params: query, + }); + return result; +} diff --git a/src/api/perfManage/customTarget.ts b/src/api/perfManage/customTarget.ts index 4134a0fd..ac3b9ab6 100644 --- a/src/api/perfManage/customTarget.ts +++ b/src/api/perfManage/customTarget.ts @@ -8,57 +8,72 @@ import { parseDateToStr } from '@/utils/date-utils'; * @param query 查询参数 * @returns object */ -export async function listCustom(query: Record) { - let totalSQL = 'select count(*) as total from pm_custom_title where 1=1 '; - let rowsSQL = 'select * from pm_custom_title where 1=1 '; +// export async function listCustom(query: Record) { +// let totalSQL = 'select count(*) as total from pm_custom_title where 1=1 '; +// let rowsSQL = 'select * from pm_custom_title where 1=1 '; - // 查询 - let querySQL = ''; - if (query.neType) { - querySQL += ` and ne_type like '%${query.neType}%' `; - } +// // 查询 +// let querySQL = ''; +// if (query.neType) { +// querySQL += ` and ne_type like '%${query.neType}%' `; +// } - // 排序 - let sortSql = ' order by update_time '; - if (query.sortOrder === 'asc') { - sortSql += ' asc '; - } else { - sortSql += ' desc '; - } - // 分页 - const pageNum = (query.pageNum - 1) * query.pageSize; - const limtSql = ` limit ${pageNum},${query.pageSize} `; +// // 排序 +// let sortSql = ' order by update_time '; +// if (query.sortOrder === 'asc') { +// sortSql += ' asc '; +// } else { +// sortSql += ' desc '; +// } +// // 分页 +// const pageNum = (query.pageNum - 1) * query.pageSize; +// const limtSql = ` limit ${pageNum},${query.pageSize} `; +// // 发起请求 +// const result = await request({ +// url: `/api/rest/databaseManagement/v1/select/omc_db/pm_custom_title`, +// method: 'get', +// params: { +// totalSQL: totalSQL + querySQL, +// rowsSQL: rowsSQL + querySQL + sortSql + limtSql, +// }, +// }); + +// // 解析数据 +// if (result.code === RESULT_CODE_SUCCESS) { +// const data: DataList = { +// total: 0, +// rows: [], +// code: result.code, +// msg: result.msg, +// }; +// result.data.data.forEach((item: any) => { +// const itemData = item['pm_custom_title']; +// if (Array.isArray(itemData)) { +// if (itemData.length === 1 && itemData[0]['total'] >= 0) { +// data.total = itemData[0]['total']; +// } else { +// data.rows = itemData.map(v => parseObjLineToHump(v)); +// } +// } +// }); +// return data; +// } +// return result; +// } + +/** + * 新 查询自定义指标 + * @param query 查询参数 + * @returns object + */ +export async function listCustom(query?: Record) { // 发起请求 const result = await request({ - url: `/api/rest/databaseManagement/v1/select/omc_db/pm_custom_title`, + url: `/pm/kpiC/title/totalList`, method: 'get', - params: { - totalSQL: totalSQL + querySQL, - rowsSQL: rowsSQL + querySQL + sortSql + limtSql, - }, + params: query, }); - - // 解析数据 - if (result.code === RESULT_CODE_SUCCESS) { - const data: DataList = { - total: 0, - rows: [], - code: result.code, - msg: result.msg, - }; - result.data.data.forEach((item: any) => { - const itemData = item['pm_custom_title']; - if (Array.isArray(itemData)) { - if (itemData.length === 1 && itemData[0]['total'] >= 0) { - data.total = itemData[0]['total']; - } else { - data.rows = itemData.map(v => parseObjLineToHump(v)); - } - } - }); - return data; - } return result; } @@ -68,22 +83,10 @@ export async function listCustom(query: Record) { * @returns object */ export async function getCustom(id: string | number) { - // 发起请求 - const result = await request({ - url: `/api/rest/databaseManagement/v1/select/omc_db/pm_custom_title`, + return request({ + url: `/pm/kpiC/title/${id}`, method: 'get', - params: { - SQL: `select * from pm_custom_title where id = ${id}`, - }, }); - // 解析数据 - if (result.code === RESULT_CODE_SUCCESS && Array.isArray(result.data.data)) { - let data = result.data.data[0]; - return Object.assign(result, { - data: parseObjLineToHump(data['pm_custom_title'][0]), - }); - } - return result; } /** @@ -92,21 +95,10 @@ export async function getCustom(id: string | number) { * @returns object */ export function addCustom(data: Record) { - let obj: any = { - title: data.title, - ne_type: data.neType, - kpi_id: data.kpiId, - object_type: data.objectType, - expression: data.expression, - period: data.period, - description: data.description, - kpi_set: data.kpiSet, - }; - return request({ - url: `/api/rest/databaseManagement/v1/omc_db/pm_custom_title`, + url: `/pm/kpiC/title`, method: 'post', - data: { 'data': [obj] }, + data: data, }); } @@ -116,20 +108,10 @@ export function addCustom(data: Record) { * @returns object */ export function updateCustom(data: Record) { - let obj: any = { - title: data.title, - ne_type: data.neType, - kpi_id: data.kpiId, - object_type: data.objectType, - expression: data.expression, - period: data.period, - description: data.description, - kpi_set: data.kpiSet, - }; return request({ - url: `/api/rest/databaseManagement/v1/omc_db/pm_custom_title?WHERE=id=${data.id}`, + url: `/pm/kpiC/title/${data.id}`, method: 'put', - data: { data: obj }, + data: data, }); } @@ -139,8 +121,7 @@ export function updateCustom(data: Record) { */ export async function delCustom(data: Record) { return request({ - url: `/api/rest/databaseManagement/v1/omc_db/pm_custom_title?WHERE=id=${data.id}`, + url: `/pm/kpiC/title/${data.id}`, method: 'delete', }); } - diff --git a/src/api/traceManage/analysis.ts b/src/api/trace/analysis.ts similarity index 100% rename from src/api/traceManage/analysis.ts rename to src/api/trace/analysis.ts diff --git a/src/api/traceManage/pcap.ts b/src/api/trace/pcap.ts similarity index 67% rename from src/api/traceManage/pcap.ts rename to src/api/trace/pcap.ts index 1090ebbd..5fc6a651 100644 --- a/src/api/traceManage/pcap.ts +++ b/src/api/trace/pcap.ts @@ -18,10 +18,21 @@ export function dumpStop(data: Record) { }); } +// 网元抓包PACP 下载 +export function dumpDownload(data: Record) { + return request({ + url: '/trace/tcpdump/download', + method: 'get', + params: data, + responseType: 'blob', + timeout: 60_000, + }); +} + // UPF标准版内部抓包 export function traceUPF(data: Record) { return request({ - url: '/trace/tcpdump/traceUPF', + url: '/trace/tcpdump/upf', method: 'post', data: data, }); diff --git a/src/api/trace/task.ts b/src/api/trace/task.ts new file mode 100644 index 00000000..f48ac1db --- /dev/null +++ b/src/api/trace/task.ts @@ -0,0 +1,89 @@ +import { RESULT_CODE_SUCCESS } from '@/constants/result-constants'; +import { request } from '@/plugins/http-fetch'; +import { parseObjLineToHump } from '@/utils/parse-utils'; + +/** + * 查询跟踪任务列表 + * @param query 查询参数 + * @returns object + */ +export async function listTraceTask(query: Record) { + return request({ + url: '/trace/task/list', + method: 'get', + params: query, + }); +} + +/** + * 查询跟踪任务信息 + * @param id 网元ID + * @returns object + */ +export async function getTraceTask(id: string | number) { + return request({ + url: `/trace/task/${id}`, + method: 'get', + }); +} + +/** + * 新增任务 + * @param data 网元对象 + * @returns object + */ +export function addTraceTask(data: Record) { + return request({ + url: `/trace/task`, + method: 'post', + data: data, + }); +} + +/** + * 修改任务 + * @param data 网元对象 + * @returns object + */ +export function updateTraceTask(data: Record) { + return request({ + url: `/trace/task`, + method: 'put', + data: data, + }); +} + +/** + * 跟踪任务删除 + * @param ids ID多个逗号分隔 + * @returns object + */ +export async function delTraceTask(ids: string) { + return request({ + url: `/trace/task/${ids}`, + method: 'delete', + }); +} + +/** + * 获取网元跟踪接口列表 + * @returns object + */ +export async function getNeTraceInterfaceAll() { + // 发起请求 + const result = await request({ + url: `/api/rest/databaseManagement/v1/elementType/omc_db/objectType/ne_info`, + method: 'get', + params: { + SQL: `SELECT ne_type,interface FROM trace_info GROUP BY ne_type,interface`, + }, + }); + // 解析数据 + if (result.code === RESULT_CODE_SUCCESS && Array.isArray(result.data.data)) { + let data = result.data.data[0]; + return Object.assign(result, { + data: parseObjLineToHump(data['trace_info']), + }); + } + return result; +} diff --git a/src/api/trace/taskHLR.ts b/src/api/trace/taskHLR.ts new file mode 100644 index 00000000..6d6adf34 --- /dev/null +++ b/src/api/trace/taskHLR.ts @@ -0,0 +1,83 @@ +import { request } from '@/plugins/http-fetch'; + +/** + * 查询跟踪任务列表 + * @param query 查询参数 + * @returns object + */ +export function listTaskHLR(query: Record) { + return request({ + url: '/trace/task/hlr/list', + method: 'get', + params: query, + }); +} + +/** + * 跟踪任务删除 + * @param ids 任务ID + * @returns object + */ +export function delTaskHLR(ids: string | number) { + return request({ + url: `/trace/task/hlr/${ids}`, + method: 'delete', + timeout: 60_000, + }); +} + +/** + * 跟踪任务创建 + * @param data 对象 + * @returns object + */ +export function startTaskHLR(data: Record) { + return request({ + url: '/trace/task/hlr/start', + method: 'post', + data: data, + timeout: 60_000, + }); +} + +/** + * 跟踪任务停止 + * @param data 对象 + * @returns object + */ +export function stopTaskHLR(data: Record) { + return request({ + url: '/trace/task/hlr/stop', + method: 'post', + data: data, + timeout: 60_000, + }); +} + +/** + * 跟踪任务文件 + * @param data 对象 + * @returns object + */ +export function fileTaskHLR(data: Record) { + return request({ + url: '/trace/task/hlr/file', + method: 'post', + data: data, + }); +} + +/** + * 跟踪任务文件从网元到本地 + * @param query 对象 + * @returns object + */ +export function filePullTaskHLR(query: Record) { + return request({ + url: '/trace/task/hlr/filePull', + method: 'get', + params: query, + responseType: 'blob', + timeout: 60_000, + }); +} diff --git a/src/api/traceManage/task.ts b/src/api/traceManage/task.ts deleted file mode 100644 index f55066f7..00000000 --- a/src/api/traceManage/task.ts +++ /dev/null @@ -1,154 +0,0 @@ -import { RESULT_CODE_SUCCESS } from '@/constants/result-constants'; -import { request } from '@/plugins/http-fetch'; -import { parseObjLineToHump } from '@/utils/parse-utils'; - -/** - * 查询任务列表 - * @param query 查询参数 - * @returns object - */ -export async function listTraceTask(query: Record) { - let totalSQL = 'select count(*) as total from trace_task where 1=1 '; - let rowsSQL = 'select * from trace_task where 1=1 '; - - // 查询 - let querySQL = ''; - if (query.imsi) { - querySQL += ` and imsi like '%${query.imsi}%' `; - } - if (query.beginTime) { - querySQL += ` and start_time >= '${query.beginTime}' `; - } - if (query.endTime) { - querySQL += ` and end_time <= '${query.endTime}' `; - } - - // 分页 - const pageNum = (query.pageNum - 1) * query.pageSize; - const limtSql = ` limit ${pageNum},${query.pageSize} `; - - // 排序 - let sortSql = ' order by start_time '; - if (query.sortOrder === 'asc') { - sortSql += ' asc '; - } else { - sortSql += ' desc '; - } - - // 发起请求 - const result = await request({ - url: `/api/rest/databaseManagement/v1/select/omc_db/trace_task`, - method: 'get', - params: { - totalSQL: totalSQL + querySQL, - rowsSQL: rowsSQL + querySQL + sortSql + limtSql, - }, - }); - - // 解析数据 - if (result.code === RESULT_CODE_SUCCESS) { - const data: DataList = { - total: 0, - rows: [], - code: result.code, - msg: result.msg, - }; - result.data.data.forEach((item: any) => { - const itemData = item['trace_task']; - if (Array.isArray(itemData)) { - if (itemData.length === 1 && itemData[0]['total'] >= 0) { - data.total = itemData[0]['total']; - } else { - data.rows = itemData.map(v => parseObjLineToHump(v)); - } - } - }); - return data; - } - return result; -} - -/** - * 查询任务详细 - * @param id 网元ID - * @returns object - */ -export async function getTraceTask(id: string | number) { - // 发起请求 - const result = await request({ - url: `/api/rest/databaseManagement/v1/select/omc_db/trace_task`, - method: 'get', - params: { - SQL: `select * from trace_task where id = ${id}`, - }, - }); - // 解析数据 - if (result.code === RESULT_CODE_SUCCESS && Array.isArray(result.data.data)) { - let data = result.data.data[0]; - return Object.assign(result, { - data: parseObjLineToHump(data['trace_task'][0]), - }); - } - return result; -} - -/** - * 新增任务 - * @param data 网元对象 - * @returns object - */ -export function addTraceTask(data: Record) { - return request({ - url: `/api/rest/traceManagement/v1/subscriptions`, - method: 'post', - data: data, - }); -} - -/** - * 修改任务 - * @param data 网元对象 - * @returns object - */ -export function updateTraceTask(data: Record) { - return request({ - url: `/api/rest/traceManagement/v1/subscriptions`, - method: 'put', - data: data, - }); -} - -/** - * 删除任务 - * @param noticeId 网元ID - * @returns object - */ -export async function delTraceTask(id: string) { - return request({ - url: `/api/rest/traceManagement/v1/subscriptions?id=${id}`, - method: 'delete', - }); -} - -/** - * 获取网元跟踪接口列表 - * @returns object - */ -export async function getNeTraceInterfaceAll() { - // 发起请求 - const result = await request({ - url: `/api/rest/databaseManagement/v1/elementType/omc_db/objectType/ne_info`, - method: 'get', - params: { - SQL: `SELECT ne_type,interface FROM trace_info GROUP BY ne_type,interface`, - }, - }); - // 解析数据 - if (result.code === RESULT_CODE_SUCCESS && Array.isArray(result.data.data)) { - let data = result.data.data[0]; - return Object.assign(result, { - data: parseObjLineToHump(data['trace_info']), - }); - } - return result; -} diff --git a/src/assets/js/wiregasm_worker.ts b/src/assets/js/wiregasm_worker.ts new file mode 100644 index 00000000..8157b0ef --- /dev/null +++ b/src/assets/js/wiregasm_worker.ts @@ -0,0 +1,11 @@ +/** + * worker文件-静态资源文件路径 + */ +const baseUrl = import.meta.env.VITE_HISTORY_BASE_URL; +export const scriptUrl = `${ + baseUrl.length === 1 && baseUrl.indexOf('/') === 0 + ? '' + : baseUrl.indexOf('/') === -1 + ? '/' + baseUrl + : baseUrl +}/wiregasm/worker.js`; diff --git a/src/components/TerminalTelnet/index.vue b/src/components/TerminalTelnet/index.vue index 329907cd..ef2625f3 100644 --- a/src/components/TerminalTelnet/index.vue +++ b/src/components/TerminalTelnet/index.vue @@ -119,7 +119,7 @@ function fnAutoCompleteKeydown(evt: any) { ws.send({ requestId: `telnet_${props.hostId}`, type: 'telnet', - data: `${cmdStr}\r\n'`, + data: `${cmdStr}\r\n`, }); terminalState.text = ' '; diff --git a/src/components/VirtualList/index.vue b/src/components/VirtualList/index.vue new file mode 100644 index 00000000..63e003e8 --- /dev/null +++ b/src/components/VirtualList/index.vue @@ -0,0 +1,204 @@ + + + + + diff --git a/src/constants/ne-constants.ts b/src/constants/ne-constants.ts index 4cd14a74..037ece3e 100644 --- a/src/constants/ne-constants.ts +++ b/src/constants/ne-constants.ts @@ -16,6 +16,7 @@ export const NE_TYPE_LIST = [ 'N3IWF', 'MOCNGW', 'SMSC', + 'CBC', ]; /** diff --git a/src/i18n/locales/en-US.ts b/src/i18n/locales/en-US.ts index d87b8492..ee746670 100644 --- a/src/i18n/locales/en-US.ts +++ b/src/i18n/locales/en-US.ts @@ -88,7 +88,7 @@ export default { day33: "days", day4: "Designated day (optional)", day5: "Last day of the month", - hour1: "Hourly", + hour1: "Hourly", hour21: "Execute every", hour22: "hours, starting from the", hour23: "hour", @@ -149,6 +149,7 @@ export default { page403: 'No Access', page404: 'Match Page Not Found', helpDoc: 'System User Documentation', + traceTaskHLR: 'Tracking Tasks HLR', lockScreen: 'Lock Screen', account: { index: "Personal Center", @@ -185,11 +186,11 @@ export default { helpDoc: 'Doc', }, rightContent: { + alarm: "Active Alarms", lock: "Lock Screen", lockTip: "Confirmation of the lock screen?", lockPasswd: "Unlock Password", lockPasswdTip: "No password can be set", - helpDoc: "System User Documentation", fullscreen: "Full Screen", logout: "Logout", profile: "Profile", @@ -239,7 +240,7 @@ export default { ttile: 'No access', subTitle:'Please do not perform illegal operations, you can go back to the main page or return to the', backHome: 'Back to Home', - back: 'Back', + back: 'Back', }, err404: { ttile: 'Match page not found', @@ -296,10 +297,10 @@ export default { newPassword: "New Password", newPasswordTip: "Password contains at least upper and lower case letters, numbers, special symbols, and not less than 6 digits", newPassworddPleace: "Please enter a new password", - confirmPassword: "Confirm new password", + confirmPassword: "Confirm new password", confirmPasswordPleace: "Please confirm the new password", submit: "Submit changes", - reset: "Reset", + reset: "Reset", submitTip: "Are you sure you want to submit a password change?", submitOkTip: "Congratulations, {num} account password changed successfully!", submitOk: "Sign in again", @@ -525,7 +526,7 @@ export default { up:'Uplink', down:'Downlink' }, - upfFlowTotal:{ + upfFlowTotal:{ title:'Traffic Summary', up:'Uplink', down:'Downlink' @@ -606,7 +607,7 @@ export default { neIdTip: 'Fill in the unique identifier of the network element binding', rmUid: 'Resource Unique ID', rmUidPlease: 'Please enter a resource unique ID', - rmUidTip: "Tagging for data reporting of network element logs, alarms, metrics, etc.", + rmUidTip: "Tagging for data reporting of network element logs, alarms, metrics, etc.", neName: 'NE Name', neNamePlease: 'Please enter the name of the network element', ipAddr: 'IP Addr', @@ -630,9 +631,9 @@ export default { log: 'Logs', }, neInfo: { - version: "Version", + version: "Version", state: "State", - serviceState: "Service Status", + serviceState: "Service Status", info: 'Status Message', resourceInfo: 'Resource Situation', sysMem: "SYS Mem", @@ -666,8 +667,8 @@ export default { backConf: { export: 'Config Export', import: 'Config Import', - title: 'Configuration File Import', - importType: 'Source of File', + title: 'Configuration File Import', + importType: 'Source of File', server:'Server File', local:'Local File', localUpload:'Local Upload', @@ -743,17 +744,17 @@ export default { rollback: 'Switch to previous version', rollbackTip: "Confirm switching to the previous version?", rollbackTipEmpty: "There is currently no previous version available", - rollbackTipEqual: 'The current version is the same as the previous version', + rollbackTipEqual: 'The current version is the same as the previous version', version: "Current Version", preVersion: "Previous Version", newVersion: "New Version", status: "Revision Status", upgradeBatch: "Batch Upgrade", upgradeBatchTip: "Do you perform new version upgrades on checked records?", - upgradeNotNewVer: 'No new version found', - upgradeOMCVer: 'Rejection of batch operation upgrades OMC', - upgradeDone: 'Update complete, service being reloaded', - upgradeFail: 'The update fails, please check whether the software file exists and whether the service terminal environment is available!', + upgradeNotNewVer: 'No new version found', + upgradeOMCVer: 'Rejection of batch operation upgrades OMC', + upgradeDone: 'Update complete, service being reloaded', + upgradeFail: 'The update fails, please check whether the software file exists and whether the service terminal environment is available!', upgradeModal: 'Network Element Version Updates', }, neLicense: { @@ -773,7 +774,7 @@ export default { uploadChangeOk: 'Network Element renewed license successfully and is being calibrated in the background!', uploadChangeFail: "Some network elements failed to update the license, please check whether the service terminal environment is available!", }, - neConfig: { + neConfig: { treeTitle: "Navigation Configuration", treeSelectTip: "Select configuration item information in the left configuration navigation!", neType: 'NE Type', @@ -877,12 +878,13 @@ export default { imsiTip3: 'MSIN = Mobile Subscriber Identification Number, consisting of 10 equal digits.', amfTip: 'Authentication management field, maximum parameter length is 4', algoIndexTip: 'Algorithm index, between 0 and 15', - kiTip: 'User signing key information, the maximum length of 32', + kiTip: 'User signing key information, the length can only be 32', opcTip: 'The authentication key, OPC, is calculated from Ki and OP, OP is the root key of the operator, ki is the authentication key, and the maximum length is 32.', delSure:'Are you sure you want to delete the user with IMSI number: {imsi} ?', + imsiConfirm:'The length of the IMSI must be 15', }, sub: { - subInfo:' Subscription Info', + subInfo:' Subscription Info', neType: 'UDM Object', export: 'Export', exportConfirm: 'Are you sure to export all signed user data?', @@ -940,7 +942,7 @@ export default { batchAddText: 'Batch Add', batchDelText: 'Batch Delete', batchUpdateText: 'Batch Modify', - batchNum: 'Number of batches', + batchNum: 'Number of batches', imsiTip: 'IMSI=MCC+MNC+MSIN', imsiTip1: 'MCC=Mobile Country Code, consisting of three digits.', imsiTip2: 'MNC = Mobile Network Number, consisting of two digits', @@ -967,10 +969,10 @@ export default { n3iwf: { neType: 'N3IWF Object', }, - ue: { + ue: { neType: 'SMF Object', }, - ims: { + ims: { neType: 'IMS Object', }, nssf:{ @@ -1059,6 +1061,7 @@ export default { }, customTarget:{ kpiId:' Custom Indicator', + kpiIdTip:'This Ne has no custom indicators', period:' Granularity', title:' Custom Indicator Title', objectType:' Object type', @@ -1070,6 +1073,13 @@ export default { addCustom:' Add custom indicator', editCustom:' Edit Custom indicator', errorCustomInfo: 'Failed to get information', + status: 'Status', + active:'Active', + inactive:'Inactive', + symbol:'Symbol', + element:'Element', + granularity:'Granularity', + unit:'Unit', } }, traceManage: { @@ -1095,18 +1105,23 @@ export default { pcap: { capArgPlease: 'Please enter tcpdump -i any support parameter', cmd: 'Command', - execCmd: "Generic tcpdump packet capture command", - execCmdsSctp: "Generic tcpdump filter sctp and port commands", - execUPFCmdA: 'Suitable for anomalous packet capture of other NE', - execUPFCmdB: 'Suitable for UPF anomaly packet capture analysis', + execCmd: "Common Command Options", + execCmd2: "Filter Protocol Port Command", + execCmd3: "File Split By Time units of seconds (-G 10), Generated Max File Number (-W 7)", + execUPFCmdA: 'Standard Edition - UPF with other NE anomalous packet capture analysis', + execUPFCmdB: 'Standard Edition - UPF anomalies requiring packet capture analysis', + batchOper: 'Batch Operations', + batchStartText: 'Batch Start', + batchStopText: 'Batch Stop', + batchDownText: 'Batch Download', + fileView: 'Historical Packet Capture Files', + fileUPF: 'Standard Edition', + fileUPFTip: 'UPF internal packet capture and analysis packet', textStart: "Start", - textStartBatch: "Batch Start", textStop: "Stop", - textStopBatch: "Batch Stop", textLog: "Log", textLogMsg: "Log Info", textDown: "Download", - textDownBatch: "Batch Download", downTip: "Are you sure you want to download the {title} capture data file?", downOk: "{title} file download complete", downErr: "{title} file download exception", @@ -1126,6 +1141,9 @@ export default { trackType: 'Tracing Type', trackTypePlease: 'Please select a tracing type', creater: 'Created by', + textStop: "Stop", + status: 'Status', + time: 'Time', startTime: 'Start Time', endTime: 'End Time', msisdn: 'MSISDN', @@ -1135,26 +1153,30 @@ export default { imsiPlease: 'Please enter IMSI', imsiTip: 'Mobile communication IMSI number', srcIp: 'Source IP Address', - srcIpPlease: 'Please enter the source IP address', + srcIpPlease: 'Please enter the IP address', srcIpTip: 'Current sender IPv4 address', dstIp: 'Destination IP Address', - dstIpPlease: 'Please enter the destination IP address', + dstIpPlease: 'Please enter the IP address', dstIpTip: 'IPv4 address of the receiving end of the other party', interfaces: 'Signaling Interface', interfacesPlease: 'Please enter the signaling interface', signalPort: 'Signal Port', signalPortPlease: 'Please enter the signaling port', - signalPortTip: 'Port corresponding to the interface', + signalPortTip: 'Port of the side corresponding to the destination IP address or source IP address', rangePicker: 'Start/End Time', rangePickerPlease: 'Please select the start and end time of the task', - comment: 'Task Description', - commentPlease: 'Task description can be entered', + remark: 'Remark', + remarkPlease: 'Task description can be entered', addTask: 'Add Task', editTask: 'Modify Task', viewTask: 'View Task', errorTaskInfo: 'Failed to obtain task information', - delTask: 'Successfully deleted task {num}', - delTaskTip: 'Are you sure to delete the data item with record number {num}?', + delTaskTip: 'Are you sure to delete the data item with record ID {id} ?', + stopTask: 'Successful cessation of tasks {id}', + stopTaskTip: 'Confirm stopping the task with record ID {id} ?', + traceFile: "Tracking File", + errMsg: "Error Message", + imsiORmsisdn: "imsi or msisdn is null, cannot start task", }, }, faultManage: { @@ -1273,6 +1295,14 @@ export default { tailChar: 'End Characters', tailLines: 'End Lines', }, + exportFile:{ + fileName:'File Source', + downTip: "Confirm the download file name is [{fileName}] File?", + downTipErr: "Failed to get file", + deleteTip: "Confirm the delete file name is [{fileName}] File?", + deleteTipErr: "Failed to delete file", + selectTip:"Please select File Name", + } }, monitor: { session: { @@ -1590,7 +1620,7 @@ export default { edgeTypeLineAnimateState: "Straight line with state animations", edgeLabelPositionStart: "Start", edgeLabelPositionMiddle: "Middle", - edgeLabelPositionEnd: "End", + edgeLabelPositionEnd: "End", nodeTypeCircle: "Circle", nodeTypeRect: "Rect", nodeTypeEllipse: "Ellipse", @@ -1949,7 +1979,7 @@ export default { componentTip:' The component path accessed by views in the page component directory, such as: system/user/index Note: The routing address without the .vue file suffix is the network address and can be filled in as a link', perms:`Permission identification example: monitor:server:query Permission identification is used in the back-end controller, such as:['monitor:server:query'] Permission identification is used in the front-end Vue page, such as: v-perms:has="['monitor:server:query']"` }, - dict:{ + dict:{ dictInfo:'Dictionary Type Information', dictId:'Dictionary Number', dictName:'Dictionary Name', @@ -2028,9 +2058,9 @@ export default { stepInstallText: 'Select Install', stepInstallTip: 'Confirm the installation of the new version of the chosen Net Meta?', stepInstallModal: 'Network Element For Install', - stepInstallNotNewVer: 'No new version found', - stepInstallDone: 'Installation complete, service initialized', - stepInstallFail: 'Installation fails, check if the service terminal environment is available!', + stepInstallNotNewVer: 'No new version found', + stepInstallDone: 'Installation complete, service initialized', + stepInstallFail: 'Installation fails, check if the service terminal environment is available!', stepLicenseTitle: "Service License", stepLicenseDesc: "Obtaining a license activation code for authorization authentication", stepLicenseReload: 'Select Refresh', @@ -2119,6 +2149,30 @@ export default { hostSelectMore: "Load More {num}", hostSelectHeader: "Host List", }, + ps:{ + realTimeHigh:"High", + realTimeLow:"Low", + realTimeRegular:"Regular", + realTimeStop:"Stop", + realTime:"Real Time Speed", + pid:"PID", + name:"APP Name", + username:"User Name", + runTime:"Run Time", + numThreads:"Thread", + cpuPercent:"CPU Percent", + diskRead:"Disk Read", + diskWrite:"Disk Write", + }, + net:{ + PID:"PID", + name:"name", + localAddr:"localAddr", + remoteAddr:"remoteAddr", + status:"status", + type:"type", + port:"port", + }, }, }, }; diff --git a/src/i18n/locales/zh-CN.ts b/src/i18n/locales/zh-CN.ts index 4ee5c82b..437be291 100644 --- a/src/i18n/locales/zh-CN.ts +++ b/src/i18n/locales/zh-CN.ts @@ -149,6 +149,7 @@ export default { page403: '没有访问权限', page404: '找不到匹配页面', helpDoc: '系统使用文档', + traceTaskHLR: '跟踪任务 HLR', lockScreen: '锁屏', account: { index: "个人中心", @@ -185,11 +186,11 @@ export default { helpDoc: '使用手册', }, rightContent: { + alarm: "活动告警", lock: "锁屏", lockTip: "确认要进行锁屏吗？", lockPasswd: "解锁密码", lockPasswdTip: "可不设置密码", - helpDoc: "系统使用文档", fullscreen: "全屏显示", logout: "退出登录", profile: "个人中心", @@ -296,10 +297,10 @@ export default { newPassword: "新密码", newPasswordTip: "密码至少包含大小写字母、数字、特殊符号，且不少于6位", newPassworddPleace: "请输入新密码", - confirmPassword: "确认新密码", + confirmPassword: "确认新密码", confirmPasswordPleace: "请确认新密码", submit: "提交修改", - reset: "重置", + reset: "重置", submitTip: "确认要提交修改密码吗?", submitOkTip: "恭喜您，{num} 账号密码修改成功！", submitOk: "重新登录", @@ -606,7 +607,7 @@ export default { neIdTip: '填写网元绑定的唯一标识', rmUid: '资源唯一标识', rmUidPlease: '请输入资源唯一标识', - rmUidTip: "用于网元日志、告警、指标等数据上报的标记", + rmUidTip: "用于网元日志、告警、指标等数据上报的标记", neName: '网元名称', neNamePlease: '请输入网元名称', ipAddr: '服务IP', @@ -630,9 +631,9 @@ export default { log: '日志', }, neInfo: { - version: "网元版本", + version: "网元版本", state: "网元状态", - serviceState: "服务状态", + serviceState: "服务状态", info: '状态信息', resourceInfo: '资源情况', sysMem: "系统内存", @@ -666,8 +667,8 @@ export default { backConf: { export: '配置导出', import: '配置导入', - title: '配置文件导入', - importType: '文件来源', + title: '配置文件导入', + importType: '文件来源', server:'服务器文件', local:'本地文件', localUpload:'本地上传', @@ -750,11 +751,11 @@ export default { status: "版本状态", upgradeBatch: "批量更新", upgradeBatchTip: "对勾选的记录进行新版本升级吗？", - upgradeNotNewVer: '没有发现新版本', - upgradeOMCVer: '拒绝批量操作升级OMC', - upgradeDone: '更新完成，服务正在重载', - upgradeFail: '更新失败，请检查软件文件是否存在且服务终端环境是否可用！', - upgradeModal: '网元版本更新', + upgradeNotNewVer: '没有发现新版本', + upgradeOMCVer: '拒绝批量操作升级OMC', + upgradeDone: '更新完成，服务正在重载', + upgradeFail: '更新失败，请检查软件文件是否存在且服务终端环境是否可用！', + upgradeModal: '网元版本更新', }, neLicense: { status: "许可证状态", @@ -877,9 +878,10 @@ export default { imsiTip3: 'MSIN=移动客户识别码，采用等长10位数字构成', amfTip: '鉴权管理域，参数最大长度为 4', algoIndexTip: '算法索引，介于0到15之间', - kiTip: '用户签权密钥信息,最大长度为32', + kiTip: '用户签权密钥信息,长度只能是32', opcTip: '鉴权秘钥，OPC是由Ki和OP经过计算得来的，OP为运营商的根秘钥，ki是鉴权秘钥,最大长度为32', delSure:'确认删除IMSI编号为: {imsi} 的用户吗?', + imsiConfirm:'IMSI的长度必须为15', }, sub: { subInfo:'签约信息', @@ -940,7 +942,7 @@ export default { batchAddText: '批量新增', batchDelText: '批量删除', batchUpdateText: '批量更新', - batchNum: '批量个数', + batchNum: '批量个数', imsiTip: 'IMSI=MCC+MNC+MSIN', imsiTip1: 'MCC=移动国家号码, 由三位数字组成', imsiTip2: 'MNC=移动网络号，由两位数字组成', @@ -1059,6 +1061,7 @@ export default { }, customTarget:{ kpiId:'自定义指标项', + kpiIdTip:'该网元没有自定义指标', period:'颗粒度', title:'自定义指标项标题', objectType:'对象类型', @@ -1069,7 +1072,14 @@ export default { delCustom:'成功删除记录编号为 {num} 自定义指标', addCustom:'添加自定义指标', editCustom:'编辑自定义指标', - errorCustomInfo: '获取信息失败', + errorCustomInfo: '获取信息失败', + status: '状态', + active:'正常', + inactive:'停用', + symbol:"符号", + element:'元素', + granularity:'颗粒度', + unit:'单位', } }, traceManage: { @@ -1095,18 +1105,23 @@ export default { pcap: { capArgPlease: '请输入tcpdump -i any支持参数', cmd: '命令', - execCmd: "通用tcpdump抓包命令", - execCmdsSctp: "过滤sctp和port命令", - execUPFCmdA: '适合其他网元异常，UPF配合抓包的情况', - execUPFCmdB: '适合UPF异常需要抓包分析的情况', + execCmd: "通用命令选项", + execCmd2: "过滤协议端口命令", + execCmd3: "分割文件按时间单位秒 (-G 10 )，最多生成文件数量 (-W 7)", + execUPFCmdA: '标准版-UPF配合其他网元异常抓包分析', + execUPFCmdB: '标准版-UPF异常需要抓包分析', + batchOper: '批量操作', + batchStartText: '批量开始', + batchStopText: '批量停止', + batchDownText: '批量下载', + fileView: '历史抓包文件', + fileUPF: '标准版', + fileUPFTip: 'UPF内部抓包分析包', textStart: "开始", - textStartBatch: "批量开始", textStop: "停止", - textStopBatch: "批量停止", textLog: "日志", textLogMsg: "日志信息", textDown: "下载", - textDownBatch: "批量下载", downTip: "确认要下载 {title} 抓包数据文件吗？", downOk: "{title} 文件下载完成", downErr: "{title} 文件下载异常", @@ -1126,6 +1141,9 @@ export default { trackType: '跟踪类型', trackTypePlease: '请选择跟踪类型', creater: '创建人', + textStop: "停止", + status: '状态', + time: '时间', startTime: '开始时间', endTime: '结束时间', msisdn: 'MSISDN', @@ -1144,17 +1162,21 @@ export default { interfacesPlease: '请输入信令接口', signalPort: '信令端口', signalPortPlease: '请输入信令端口', - signalPortTip: '接口对应的端口', + signalPortTip: '目标IP地址或源IP地址对应一方的端口', rangePicker: '开始结束时间', rangePickerPlease: '请选择任务时间开始结束时间', - comment: '任务说明', - commentPlease: '可输入任务说明', + remark: '说明', + remarkPlease: '可输入任务说明', addTask: '添加任务', editTask: '修改任务', viewTask: '查看任务', errorTaskInfo: '获取任务信息失败', - delTask: '成功删除任务 {num}', - delTaskTip: '确认删除记录编号为 {num} 的数据项?', + delTaskTip: '确认删除记录编号为 {id} 的数据项?', + stopTask: '成功停止任务 {id}', + stopTaskTip: '确认停止记录编号为 {id} 的任务?', + traceFile: "跟踪文件", + errMsg: "错误信息", + imsiORmsisdn: "imsi 或 msisdn 是空值，不能开始任务", }, }, faultManage: { @@ -1273,7 +1295,15 @@ export default { tailChar: '末尾字数', tailLines: '末尾行数', }, - }, + exportFile:{ + fileName:'文件来源', + downTip: "确认下载文件名为 【{fileName}】 文件?", + downTipErr: "文件获取失败", + deleteTip: "确认删除文件名为 【{fileName}】 文件?", + deleteTipErr: "文件删除失败", + selectTip:"请选择文件名", + } + }, monitor: { session: { userName: "登录账号", @@ -1590,7 +1620,7 @@ export default { edgeTypeLineAnimateState: "直线，含有状态动画", edgeLabelPositionStart: "开头", edgeLabelPositionMiddle: "中间", - edgeLabelPositionEnd: "末尾", + edgeLabelPositionEnd: "末尾", nodeTypeCircle: "圆形", nodeTypeRect: "矩形", nodeTypeEllipse: "椭圆", @@ -1916,8 +1946,8 @@ export default { unlockSure:'确认解锁用户 【{username}】 数据项?', }, }, - menu:{ - menuInfo:'菜单信息', + menu:{ + menuInfo:'菜单信息', menuName:'菜单名称', menuId:'菜单编号', menuSort:'菜单排序', @@ -1949,7 +1979,7 @@ export default { componentTip:' 页面组件目录 views 访问的组件路径,如:system/user/index 注意：不带 .vue 文件后缀路由地址是网络地址可填入链接', perms:`权限标识示例:monitor:server:query 后端控制器中使用权限标识，如：['monitor:server:query'] 前端vue页面中使用权限标识,如:v-perms:has="['monitor:server:query']"` }, - dict:{ + dict:{ dictInfo:'字典类型信息', dictId:'字典编号', dictName:'字典名称', @@ -2028,9 +2058,9 @@ export default { stepInstallText: '选择安装', stepInstallTip: '确认安装选择的网元新版本吗？', stepInstallModal: '网元进行安装', - stepInstallNotNewVer: '没有发现新版本', - stepInstallDone: '安装完成，服务进入初始化', - stepInstallFail: '安装失败，请检查服务终端环境是否可用！', + stepInstallNotNewVer: '没有发现新版本', + stepInstallDone: '安装完成，服务进入初始化', + stepInstallFail: '安装失败，请检查服务终端环境是否可用！', stepLicenseTitle: "网元许可授权", stepLicenseDesc: "获取网元许可激活码进行授权认证", stepLicenseReload: '选择刷新许可证', @@ -2119,6 +2149,30 @@ export default { hostSelectMore: "加载更多 {num}", hostSelectHeader: "主机列表", }, + ps:{ + realTimeHigh:"高", + realTimeLow:"低", + realTimeRegular:"常规", + realTimeStop:"已暂停", + realTime:"实时更新速度", + pid:"PID", + name:"应用名称", + username:"用户名", + runTime:"运行时间", + numThreads:"线程数", + cpuPercent:"CPU使用率", + diskRead:"磁盘读取", + diskWrite:"磁盘写入", + }, + net:{ + PID:"PID", + name:"名称", + localAddr:"localAddr", + remoteAddr:"remoteAddr", + status:"状态", + type:"类型", + port:"接口", + }, }, }, }; diff --git a/src/layouts/BasicLayout.vue b/src/layouts/BasicLayout.vue index 63d21828..9a3f9f4d 100644 --- a/src/layouts/BasicLayout.vue +++ b/src/layouts/BasicLayout.vue @@ -59,7 +59,7 @@ watch( // 路由地址含有内嵌地址标识又是隐藏菜单需要处理打开高亮菜单栏 if (v.path.includes(MENU_PATH_INLINE) && v.meta.hideInMenu) { const idx = v.path.lastIndexOf(MENU_PATH_INLINE); - layoutState.openKeys.splice(-1); + layoutState.openKeys = layoutState.selectedKeys.slice(0, -1); layoutState.selectedKeys[matched.length - 1] = v.path.slice(0, idx); } }, @@ -435,7 +435,8 @@ onUnmounted(() => { } & #serverTimeDom { - color: #00000085; + color: inherit; + opacity: 0.85; transition: all 0.3s; } } diff --git a/src/layouts/components/RightContent.vue b/src/layouts/components/RightContent.vue index 2a57b36c..ded5918c 100644 --- a/src/layouts/components/RightContent.vue +++ b/src/layouts/components/RightContent.vue @@ -64,16 +64,6 @@ function fnClickAlarm() { router.push({ name: 'ActiveAlarm_2088' }); } -/**系统使用手册跳转 */ -function fnClickHelpDoc(language?: string) { - const routeData = router.resolve({ name: 'HelpDoc' }); - let href = routeData.href; - if (language) { - href = `${routeData.href}?language=${language}`; - } - window.open(href, '_blank'); -} - /**改变多语言 */ function fnChangeLocale(e: any) { changeLocale(e.key); @@ -82,23 +72,23 @@ function fnChangeLocale(e: any) {